What is the IUPAC name of this compound? A) 2-Ethoxypropane Ethoxypropane B) C) 2-Methoxypropane D) Propoxyethane A O O 0 O

Q: What is the correct IUPAC name for the compound shown here? عيد 5- ethyl heptan one

A: IUPAC: Give priority to the functional group. Start numbering the parent hydrocarbon. Frist write…

Q: What is the IUPAC name of CH3-O-CH2CH3? O methoxyethane O ethoxymethane O 2-methoxyethane O…

A: Given that : We have to identify the IUPAC name of the following compound :

Q: What is the IUPAC name for CH 3 -CH 2 - CH 2-I   a. diiodopropane. b. propane diiodide. c.…

A: Given  Structure of Compound  = CH3 - CH2 - CH2 - I  IUPAC   Name   =?

Q: 11. CH;CHCH3 CH2-CH2-OH What is the IUPAC name for the above? O 1-hydroxy-3-methylbutane O…

A: IUPAC nomenclature is used for naming the organic compounds as recommended by international union of…

Q: What is the IUPAC name of the following compound? la a. (E)-3-methyl-4-hexene b.…

A: Answer: c

Q: Ethylene is the common name for the plant hormone that is responsible for ripening fruit. The…

A:

Q: What is the IUPAC name of the following compound? Me Me A. 2-Ethyl-3-methyl epoxy butane B.…

A:

Q: What is the IUPAC name for the following molecule? Select one: a. S-methyl-6-propyloctane b.…

A: In the IUPAC system of nomenclature, the longest chain possible is chosen, and the compound is named…

Q: 38. What is the IUPAC name of this compound? H3C CH,CH3 H. H. A) cis-3-Pentene B) cis-2-Pentene C)…

A: Rules for naming an organic compound : 1. Consider a longest chain of carbon atom consisting of…

Q: . What is the IUPAC name of the following compound? CI a) 3-Ethyl-2-methyl-4-chloropentane b)…

A:

Q: What is the IUPAC name for the compound? H;C- H,C-CH,-CH-CH, CH, ÕH

A: The IUPAC name of the given compound is -

Q: CH, CH,CH, CH;CHCH, CHCH,CH3 6. The compound has the IUPAC name O 3-ethyl-5-methylhexane…

A: The compound has the IUPAC name    CH31—CH2 ICH3— CH23—CH4lCH2 - CH3 — CH25 -CH36

Q: CH C-C= CH

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Q: What is the IUPAC name for the compound shown here? A) methylpentyne B) 2-methyl-3-pentyne C)…

A:

Q: What is the IUPAC name of the following compound? CH3 CH2 H. CH2CHCH, CH3 H.

A: While writing the IUPAC name first identify the parent chain and the functional group.

Q: The IUPAC name of CH3-O-CH2-CH2-CH2-CH3 is ---.     Question 26 options:   butyl pentyl ether…

A: The IUPAC name of CH3-O-CH2-CH2-CH2-CH3 is

Q: IUPAC name of the following compound is: C2H5 CH;-C-CH-CH3 CH2 A 3-Ethylbut-2-ene B 2,3…

A: The given compound is an alkene. Hence, the suffix "-ene" is used for the compound.

Q: The general formula for the alkene series is: C nH 2n + 2 C nH 2n C 2nH n - 2 C nH 2n - 2

A:

Q: What is the IUPAC name of the following? OA. 2-ethyl-5-propyloctane O B. 3-methyl-6-propylnonane…

A:

Q: What is the IUPAC name for the compound shown? H3C N' `CH3 ZI

A:

Q: What is the IUPAC name for the following compound? CH3 H3C Select one: 1,3-dimethyl-2-cyclopentene…

A: Using iupac naming rules , we will name the following compound.

Q: What is the IUPAC name for the compound? H,C- CH2-CH-CH, CH3 _ぎ

A:

Q: What is the correct IUPAC name for N2O?

A: Given molecule  N2O here Oxygen is More electronegative than Nitrogen So oxygen act as somewhat like…

Q: 01: 1. What is the IUPAC name for the following compounds?

A: Cyclic compounds containing atoms other than carbon and hydrogen such as N, O, S etc are known as…

Q: What is the IUPAC name of this compound? CH3 -CH2-CH2 -CH2-CH2 - CH2-CH3 OA) hexane O B) heptane O…

A:

Q: What is the correct IUPAC name for the compound shown here? A) 2-methyl-3-propanol B) propanal C)…

A: Alcohols contain hydroxyl (OH) functional group.

