What is the IUPAC name of the following compound? a. 2-isopropyl-5-methylpentane b. 5-isopropyl-2-methylpentane C. 2,3,5-trimethylhexane d. 1,2-diisopropylpropane

Q: Convert the structure to IUPAC name or IUPAC name to structure, as appropriate. Structure IUPAC Name…

A:

Q: What is the molecular formula for a hydrocarbon with 23 carbons that is (a) completelysaturated; (b)…

A:

Q: Draw condensed structural formulas for the following molecules.    a) 3-ethylpentan-2-one…

A: Given :-  IUPAC names of compounds :-  a)3-ethylpentan-2-one b) 2-ethoxy-3-methylhexane  To draw :-…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: Rules for naming the organic compound is as follows; Select the longest continuous carbon chain.…

Q: 6. Draw the condensed structural diagram and then the line structural formula for each of the…

A: Condensed formula of compound indicates the no. of different atoms present in the molecule. Line…

Q: Provide the IUPAC name the compound CH3(CH2)4-C=C-CH2CH=CH(CH2)7CH3. Parent name: Locants: IUPAC…

A: Given compound is :

Q: 7.Draw structural diagrams for the following: a) O-diethylbenzene b) 4-methyl-2-pentyne c)…

A: Answer 7 :  Draw the structural diagram for the following :  a) o- diethylbenzene. b)…

Q: What is a Propane

A: Porpane is a Hydrocarbon which contain 3 carbon atoms and 8 hydrogen atom. Proapne = C3H8

Q: The IUPAC name for the molecule above is A: 4-ethylhexane B: 1-hexylethane C: 3-propylpentane D:…

A: To write the IUPAC name of the below compound.

Q: DRAW the structure given the IUPAC name 4-Bromo-4-ethyl-2-methylhexane

A:

Q: (b) Draw structures corresponding to the following IUPAC names. (a) 3,4-Dimethylnonane (c)…

A:

Q: True or False: 1. The single bond is the only type of covalent bond that always rotates freely. 2.…

A: Free rotation around a single bond occurs readily while rotation around double bond is restricted.…

Q: For each, draw a structural diagram (line, condensed or complete) 9. 2-methyl-l-pentene 10. 2-butene…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: a) indicate the structural formula of the product/s formed  b) name the organic product formed  c)…

A: The aromatic compounds undergo electrophilic substitution reactions which are as follows-  1-…

Q: Draw the structural formula for each of the following.   a.3-isobutylhexane…

A: This question is answered by using the simple concept of writing the structural formula using the…

Q: How do structures of these IUPAC names look like? 2-Propoxy-1-(2-propoxyethoxy)propane   Please…

A:

Q: (a ) A diethyldimethylhexanc (b) A (3-methylbutyl)-substituted alkane

A: IUPAC nomenclature  is a method of naming organic compounds as recommended by international union of…

Q: How many different alkenes can be hydrogenated to form a. butane? b. 3-methylpentane? c. hexane?

A: Using same number of carbon atoms for alkene as that of alkane which has to be synthesized.

Q: Draw the structure of 3-benzylpentane.

A: 3-benzylpentane is a hydrocarbon in  which benzyl group is attached to the 3rd position in pentane.…

Q: Explain the role of London dispersion forces on the melting and boiling points of alkanes.

A: Alkanes are non-polar molecules with no ions present in the structure. There is the absence of an…

Q: B. List a structure for the following compounds: a) 2,4,4-trimethylheptane b)…

A:

Q: How do structures of these IUPAC names look like? e) 2-Propoxy-1-(2-propoxyethoxy)propane

A:

Q: Does pencillin contains alkene or alkane functional group ?

