Answered: Consider the enthalpy diagram of an…

Consider the enthalpy diagram of an exothermic reaction. Where are the reactants in relation to the products on the H scale (y axis)?

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter15: Energy And Chemical Change

Section15.2: Heat

Problem 17SSC

See similar textbooks

Related questions

Q: Consider the following reaction: CH, (9) + 20, (9) → CO2(9) + 2H, O(1) AH =-891 kJ a. Calculate the…

A: The balanced reaction taking place is given as, ΔH = -891…

Q: Use the given information to determine the enthalpy of the reaction 2 M(s) + 3 Cl,(g) – 2 MCI, (s)

A: Step : 1 Find the enthalpy of the reaction.

Q: From a consideration of the reaction 2NO(g) + O2(g)  2NO2(g) H = 114.1 kJ if 2.00 * 10^2 g of…

A: given mass of NO2 = 2*102 g

Q: 14. A 222.5 mg sample of sucrose (C12H22O11) is combusted in a bomb calorimeter. The temperature of…

Q: Using the provided table, determine the enthalpy for the reaction: C₃H₈(g) + 5O₂(g) → 3CO₂(g) +…

A: Given information, ΔH0 C3H8 = −108.4 kJ/mol ΔH0 O2 = 0 kJ/mol ΔH0 CO2 = −393.5 kJ/mol ΔH0…

Q: Calculate the amount of heat released

A: Number of moles = mass/molar mass Molar mass of MgO is 40.3044 g/mol

Q: If a student performs an endothermic reaction in a calorimeter, how does the calculated value of ∆H…

A: An endothermic reaction is the one that takes in energy, overall.

Q: What does "Enthalpy change of a chemical reaction" mean?

A: Enthalpy change of a chemical reaction is defined as the amount of heat released or absorbed in the…

Q: Consider the following reaction: CH4 (9) + 20, (9) → CO2 (g) + 2H, O(1) AH=-891 kJ a. Calculate the…

A: We have enthalpy of combustion of methane as -891 KJ. a) we have to calculate the enthalpy change…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: how to write the enthalpy cycle?

A: The previous answer has shown all the necessary calculations and enthalpy changes. In case you want…

Q: An engineering student wants to study the heat transfer between a 50 g of heated block of iron (cFe…

Q: 9. The evaporation of water is endothermic: H2O (1) → H2O (g) AH°rxn = 44.01 kJ/mol What minimum…

A: H°rxn = 44.01 kJ / mol

Q: Describe how chemists use Hess’s law to determine the ΔH°f of a compound by measuring its heat…

A: To find: How the Hess's law used to determine the ΔH°f of a compound by measuring its heat…

Q: What is the change in enthalpy (ΔH) for a chemical reaction?How is ΔH different from ΔE?

A: In thermodynamics various terms are used. Some of these terms are work, heat, change in enthalpy,…

Q: Sand is converted to pure silicon in a three step process. The third step is SiCl4(g) + 2Mg(s) →…

A: Given:SiCl4(g) + 2Mg(s) → 2MgCl(s) + Si(s) ΔH = –625.6 kJ

Q: If 20.0 g of CH4 reacts with excess oxygen, what is the change in enthalpy for the reaction?…

A: The reaction considered is the combustion of methane and it is exothermic.

Q: Draw an enthalpy diagram for a general exothermic reaction; label the axis, reactants, products, and…

Q: What is a standard state? What is the standard enthalpy change for a reaction?

A: Standard state of a material is the reference point that is used to calculate its properties under…

Q: Suppose that 0.250 mol of methane, CH4(g), is reacted with 0.400 mol of fluorine, F2(g), forming CF…

A: 0.250 mol of methane is reacted with 0.400 mol of fluorine.

Q: Define standard enthalpy.

Q: Is the total enthalpy (H) of the reactants more than or less than the total enthalpy of the products…

Q: Determine the enthalpy change for the following reaction when 10.9 g of NH3 is formed. N2 (g) + 3…

Q: Why do we measure the enthalpy of a chemical reaction?