Q: What is the IUPAC name of the following compound? CH;CH2C(CH3)½CH2CH(C>H5)2…

A: Rules for naming the organic compound is as follows; Choose the longest continuous carbon chain.…

Q: Give correct IUPAC name of these products? +HCI H. NO2 A) B) NH + HyCOz + Hcl

A: The IUPAC names of the above given compounds are as follows;

Q: What is the correct IUPAC name for the following compound? O A. t-butyl iodide O 1-iodo-1-methyl…

A:

Q: 3. What is the IUPAC name of the following compound? ÇI a) 3-Ethyl-2-methyl-4-chloropentane b)…

A: Rules for IUPAC Nomenclature: 1. Always choose the longest chain for parent naming .2. During…

Q: CH, CH,— сн— сн — сң— сн, - CH CH- - CH, The IUPAC name of the above molecule is Select one: O…

A: methylpentylbenzene

Q: OH H2 C CH2 H C CH2 H2C CH2 H2C H2 H2

A:

Q: CH3 CH,=CH-CH CH,CH; What is the correct IUPAC name for the compound above?

A: Basic rules for naming the organic compounds are the following. Identify the longest chain with…

Q: CH3 Но OH A. Alkene B. Ether C. Ester D. Aldehyde

A:

Q: What is the correct IUPAC name of the structure below? H3C CH3 H3C CH2 OH 3-methyl-3-butanol…

A: Note : Give the priority to FG. Then start the numbering on parent chain. Then assign the IUPAC…

Q: What is the IUPAC name of the following molecule? CH3 H3C C-CH OH CI o 2-chloro-2-methyl-3-propanol…

A: Parent chain recognition is essential and first step for "IUPAC nomenclature". This naming must…

Q: The IUPAC name for the following compound is: CH3-CH 2-CH a) acetaldehyde b) 1-ethanal c) propanal…

A: All chemical compounds can be named with certain rules which are purposed by IUPAC. It purposed to…

Q: what is the IUPAC name for this compound? || CH-CH, CH-CH-C-CH 2. 3. 2 3.

A:

Q: What is the IUPAC name for the following compound? O 2-methylcyclohexene O 1-methylcyclohex-2-ene O…

A: Rules for naming cycloalkenes: 1. The double bond in the ring is given high priority. 2. The…

Q: The correct IUPAC name for this compound is It may help to draw the complete Lewis Structure. он…

A: The given compound, belongs to the alcohol family due to the presence of (OH) group. On…

Q: What is the IUPAC name of the following compound? LOH Br N=C- 2-bromo-4-cyano-1-hydroxybenzene…

A: Given molecule is aromatic compound

Q: Give iupac name for this diol CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: IWPAC Nomenclature contain & Pant:-   2 Pnefin (substituents) + 1 Pnefin (Cyclic on Acyclic) +…

Q: Write the IUPAC name for each unsaturated hydrocarbon. a (CH3)2CHCH=c(CH3)2 This hydrocarbon is CH3…

A: IUPAC full form is "International Union For Pure and Applied Chemistry". It has given a set of…

Q: is 2-butanone a correct IUPAC name?

A: The IUPAC name given is 2-butanone.

Q: What is the IUPAC name for the compound? H;C-CH,-CH-CH, CH3 OH

A: Given here two molecules and we are asked to write the IUPAC name for them.

Q: The correct IUPAC name for the following structure is CH;-CH-OH | CH3 OA 2-methyl ethanol OB.…

A:

Q: What is the IUPAC name for the following compound? Cyclohexanebutane Butylcyclohexane…

A: The structure of the given compound is   The IUPAC name of the compound is

Q: What is the IUPAC name of the following structure? CH, CH,CCH=CCH,CH, 1. CH, CH,

A: IUPAC nomenclature is the naming of a compound according to international rules.

Q: What is the IUPAC name of the following compound? CH, H.C a. (R)-4-methyl-2-hexyne b.…

A: Here we are required to find the correct iupac name for the given compound.

Q: What is the IUPAC name of the following compound? A (1R,35)-1-Chloro-3-ethyl-3-methylcyclohexane B…

A: IUPAC name of following compound