A: The structure of pencillin is given as,

Q: Consider the following test sample: hexa

A: Bromine water test : This is used to test for unsaturation i.e alkene and alkyne can give this…

Q: Draw and name all of the structural isomers of a) pentane and b) hexan

A: Structural isomers are isomers where the atoms are organized in a different order but have the same…

Q: CH2-CH2-CH3 Type of functional group r. CH2-CH2-CH3 Common Name K* S. Type of functional group H3C…

A:

Q: B. Draw the Structural formula for the given hydrocarbons. 1.) Decane 2.) 2- Pentene 3.) 3- Hexyne

A: Structural formula:

Q: name 3 different structural isomers for hexane

A: Answer:- This question is answered by using the simple concept of writing the structural isomers and…

Q: Consider the following test samples: A. heptane   D. toluene B. hexane   E. benzene C. hexene…

A: In the given question, the species possessing a reactive functionality will give this reaction,…

Q: What is the correct IUPAC name of the organic compound produced in the largest amount when 1-butene…

A: The solution is given below -

Q: CH,CH,CH3 CH,CCH,CH3 OH

A:

Q: a. List 3 differences between organic and inorganic compounds: b. Explain the property of solubility…

A: Organic chemistry concern with the chemistry of carbon and their compounds where as  inorganic…

Q: Why are alkanes used more as fuels than alkenes

A: Alkanes are saturated hydrocarbons, they are (mostly) liquid in a room temperature. They are…

Q: How do structures of these IUPAC names look like? d) 4-Mercapto-3-methylthiopentene

A: A question based on nomenclature that is to be accomplished.

Q: How would you synthesize each of the following?a. 1,2-dibromopropane from propeneb. acetone…

A: Since you have asked a question with a multiple subpart we will solve the first 3 sub-parts. If you…

Q: Consider the following organic molecules: A) Butanone B) 3-methyl-3-pentanol C)…

A:

Q: 1. For each of the following IUPAC names, draw a structural diagram. (a) 2-methylpentane (b) octane…

A:

Q: CH2-CH3 у. Type of functional group CH2-CH3 Common Name 1

A: functional group of 1 is ketone  common name is propiophenone iupac name is 1-phenylpropan-1-one

Q: Draw the structure for the given IUPAC naming (3S)-1-chloro-3-methyl hexane

A: We have given the IUPAC name of compound as follow         (3S)-1-chloro-3-methyl hexane And the…

Q: I want to study thiols and bad-smelling organic natural and artificial chemicals, these topics can…

A: The carboxylic acid functional group is depicted as R-COOH, where R group can be an alkyl or aryl…

Q: How many total covalent bonds are present in the compound? (Please refer to the first image…

A: Covalent bond:  Covalent bond is formed due to sharing of electrons    IUPAC rules:  1. Choose the…

Q: Convert propan-2-ol [(CH3)2CHOH] to attached compound. You may use any other organic or inorganic…

A: Convert propan-2-ol [(CH3)2CHOH] to attached compound.

Q: Which of the following statements about the organic molecule is false? A. Isomer with ethyl…

A: a. The chemical formula of ethylpropyl ether is: C5H12O. But the given compound has molecular…

Q: Draw the structure corresponding to following  IUPAC name. 3-ethyl-2-methylhexane

A: Given, 3-ethyl-2-methylhexane

Q: Explain Polysubstituted Benzenes ?

A: In the benzene ring if the single hydrogen are replaced by a functional group it is known as mono…

Q: What is the structure of 2-methyl-3-hexene

A: To draw the structure of given organic compounds we have to follow these steps  (1) draw the longest…

Q: Do saturated and unsaturated hydrocarbons show similar observable positive results in all tests?

A: Hydrocarbons are compounds of hydrogen and carbons. These are classified into two types on the basis…

Q: Draw the structures corresponding to the following names(a) 2-chloro-3,3-dimethylhexane (b)…

A: In the IUPAC name, the last name has the longest chain name with a functional group, if any, and the…

Q: The IUPAC name 4-hexylhexane is incorrect. What should be the correct name? o 3-propylnonane…

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.