A: A thermodynamic property of a system is known as enthalpy. The sum of internal energy and product of…

Q: 2. The work done when a gas expands in a cylinder is 264 J. During the process, there is a heat…

Q: Consider the following reaction between nitrogen and hydrogen gases. N2(g) + 2H2(g) → N2H4(g) ΔH…

Q: For a given sample of CH3OH, the enthalpy change during the reaction is 82.3 kJ. How many grams of…

A: The reaction will be:

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction?…

A: Given reaction:

Q: Decomposition reactions are usually endothermic, whereas combination reactions are usually…

A: Endothermic reaction is a process that absorbs energy from the surroundings. In decomposition…

Q: A calorimeter is used to measure the enthalpy of a reaction. Label the system and the surroundings.

Q: The amount of energy required to raise the temperature of a substance by 1 K (1 °C) is its heat…

A: We have to conclude what is the term called in chemical thermodynamics when 1g of substance is…

Q: What are the assumptions that are made when performing calorimetry to determine molar enthalpies?…

A: Calorimeter : A calorimeter is a insulated device used for heat measurements. It mainly consists of…

Q: What is the definition of enthalpy? O a. Heat flow in a chemical reaction at constant temperature O…

A: Enthalpy is Heat flow in a chemical reaction at constant pressure.

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction?…

A: Enthalpy change of a reaction is calculated by subtracting the sum of enthalpies of formation of…

Q: Consider the hypothetical reaction: A + 3B → 2C, which gives ΔH0= 357.2 kJ. Determine the enthalpy…

A: Exothermic reaction releases the energy during occurrence. Here, the enthalpy of the substrates is…

Q: CH4 + 202 → CO₂ + 2H₂O AH-890kJ/mol How much heat is released when 2.7 g of methane gas is burned in…

A: Here we are required to find heat released when 2.7 gm of methane is burnt

Q: If a student performs an endothermic reaction in a calorimeter, how does the calculated value of ΔH…

Q: From a molecular viewpoint, where does the energy absorbed in an endothermic chemical reaction go?…

A: In an endothermic reaction energy flows from surroundings to system (chemical molecules composing…

Q: According to the following reaction, what is the change in enthalpy (kJ) per mole of the reaction?…

A: Enthalpy of Reaction: The difference in enthalpy between products and reactants ( HrxnHrxn ) is the…

Q: What is the change in enthalpy (∆H) for a chemical reaction?How is ∆H different from ∆E?

A: In thermodynamics various terms are used. Some of these terms are work, heat, change in enthalpy,…

Q: determine the enthalpy change for the complete combustion of one mole of ethane with oxygen gas to…

Q: Use standard enthalpies to determine the enthalpy change from the following reaction occurring:…

Q: What is meant by the term standard conditions with reference to enthalpy changes?

A: Thermodynamic is the branch of chemistry that mainly deals with the heat transfer between system and…

Q: 21.0°C to 27.5°C. calculate the enthalpy change for the reaction in kJ/mol HCl, assuming that the…

A: We need to calculate the enthalpy change for reaction of HCl and NaOH using the given data.

Q: Consider the reaction: 2C4H10g) + 1302(g) 8CO28) + 10H20(), AH = -5756 kJ When a 0.571 mol of C4H10…

Question

100%

Consider the enthalpy diagram of an exothermic reaction. Where are the reactants in relation to the products on the H scale (y axis)?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
Assume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)
9.41 Under what conditions does the enthalpy change equal the heat of a process?
Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.
9.73 Without looking up any numerical data or doing calculations, predict whether the enthalpy change for each of the following reactions should he positive, negative, or zero. (a) H2O(l)H2O(s) (b) N2(g)2N(g) (c) CH4(g)+2O2(g)CO2(g)+2H2O(l) (d) CO2(s)CO2(g)
In a calorimetric experiment, 6.48 g of lithium hydroxide, LiOH, was dissolved in water. The temperature of the calorimeter rose from 25.00C to 36.66C. What is H for the solution process? LiOH(s)Li(aq)+OH(aq) The heat capacity of the calorimeter and its contents is 547 J/C.
One step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?