Solve correctly please.Final ans should correct.(Gpt/Ai wrong answer not allowed) Use standard reduction potentials to find the equilibrium constant for the following reaction at 25 °C. Round your answer to 2 significant digits.O₂(g) + 411' (aq) 4Fe(aq)211,0(+4Fe³+ (aq)Note: Reference the Standard reduction potentials at 25 C table for additional information.K0.PIncreasing strength as oxidizing agentXTABLE 19.1 Standard Reduction Potentials at 25°C*Half-ReactionF₂(g) + 2e2F (aq)O,(g) + 2H*(aq) + 2eO₂(g) + H₂OCot(aq) +ẻ — Cot(aq)H₂O₂(aq) + 2H(aq) + 2e2H₂OPbO₂(s) + 4H(aq) + SO (aq) + 2e PbSO4(s) + 2H₂OCe+ (aq) + eCe³(aq)MnO4 (aq) + 8H(aq) + 5eMn²+ (aq) + 4H₂OAu³+ (aq) + 3e →→→ Au(s)Cl₂(g) + 2e →→→ 2CT (aq)Cr₂O (aq) + 14H*(aq) + 6e2Cr³+ (aq) + 7H₂OMn² (aq) + 2H₂OMnO₂(s) + 4H(aq) + 2eO₂(g) + 4H (aq) + 4e →→→ 2H₂OBr₂(l) + 2e→2Br (aq)NO3(aq) + 4H* (aq) + 3e¯2Hg²+ (aq) + 2eHg (aq) + 2eAg (aq) + e-Ag(s)Fe (aq)→→→ Fe²+ (aq)O₂(g) + 2H(aq) + 2e-MnO4 (aq) + 2H₂O + 3e1₂(s) + 2e21 (aq)O₂(g) + 2H₂O + 4e →→→40H(aq)Cu²+ (aq) + 2e →→→ Cu(s)-Hg2+ (aq)Be²+ (aq) + 2eMg²+ (aq) + 2e2Hg(1)H₂(g)Pb(s)AgCl(s) +eAg(s) + Cl(aq)Cu (aq)→ Sn²+ (aq)SO (aq) + 4H* (aq) + 2e SO₂(g) + 2H₂OCu²+ (aq) + eSn (aq) + 2e72H*(aq) + 2ePb²+ (aq) + 2eSn²+ (aq) + 2eNi²+ (aq) + 2e2+Co²+ (aq) + 2e - Co(s)PbSO4(s) + 2eCd²+ (aq) + 2eFe2+ (aq) + 2e7Cr³+ (aq) + 3eZn²+ (aq) + 2e2H₂O + 2eMn²+ (aq) + 2eAP+ (aq) + 3e→→→Sn(s)-Ni(s)- Cd(s)-> Fe(s)-Cr(s)→→→ Zn(s)→→Pb(s) + SO (aq)-> Al(s)→→→ Be(s)H₂(g) + 2OH(aq)→Mn(s)Mg(s)Na (aq) + e - Na(s)Ca²+ (aq) + 2e-Ca(s)Sr² (aq) + 2e7Ba²+ (aq) + 2eK'(aq) + eLit (aq) + e→NO(g) + 2H₂O-Sr(s)→→Ba(s)H_O_aq)MnO₂(s) + 4OH(aq)→ > K(s)→ Li(s)E°(V)+2.87+2.07+1.82+1.77+1.70+1.61+1.51+1.50+1.36+1.33+1.23+1.23+1.07+0.96+0.92+0.85+0.80+0.77+0.68+0.59+0.53+0.40+0.34+0.22+0.20+0.15+0.13 =0.00-0.13-0.14-0.25-0.28-0.31-0.40-0.44-0.74-0.76-0.83-1.18-1.66-1.85-2.37-2.71Increasing strength as reducing agent-2.87-2.89-2.90-2.93-3.05*For all half-reactions the concentration is 1 M for dissolved species and the pressure is 1 atm for gases. These are thestandard-state values.

Answered: Image /qna-images/answer/a650fd2a-5cb1-416d-a4de-d094599b04ab.jpg

Use standard reduction potentials to find the equilibrium constant for the following reaction at 25 "C. Round your answer to 2 significant digits. 0₂(g) + 411¹(ag) 4Fe²(aq)21.0(-4Fe (ag) Note: Reference the Standard reduction potentials at 25 C table for additional information. TABLE 19.1 Standard Reduction Potentials at 25°C* Half-Reaction E°(V)

Use standard reduction potentials to find the equilibrium constant for the following reaction at 25 "C. Round your answer to 2 significant digits. 0₂(g) + 411¹(ag) 4Fe²(aq)21.0(-4Fe (ag) Note: Reference the Standard reduction potentials at 25 C table for additional information. TABLE 19.1 Standard Reduction Potentials at 25°C* Half-Reaction E°(V)

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 160MP

See similar textbooks

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Given the following two standard reduction potentials, solve for the standard reduction potential of the half-reaction M3++eM2+ (Hint: You must use the extensive property G to determine the standard reduction potential.)
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.