Two samples of C60 are stirred in H2O and benzene respectively. How would you determine the size of the fullerene

Q: How many chiral carbons are present in the structural formula for the open-chain form of d-mannose?…

A: Concept introduction: Chiral molecules: Molecule is said to be chiral if its mirror image is not…

Q: Which structure is a portion of 1. chitin 2. glycogen 3. Dextran 4. Cellulose? IN-, 1. B 2. A 3. D…

A: the solution is shown below.

Q: How many chiral carbon atoms are in this structure? Br ОН HO. CI

A: Only 2 carbons.

Q: How many chiral carbons are in 2-bromo-2-chloro-3-methylpentane? (a) 0, (b) 1, (c) 2, (d) 3, (e) 4…

A:

Q: How would I be able to look at the compound C2H6 and be able to determine what kind of bond there is…

A: Molecular geometry is the 3-D representation of the molecule in a space. In terms of electron…

Q: (a) || CH3CH2CCHCH3 CH3 (Ь) _CH2CH2CHO

A: IUPAC names : (a)  2-Methylpentan-3-one   (b) 3-Phenylpropanal

Q: What is Markovnikov’s rule?

A: ANSWERE IS GIVEN BELOW ;

Q: Define Semivolatile organic compounds (SVOCs).

A: The organic compound is the compound having main constituents are C, H, O, and N. The organic…

Q: The structural formula for the open-chain form of galactose is CH Н—ҫ—ОН Но—С—н НО—С—Н Н—ҫ—ОН CH-ОН…

A:

Q: Does replacement of hydrogen atom on the oxygen by a CHa, the methyl group, generally results in a…

A: The hydrogen bonding interaction is a type of intermolecular interaction that arises when a molecule…

Q: Which of the following straight chain alkanes has the highest boiling point ? C3H8, C10H22, C7H16,…

A:

Q: the monmer of Polytetrafluoroethylene O a) CF3 O b) CH2 O c) CF1 O d) CF2

A:

Q: How many distinct trichlorobenzene isomers are possible? C) 4 A) 2 B) 3 D) 5 lom E) 6

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: What is the basis or reason behind Markovnikov's Rule?

A: Statement :  Markovnikov's rule states that When a monoprotic acid (HX) is added to an asymmetric…

Q: How does polarized light used for identification of chiral compounds?

A:

Q: Draw the structure of R-3-bromo-2-methylpentane. Clearly show the ranking of the groups on the…

A:

Q: 6. How are fhese selated: (25,3R) 2 bromo 3chloro butane (25,35) 2bromo 3ch loro butane

A:

Q: how would you describe the c-c bonds in benzene? single bonds or double bonds?

A: Benzene i.e. C6H6 shows the resonance that is the delocalisation of unhybridised electrons residing…

Q: Illustrate this phenomenon, compare ethane (CH3CH3), ethylene (CH2=CH2), and acetylene (HC=CH).

A: Since the phenomenon to be explained has not been mentioned, so the general comparison of ethane,…

Q: Which of these alkanes has the lowest boiling point? a) C2H6 b) C4H10 c) C6H14 d) C8H18

A: we know that as the chain increases there is increase  in number of electron in alkane chain and as…

Q: 12. How many hydrogen atoms are needed to saturate the open chain compound C3H12?

A: Organic compounds are also known as hydrocarbons. This is because organic molecules are majorly…

Q: An alkane has 50 hydrogen atoms. How many carbon atoms would it contain if it were  (a) a…

A: We habe to find no. Of carbons from no. Of given Hydrogen

Q: 2. Poly (ethyl acrylate) (EA) and Poly(methyl methacrylate) (PMMA) have the same molecular formula…

A: PEA amd PMMA both different tg( the temperature range where the polymer substrate changes from a…

Q: 1. Explain the following - why stearic acid has higher melting point than decanoic acid. - why…

A: Since you have posted questions with multiple subparts, We will solve the first three parts for you.…

Q: Give the chemical names of the corresponding structures for compounds A and B.…

A:

Q: How many chiral center, if any, would be formed in this structure?

A: Chiral carbon or Chiral center : A chiral carbon atom is a carbon atom that is attached to four…

Q: What is the molecular formula of a hydrocarbon with M^+=166? What is the sum of the rings and…

A:

Q: Account for the following:(i) The C – Cl bond length in chlorobenzene is shorter than that in CH3 –…

A: i)  The C – Cl bond length in chlorobenzene is shorter than C – Cl bond length in CH3 – Cl.  The…

Q: What is the number of isomers of the heptane position? a) 2 b) 3 c) 4 d) 5

A: three on second, third and fourth carbon of seven carbon alkane (heptane) ie, for example…

Q: Would you expect water to dissolve in CCl4? Why?

A: NO Water does not dissolve in carbon tetrachloride (CCl4 ).

Q: 1. Identify the functional groups in the following molecules, and show the polarity of each: NH2…

A: Due to the electronegativity difference between the atom in the bond. Polarity creates as the…

Q: 6. Both neopentane and n-pentane have a C,H2 formula. a. Which compound has a higher boiling point?…

A: a. Clearly n pentane has a higher boiling point beacuse n pentane is an unbranched organic compound…

Q: 1. Carbon atoms always have how many covalent bonds? 2. Hydrogen atoms always have how many covalent…

A: The covalent bond can be defined as a chemical bond which involves sharing of electron pairs between…

Q: Based on molecular forces what type of polymer is neoprene?

A: The word polymer is made of two parts- 'poly' means many and 'mer' means unit. Polymers are large…

Q: HBr 4) diethylacety lene H2O, Hg2*, H2SO4 5) dimethylacetylene

A:

Q: There are 9 different isomers of C7H16. Draw the structures of the 2 isomers of C7H16 that contain…

A: Draw the structures of the 2 isomers of C7H16 that contain 2 methyl branches on the same carbon of…

Q: An alkane has 70 hydrogen atoms. How many carbon atoms would it contain if it were (a) a…

A:

Q: Explain the Markovnikov's Rule ?

A: According to Markovnikov's rule, when a protic acid (HCl ,HBr) is added to an unsymmetrical alkene ,…

Q: What is an isomer? Name the isomers of the compound with the closed formula C4H9CI. Which of these…

A: There are various organic compounds that look similar to each other in terms of their formula.…

Q: Is 3-chloro-3-methylhexane chiral?

A: Chiral means asymmetric in such a way that the structure and its mirror image are not…

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: How do you assign priority in a ring structure when determining if a carbon within the ring is (R)…

A: Assign of priority to the 4 groups in a chiral carbon in a ring is same as the chiral carbon in a…

Q: On your paper draw the L- enatomer (on the straight skeleton structure) for this carbohydrate: CHOH…

A: Draw the L-enantiomer for this carbohydrate.

Q: ОН YHO, ОН H. O, ОН NH2 This is the molecule commonly known as Doxorubicin. Doxorubicin is used in…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 2. Draw the structure of the following compounds 3-ethyl, 1fluorohexane (i) (ii) 2-bromo, 4-chloro,…

A: