Q: Give IUPAC names for the following compounds.(a) CH3OCH(CH3)CH2OH
A: The first step while naming the organic compound in IUPAC nomenclature is to find the longest…
Q: What is the correct IUPAC name for the following structure: CH2=CH-CH3
A: Given : Compound To find : IUPAC name Solution : Alkenes are unsaturated Compounds. Alkenes are…
Q: What is the correct IUPAC name for the compound shown here? H CH3 H CH-CH3 CH3
A: At double bond if same groups lies on same side of the double bond it is cis-isomer and if same…
Q: 11. CH;CHCH3 CH2-CH2-OH What is the IUPAC name for the above? O 1-hydroxy-3-methylbutane O…
A: IUPAC nomenclature is used for naming the organic compounds as recommended by international union of…
Q: Give the IUPAC name for each of the following: a. HC=CH–CH;-CH; CH3 b. CH-C=C-CH,-CH2-CH-CH3 Draw…
A: The name of an organic compound can be done by using IUPAC nomenclature. The full form of IUPAC is…
Q: "hat is the IUPAC name of the following compoune он CH3CH,CCH2CH3 ČHĄCH3
A: Naming of organic compounds,according to IUPAC. word root = indicates no of carbons in longest chain…
Q: What is the IUPAC name for the following compound? CH3-0-CH2CH-0-CH3 CH3
A: The given compound consists of an ether functional group.
Q: Give the IUPAC NAME of the following compound: H2C=CH(CH2)2CH=CH2 Your answer
A: Naming compounds with multiple bonds :- Select the longest possible continuous carbon chain with…
Q: 1. Give IUPAC for the following compound = CH3 CH3 „CHCH2CH2ĊHCH3
A: The compound given is Hence the alkyl chain has longest possible carbon chain of 6 carbon as shown…
Q: 2.1 Give IUPAC name to the following 2.1 Give IUPAC name to the following CH と- ー-C4 O HC - CH CH
A: IUPAC nomenclature (of organic chemistry) is a way of assigning names to organic compounds as per…
Q: What is the IUPAC name of the following compound? CH3CH2CH2C-H
A: In this question, we will name the compound by according to IUPAC rule. You can see below.
Q: Which of (a)-(d) is the correct IUPAC name of the following compound? CH3CH2CH=C(CH2CH3)CH3
A:
Q: What is the IUPAC name of the following? CH,CH2CHÖOCH,CH3
A: We have to predict the IUPAC nomenclature of given structure.
Q: CH2CH3 H3C CH2CO2H
A: IUPAC naming for the organic compounds is done as follows: Select the longest chain in the…
Q: Give the IUPAC name for the following ether
A: The naming of the ether is done according to IUPAC nomenclature as follows: 1) Select the longest…
Q: A. Give the IUPAC name for the following compounds. OH NH2 OCH2CH2CH3 CI
A: We have given the organic compounds we have to find the IUPAC Name of the given compound. Priority…
Q: What is the IUPAC name of the following compound? CH3 CH3 CH3CHCHCHCHg он
A: IUPAC Name:- 2,4-Dimethylpentan-3-ol.
Q: CH2 CH3 CH2
A:
Q: What is the IUPAC name of the following compound? CH2CH3 CH3CH2CHCH2OH
A: We should write the name of the compound considering the IUPAC nomenclature rules. We should…
Q: what k the IUPAC Name CICHah o HO-C-CH2CHCH,CHCH-C-OH CH,CH(CHa2 CI H.
A:
Q: What is the IUPAC name for the compound shown? CH3 H2 H3C H3C CH3 CH3 fo
A:
Q: What is the IUPAC name of the following compound? SH CH3
A: 4-methylcycloheane-1-thiol
Q: ct IUPAC name for the compoun Br H-C-CH2-CH-CH2-CH-CH2-CH3
A: To write IUPAC name following Basic rule should be apply . 1 ..Select longest chain in a given…
Q: CH3 HN СОСН2CH3
A: The given compound consists of an amide functional group.
Q: What is the IUPAC name of the following substance? CH3 HC=CCH2CHCH3
A: The IUPAC Name of the Compound is written in the following format: locant + prefix + root + locant +…
Q: What is the correct IUPAC name for the following structures: CH3COOCH3 CH3-CH2-CO-CH3
A: Interpretation: We have to write correct IUPAC for the following.
Q: CHs H3C- CH3
A:
Q: Give the IUPAC name for the following: CH3 H3C
A: Some basic rules for IUPAC naming 1. Longest chain rule :- Select the longest possible…
Q: Give the IUPAC name for each of the following compounds: CH3CH(CH3)CH(OH)CH2CH3
A:
Q: What is the IUPAC name of the following compound? он CH3 CHCCH3 CH3 CH3
A: Suffix for -OH group is -ol. Choose largest carbon chain and numbering from that side from where OH…
Q: What is the IUPAC name of the following compound? CH3 CH3CSH CH3
A: R-S-H (Thiol group)
Q: What is the IUPAC name of the following compound? O CH3CHCH₂CNHCH3 Br
A:
Q: What is the IUPAC name of the following compound? CH3CH2CH2-C=C-CH(CH3)2 Oa.2-methyl-3-heptyne b.…
A:
Q: What is the common name of the following compound? CH3 CH3CHCH20CH3
A: The functional group in the given compound is ether having general formula - R-O-R or R-O-R' where…
Q: Provide the correct IUPAC name for the compound shown here. CH3 || H-C-CH2-CH-CH2-CH3
A:
Q: write the IUPAC names for the attached compounds.
A: While giving IUPAC name to any compound , first we look for longest carbon chain . Then we number…
Q: What is the IUPAC name for the following compaund? CH3 CH;CH,OCOCH,CH3 ÓCH-CH3
A: In organic chemistry IUPAC nomenclature is a method of assigning names to the organic compounds…
Q: Write the IUPAC name of CH3CH2CH(OH)CH(NO2)CH(CH3)CHO.
A: Aldehyde functional group is given more priority as compared to the alcohol functional group.
Q: What is the IUPAC name of the following compound? CH3CH2CHCCH3 ČH3 SS
A: Solution: IUPAC nomenclature has some rules that we need to follow while naming the compound…
Q: What is the correct IUPAC name for the compound shown here? H CH3 CH₂ H CH-CH3
A:
Q: What is the IUPAC name for the following compound? CH3 CH3 CH=C-CH=CH-CH3
A:
Q: What is the IUPAC name of the compound shown (CH3)3-C-CH2-CH2-CH3
A: The given compound is represented as follows:
Q: What is the IUPAC name for the following compound? CH3 CH3 CCH-CH2-CH2-CH=CH-CH3
A: Since you have asked multiple questions, we will solve the first question for you. If you want any…
Q: What is the IUPAC name of the following? (CH3)3CCOCH,CH3
A: Esters are a kind of organic molecules having functional groups, RCOO-R' where R and R' are the…
Q: e) CH;CH2CH-CC-CH-CH2CH3 ČH2CH, f) CH,CH, H,C C-CH-C H CH, CI
A: propyne is a substituent of cyclohexane Substituents containing a triple bond are called alkynyl…
Q: Provide an IUPAC name for the following: CI NEC-CH2-CH2 CH-CH2-CH, CH2- HO
A: 1. Consider a longest carbon chain with maximum number of substituent. 2. The numbering of carbon…
Q: What is the IUPAC name of the following? CHạCHCočCHCH3 CH3 CH3
A:
Q: What is the IUPAC name for the following compound? CH=CH-CH=CH-CH2-CH=CH-CH3
A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)
Q: What is the IUPAC name of the following compound? CH2CH3 CH3CH,CHCH2OH
A:
Step by step
Solved in 2 steps
- Give the IUPAC name for each of the following compounds: CH3CH(CH3)CH(OH)CH2CH3Thank you Write the IUPAC names of the following compounds a. CH3CH2CH2CH2OH b. CH3 -O- CH2CH3Which compound(s) can hydrogen bond to another molecule like itself? Which compounds can hydrogen bond to water? (a) CH 3CONHCH 3; (b) HCON(CH 3) 2.