What is the IUPAC name for the molecule shown? CI O (2R55Z)-4-chloro-N-ethyl-N.1,5-trimethylhex-3-en-1-amine O (2R55Z)-4-chloro-N-ethyl-N.15-trimethyhex-3-en-1-amine O (2R55.2)-4-chloro-N-ethyl-N.1.5-trimethyhex-3-en-1-amine O (2R55.Z)-4-chloro-N-ethyl-N1.5-trimethylhex-3-en-1-amine O (2R55.Z)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine O (25.55.2)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine O (2RSRZ)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine (2R55E)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine

What is the IUPAC name for the molecule shown? CI O (2R55Z)-4-chloro-N-ethyl-N.1,5-trimethylhex-3-en-1-amine O (2R55Z)-4-chloro-N-ethyl-N.15-trimethyhex-3-en-1-amine O (2R55.2)-4-chloro-N-ethyl-N.1.5-trimethyhex-3-en-1-amine O (2R55.Z)-4-chloro-N-ethyl-N1.5-trimethylhex-3-en-1-amine O (2R55.Z)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine O (25.55.2)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine O (2RSRZ)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine (2R55E)-4-chloro-N-ethyl-NS-dimethylhept-3-en-2-amine

Organic Chemistry: A Guided Inquiry

2nd Edition

ISBN:9780618974122

Author:Andrei Straumanis

Publisher:Andrei Straumanis

ChapterNW1: Nomenclature Worksheet 1: Naming Alkanes & Cycloalkanes

Section: Chapter Questions

Problem 1CTQ

See similar textbooks

Similar questions

1,4-Pentadiene (CH2=CH-CH2-CH=CH2) is a liquid at room temperature and has a density of 0.66 g/mL and molar mass of 68.12 g/mol. In a laboratory experiment, 3.80 mL of this compound was treated with 4.80 mL of conc. H2SO4 (100% w/w; molar mass 98.08 g/mol). Note that the density of conc. H2SO4 is 1.84 g/mL. The resulting sulfate ester was then treated with 1.20 mL of water (molar mass 18.02 g/mol) affording, after work- up, 2,4-pentanediol (molar mass 104.15 g/mol) as the crude product. The crude product was then purified by simple distillation, which yielded 2.00 g of pure product. What is the theoretical yield of 2,4-pentanediol expressed in grams? Show calculations. What is the percentage yield of pure 2,4-pentanediol?
1,4-Pentadiene (CH2=CH-CH2-CH=CH2) is a liquid at room temperature and has a density of 0.66 g/mL and molar mass of 68.12 g/mol. In a laboratory experiment, 3.80 mL of this compound was treated with 4.80 mL of conc. H2SO4 (100% w/w; molar mass 98.08 g/mol). Note that the density of conc. H2SO4 is 1.84 g/mL. The resulting sulfate ester was then treated with 1.20 mL of water (molar mass 18.02 g/mol) affording, after work- up, 2,4-pentanediol (molar mass 104.15 g/mol) as the crude product. The crude product was then purified by simple distillation, which yielded 2.00 g of pure product. a. Provide a balanced chemical equation to show the reaction between 1,4-pentadiene and sulfuric acid. Do not use molecular formulas in the chemical equation except for sulfuric acid. b. What reactant is the limiting reagent in this chemical equation? Show calculations to support your answer.
2. Give each of the following compounds an appropriate name.a. (C2H5)2Ob. CH3(CH2)2C(OH)(CH3)C2H5c. CH2OH(CH2)3CH(OH)CH3d. CH3CH2OCH2(CH3)C3H7 (n)e. CH3OC6H9 (neo
1. name the following compund ( see attachment) 2. Solve for the value of x in the following combustion reaction of a particular alkane in the presence of heat, CH3(CH2)xCH3 + yO2 → zCO2 + 14 H2O A. 4 B. 3 C. 15 D. 11 E. 5
Compound X is insoluble in cold KMnO4, Br2 in CCl4, and conc. H2SO4. Compound X is most likely: a. an alkane b. none of these c. an alkene d. an alcohol e. an alkyl halide Indicate which of the ff. statements regarding nucleophilicity is incorrect. F- is more nucleophilic, hence, more reactive towards methyl iodide than Cl-. Second row elements are more nucleophilic than first row elements of comparable basicity. The rate of SN2 reaction may be markedly affected by the nucleophilicity of the attacking atom. Nucleophilicity is the affinity of a nucleophile to an electrophilic carbon Which of the following alkynes can be deprotonated by NaNH2 in liquid NH3? 3-Methylhex-2-yne Pent-2-yne 3-Methylbutyne none of these Hex-3-yne
Using the numbering scheme below, which carbons are tertiary (3°) and quaternary (4°)?
Rank the following groups in order of decreasing priority. −H, −CH3, −Cl, −CH2Cl
Draw out a reaction for 2-chloro-2-methylbutane and KOH, naming each product (if more than one)
Please help with the following... Draw the bond line structures for the reactants and the products obtained in the following reactions: 1. m-chlorocumene +NaNiPr2, HNiPr2 2. 4-tertbutyl-3-methyl anisole + HNO3, H2SO4 3. o-isopropyl acetophenone + PhCH2COCl, AlCl3
2- Propose the structure that matches the following H1NMR data: C5H8CL2F2 δ 2.4 (singlet, 3H) δ 2.8 (singlet, 3H) δ 9.5 (singlet, 2H) C5H8CL2F2 δ 2.6 (singlet, 3H) δ 4.7 (singlet, 1H) C6H11F3 δ 1.8 (singlet, 6H) δ 3.1 (triplet, 2H) δ 4.5 (triplet, 2H) δ 8.0 (singlet, 1H) C4H10O2 δ 1.5 (doublet, 3H) δ 3.4 (multiplet, 1H) δ 3.8 (doublet, 4H) δ 4.2 (wide peak, 2H) This peak disappears when D2O is added. C4H10O2 δ 3.0 (singlet, 3H) Addition of D2O has no effect on the spectrum. δ 4.2 (singlet, 2H) C6H10O2 δ 1.5 (doublet, 3H) Addition of D2O has no effect on the spectrum. δ 1.9 (singlet, 3H)…
Do the following conversions in not more than two steps:(i) Benzoic acid to benzaldehyde(ii) Ethyl benzene to Benzoic acid(iii) Propanone to Propene
here's the reaction to be used for reference: C2H4 + H2 --> C2H6 1. What type of reaction is involved in C2H4 + H2 --> C2H6? 2. What is C2H4 in the reaction? 3. What is the name of the product in the reaction? a. ethane b. ethene c. ethyne