“Pick one” Positive Negative Unknown Use the observations about each chemical reaction in the table below to decide the sign (positive or negative) of the reaction enthalpy AH and reaction entropyAS.Note: if you have not been given enough information to decide a sign, select the "unknown" option.reactionobservationsconclusionsΔΗ is(pick one)This reaction is always spontaneous, butproceeds faster at temperatures belowA.109. °C.AS is(pick one) VThis reaction is spontaneous only aboveAH is (pick one) ♥21. °C but proceeds at a slower rate belowB192. °C.AS is(pick one) VAH is (pick one) VThis reaction is spontaneous only below120. °C.AS is(pick one) vExplanationCheckPrivacy2021 McGraw-Hill Education. All Rights Reserved Terms of Use

We have to tell which option is correct

Use the observations about each chemical reaction in the table below to decide the sign (positive or negative) of the reaction enthalpy AH and reaction entrop AS. Note: if you have not been given enough information to decide a sign, select the "unknown" option. ponglucione

Use the observations about each chemical reaction in the table below to decide the sign (positive or negative) of the reaction enthalpy AH and reaction entrop AS. Note: if you have not been given enough information to decide a sign, select the "unknown" option. ponglucione

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter10: Entropy And The Second Law Of Thermodynamics

Section: Chapter Questions

Problem 10.51PAE: 10.51 The combustion of acetylene was used in welder's torches for many years because it produces a...

See similar textbooks

Related questions

Q: 5. The chemical reaction presented below is not balanced. Balance it and calculate AH° and ASurr for…

A: CO(g) + H2(g) ----> CH3OH (l)

Q: Use standard enthalpies of formation to determine the ΔHo in kJ for the following reaction: 4NH3(g)…

Q: Without doing any calculations, match the following thermodynamic properties wvith their appropriate…

A: Gibbs free energy ∆G = ∆H - T∆S used

Q: When 25.0 mL of 1.0 M H₂SO is added to 50 ml of 1.0 M NaOH at 25 °C in a calorimeter, the…

A: ∆H in kJ can be calculated using formula : ∆H = -q Where , q is heat released or absorbed and is…

Q: Calculate the theoretical heat of reaction between the Zn and copper sulphate using the following…

Q: Using the provided table, determine the enthalpy (in kJ/mol) for the reaction C,H, (g) + 5 0, (g) –…

Q: One reaction for producing carbon monoxide and hydrogen is: 3 CH4 (g) + 2 H2O (l) + CO2 (g) ---> 4…

A: The standard enthalpy change for given reaction is +747.5 kJ/mol. And all the required calculation…

Q: Part of the industrial recovery of elemental zinc from the zinc sulfide ore is by roasting: ZnSja +…

Q: 3. In an experiment, 5.260 g of potassium hydroxide is mixed with a dilute solution of hydrochloric…

Q: Using the provided table, determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO₂ (g)→…

A: Determine the molar enthalpy (in kJ/mol) for the reaction C(s) + CO₂ (g)→ 2 CO (g)

Q: Consider the exothermic reaction. 4NH3(g)+5O2(g)→4NO(g)+6H2O(g) Calculate the standard heat of…

Q: A sample of sucrose, C12H22O11 weighing 0.1328 g, was burned to completion in a bomb calorimeter at…

A: Given: sucrose sample weight = 0.1328 g, Temperature = 25°C,…

Q: For the reaction below, determine the difference in relevant particles that allow for determination…

Q: A sample consisting of 3.0 mol CaCO3 (s) was heated to 800 oC, at which temperature the solid…

A: Interpretation - Given a sample consisting of 3.0 mol CaCO3 (s) was heated to 800 oC, at which…

Q: , When 25.0 mL of 1.00M HNO3at 25.0oC is added to 25.0 mL of 1.00M KOH at 25.0oC in a coffee cup…

A: The reaction of acid and base results in the formation of salt and water and heat is evolved. This…

Q: The value ΔH0 of for the reaction 2Ba(s) + O2(g)→ 2BaO(s)is -1107 kJ. Determine the heat released…

A: The enthalpy of a reaction is the heat that is released or absorbed in a chemical reaction that…

Q: 50 mL of 2.2 M HCI is combined with 50 mL of 2.0 M NAOH in a coffee-cup calorimeter. The temperature…

A: Hello. Since multiple questions have been posted, the first question shall only be solved in this…

Q: The combustion reaction for butane is C4H10(g) + 6.5 O2(9) → 4 CO2(g) + 5 H20(g). Is the internal…

A: According to the first law of thermodynamics, the energy of the universe remains constant. For the…

Q: Calculate the standard enthalpy for the following reaction at 25°C: C(graphite) + H20(g) → CO(g) +…

A: The enthalpy of the formation of the element or molecule at its their standard state is zero. Like…

Q: Gaseous SO2Cl2 reacts with liquid water to form hydrogen chloride gas and liquid sulfuric acid.…

A: Given: Gaseous SO2Cl2 reacts with liquid water to form hydrogen chloride gas and liquid sulfuric…

Q: 1. Define the following term: enthalpy. * Heat transfer at constant temperature. E+ PV O Heat flow…

A: Enthalpy is a property of thermodynamics, defined as the sum of the system's internal energy and the…

Q: O THERMOCHEMISTRY Calculating a molar heat of reaction from formation enthalpies 0/5 Using the table…

Q: The ΔH for the oxidation of sulfur in the gas phase to SO3 is -204 kJ/mol and for the oxidation of…

A: The enthalpy of reaction (ΔH0rxn) is the heat released or absorbed during a chemical reaction.…

Q: 27. Given the standard enthalpies of formation for the following substances, determine the reaction…

A: The given reaction for which the enthalpy is to be determined is given below : The heat of…

Q: A calorimeter contains 20.0 mL of water at 14.5 ∘C . When 1.20 g of X (a substance with a molar mass…

A: From the given information, we can calculate the mass of water (solvent) and the mass of the…

Q: Chemists have been performing experiments with the newly discovered element X to determine its…

A: The reaction given is And ΔHo for the reaction = -191 KJ Given : Under standard conditions, X is…

Q: Explain how is enthalpy related to spontaneity of a reaction?

A: The Gibbs free energy is related with enthalpy and entropy. It is shown by the formula given below.

Q: A 2.50 g sample of powdered zinc is added to 100.0 mL of a 2.00 M aqueous solution of hydrobromic…

A: Given:- •2.50g of sample of zinc powder • 100ml of 2M HBr solution. •Total heat capacity of…

Q: Use standard enthalpies of formation to determine ΔHorxnfor: 2C2H2(g) + 5O2(g) → 4CO2(g) + 2H2O(l)…

A: Standard enthalpy of formation is defined as the amount of heat absorbed or evolved in the formation…

Q: 26 The standard enthalpy change for the following reaction is 6492.0 kJ/molpxn: What mass (in g) of…

A: Standard enthalpy of formation is the energy change during formation of respective compound.

Q: Use the data given below to find the enthalpy of reaction for the following reaction: CaCO3(s) →…

Q: We can use Hess’s law to calculate enthalpy changes thatcannot be measured. One such reaction is the…

A: The ans is as given below:

Q: In a chemical reaction, the change in enthalpy and the change in enthalpy and the change in etropy…

Q: 5.00 g of potassium hydroxide (molar mass = 56.1 g/mol) dissolves in 100.0 g of water and the…

Q: Using the table of standard formation enthalpies that you'll find under the ALEKS Data tab,…

Q: a. Calculate the theoretical heat of reaction between the Zn and copper sulphate using the following…

A: For question A, we use the given formula to calculate the theoretical heat of reaction.

Q: Using the reactions below, determine the enthalpy of the following reaction 1 g S8(s) + 02(g) →…

A: Enthalpy of a chemical reaction can be calculated from the heat of the given reactions.

Q: A 2.50 g sample of powdered zinc is added to 100.0 ml.L of a 2.00 M aqueous solution of hydrobromic…

A: Given that Mass of zinc = 2.50 gTotal heat capacity = 448 J/KIncreases in temperature = 21.1 K To…

Q: Which of the following is a statement of Hess's law? If a reaction is carried out in a series of…

A: Thermodynamics is branch of chemistry in which we deal with amount of heat absorbed or evolved…

Q: Consider the following reactions: W(s) + C(graphite) ---> WC(s) What is the enthalpy of reaction (in…

A: Interpretation- To determine the enthalpy of the reaction ( in KJ) which is given as W(s) +…

Q: Consider the following reaction and the tabulated thermochemical data at 298 K. 4 NH3(g) + 5 O2(g) →…

Q: When HCl(aq) and NaOH(aq) are mixed in a beaker, the beaker feels warm to the touch. What is known…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Consider the exothermic reaction 4NH3(g)+5O2(g)→4NO(g)+6H2O(g)4NH3(g)+5O2(g)→4NO(g)+6H2O(g)…

Q: Determine the standard enthalpy of reaction, AH°n, of the reaction below, given the following…

A: Mg(s) + 2H2O(l) ---> Mg(OH)2(s) + H2(g)

Q: Consider the enthalpy diagram of an exothermic reaction. Where are the reactants in relation to the…

A: The diagramme is given below.

Q: The value of ∆G0 for forming water from elemental oxygen and hydrogen is -237kJ/mol. 2H2 +O2 -->…

A: ∆S° = [ sum of standard entropies of products ] - [ sum os standard entropies of Reactants ] Given…

Q: (a) Magnesium reacts with hydrochloric acid to produce hydrogen gas. AH°, for HCI(aq) = -167.16…

A: Enthalpy change of the reaction is given as follows. ∆H = ∆H(products) - ∆H(Reactants). As per our…

Q: 10. Hydrazine (N,H,) is a fuel used by some spacecraft. It is normally oxidized by N,0, according to…

A: Given reaction; N2H4 (l) + N2O4 (g) -------> 2N2O(g) + 2H2O(l) Enthalpy of reaction is…

Q: The value of AH° for the reaction below is -336 kJ. Calculate the heat (kJ) released to the…

A: We have a reaction, CH4 + 3Cl2 → CHCl3 + 3HCl , ΔH = –336kJ we need to find heat released when…

Question

“Pick one” Positive Negative Unknown

Use the observations about each chemical reaction in the table below to decide the sign (positive or negative) of the reaction enthalpy AH and reaction entropy
AS.
Note: if you have not been given enough information to decide a sign, select the "unknown" option.
reaction
observations
conclusions
ΔΗ is
(pick one)
This reaction is always spontaneous, but
proceeds faster at temperatures below
A.
109. °C.
AS is
(pick one) V
This reaction is spontaneous only above
AH is (pick one) ♥
21. °C but proceeds at a slower rate below
B
192. °C.
AS is
(pick one) V
AH is (pick one) V
This reaction is spontaneous only below
120. °C.
AS is
(pick one) v
Explanation
Check
Privacy
2021 McGraw-Hill Education. All Rights Reserved Terms of Use

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Quality Assurance and Calibration Methods

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.
10.51 The combustion of acetylene was used in welder's torches for many years because it produces a very hot flame: C2H2(g)+52O2(g)2CO2(g)+H2O(g) H= -1255.5 kJ (a) Use data in Appendix E to calculate S for this reaction, (b) Calculate G and show that the reaction is spontaneous at 25°C. (c) Ls there any temperature range in which this reaction is not spontaneous? (d) Do you think you could use Equation 10.4 to calculate such a temperature range reliably? Explain your answer.
For the reaction NO(g)+NO2(g)N2O3(g) , use tabulated thermodynamic data to calculate H and S. Then use those values to answer the following questions. (a) Is this reaction spontaneous at 25°C? Explain your answer. (b) If the reaction is not spontaneous at 25°C, will it become spontaneous at higher temperatures or lower temperatures? (c) To show that your prediction is accurate, choose a temperature that corresponds to your prediction in part (b) and calculate G . (Assume that both enthalpy and entropy are independent of temperature.)
Thermite reactions have been used for welding metal parts such as railway rails and in metal refining. One such thermite reaction is Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(s). Is the reaction spontaneous at room temperature under standard conditions? During the reaction, the surroundings absorb 851.8 kJ/mol of heat.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)
The reaction shown below is involved in the refining of iron. (The table that follows provides all of the thermodynamic data you should need for this problem.) 2Fe2O3(s)+3C(s,graphite)4Fe(s)+3CO2(g) (a) Find H for the reaction. (b) S for the reaction above is 557.98 J/K. Find S° for Fe2O3(s). (c) Calculate G for the reaction at the standard temperature of 298 K. (There are two ways that you could do this.) (d) At what temperatures would this reaction be spontaneous? Compound Hf (kJ mol-1) S° (kJ mol-1) Gf (J mol-1 K-1) Fe2O3(s) -824.2 ? -742.2 C(s, graphite) 0 5.740 0 Fe(s) 0 27.3 0 CO2(g) -393.5 213.6 -394.4.83
Methane can be produced from CO and H2.The process might be done in two steps, as shown below, with each step carried out in a separate reaction vessel within the production plant. Reaction 1 CO(g)+2H2(g)CH3OH(l) S = -532 J/K Reaction 2 CH3OH(l)CH4(g)+12O2(g) S= +162 J/K NOTE: You should be able to work this problem without using any additional tabulated data. (a) Calculate H for reaction 1. (b) Calculate Gf for CO(g). (c) Calculate S° for O2(g). (d) At what temperatures is reaction 1 spontaneous? (e) Suggest a reason why these two steps would need to be carried out separately. Substance Hf (kJ mol-1) Gf (kJ mol-1) S (J mol-1 K-1) CO(s) -110.5 197.674 CH3OH( l ) -238.7 -166.4 126.8 CH4(g) -74.8 186.2
How does the second law of thermodynamics explain a spontaneous change in a system that becomes more ordered when that process is exothermic?
The enthalpy of vaporization of ethanol is 38.7 kJ/mol at its boiling point (78C). Determine Ssys, Ssurr, and Suniv when 1.00 mole of ethanol is vaporized at 78C and 1.00 atm.
9.54 The phase change between graphite and diamond is difficult to observe directly. Both substances can be hurned, however. From these equations, calculate H for the conversion of diamond into graphite. C(s,graphite)+O2(g)CO2(g) H= -393.51 kJ C(s,diamond)+O2(g)CO2(g) H= -395.94 kJ
Using tabulated thermodynamic data, calculate G for these reactions. (a) Mg3N2(s)+6H2O(l)2NH3(g)+3Mg(OH)2(s) (b) 4CH3NH2(g)+9O2(g)4CO2(g)+10H2O(l)+2N2(g) (c) Fe3O(s)+4CO(g)3Fe(s)+4CO2(g) (d) P4O10(s)+6H2O(l)4H3PO4(aq)