Answered: What is the maximum number of grams of…

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2(g)

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter20: Chemistry Of The Metals

Section: Chapter Questions

Problem 11QAP

See similar textbooks

Related questions

Q: how many moles of ammonia would be required to react exactly with 0.470 moles of copper(ll) oxide in…

Q: How many moles of nitrogen gas would be produced if 5.56 moles of copper(II) oxide were reacted with…

A: Given data : Moles of copper(II) oxide (CuO) = 5.56 mol CuO Chemical reaction : 2 NH₃(g) + 3 CuO…

Q: Coal gasification is a process that coverts coal (mostly carbon) into methan, Ch4(g): 2 C(g) + 2…

A: The balanced given reaction is as follows, 2 moles of C gives 1 moles of methane, then obviously 4…

Q: Calculate the percentage by mass of the indicated element in the following compounds: carbon in…

A: Percent by mass or percent by weight refers to the total mass of the one component divided by the…

Q: (a)If 12.06 g of NH4+ was found in the soil, how many ions of NH4+ was present initially? (b)If 500…

A: Given : Mass of NH4+ = 12.06 gm Mass of H2O produced = 500 gm

Q: What mass, in grams, of C2H2 is needed to form 132.9 g of CO2? Assume excess oxygen. 2C2H2(g) +…

Q: How many grams of NO will be produced from 76.2 g of NO₂ reacted with excess water in the following…

Q: What mass, in grams, of C2H2 is needed to form 210.4 g of CO2? Assume excess oxygen. 2C2H2(g) +…

A: Ans. 62.16 g C2H2 required to form 210

Q: Molten iron and carbon monoxide are produced in a blast furnace by the reaction of iron(III) oxide…

Q: Urea, CH4N20, is produced by the reaction between ammonia and carbon dioxide, as shown by the…

A: a.

Q: An important intermediate reaction in the industrial production process of nitric acid is shown What…

A: Molar mass of NH3 =(14+3×1) g/mol =17 g/molMolar mass of H2O =(2×1+16) g/mol =18g/molMss given of…

Q: 1.When the following equation is balanced, the coefficient for oxygen is: C8H18(g) + O2(g)…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: What mass of CO is required to react with 651 g of Fe2O3 ?

A: The balanced chemical equation for the given reaction is,

Q: Pure iron can be formed from iron ore through the process below. Suppose 158 g of Fe2O3 reacts with…

A: Ratio of experimental yield to the the theoretical yield multiply by 100 is known as percentage…

Q: How many grams of solid Ca3(PO4)2 can be formed from a reaction of 51.8 mL of 0.754 M CaCl2 and 21.5…

Q: How many grams of NO will be produced from 80.0 g of NO₂ reacted with excess water in the following…

A: Given, mass of NO2 = 80.0 g Molar mass of NO2 = 46.0 g/mol Molar mass of NO = 30.01 g/mol

Q: Which of the following best describes the VSEPR structure of SF4? Octahedral Trigonal…

A: as per Q&A guidelines of portal I solve first question because it comes under multiple question…

Q: What mass, in grams, of C2H2 is needed to form 270.4 g of CO2? Assume excess oxygen. 2C2H2(g) +…

Q: How many moles of nitrogen gas would be produced if 3.40 moles of copper(II) oxide were reacted with…

A: Limiting reagent is the reagent which is consumed in the chemical reaction completely. It decides…

Q: How many moles of nitrogen gas would be produced if 6.03 moles of copper(II) oxide were reacted with…

A: Stoichiometric calculation means the calculation of masses of reactant and product involved in a…

Q: How many moles of nitrogen gas would be produced if 7.03 moles of copper(II) oxide were reacted with…

A: On seeing the reaction: 2 NH₃(g) + 3 CuO (s) → 3 Cu(s) + N₂(g) + 3 H₂O(g) We can say that 3 moles…

Q: calculate the moles of ammonia produced by the reaction of 5.50 mol of hydrogen with excess nitrogen…

A: Number of moles of hydrogen = 5.50 mol Number of moles of the nitrogen gas : present in excess The…

Q: How many moles of ammonia would be required to react exactly with 0.432 moles of copper(II) oxide in…

A: Answer 9 : The balance chemical reaction : 2NH3(g) + 3CuO(s) ---> 3Cu(s) + N2(g) + 3H2O(g)…

Q: How many grams of magnesium chloride can be produced from 3.54 moles of chlorine gas reacting with…

Q: n dioxide reacts with elemental carl SiO2(s) + 3 C(s) → Si SiO2 reacts with excess carbon, 7.2 first…

Q: Tungsten metal, used in light bulb filaments, is produced from the reaction between tungsten (VI)…

A: Given, Mass of tungsten (VI) oxide, WO3 = 34.5 kg = 34500 g % yield = 75 %

Q: If the theoretical yield for the synthesis of the pain reliever acetaminophen in a reaction was…

A: Recall the expression for percentage yield Percentage yield=amount of acetaminophen recovered during…

Q: 2. Assuming that 1/2 of the original amount of copper was used as the starting material in the…

A: Given that - Mass of copper initially used as 1/2 of starting amount = 1.316÷2 = 0.658 g And…

Q: Lead (II) oxide from an ore can be reduced to elemental lead by heating in a furnace with carbon.…

A: The chemical reaction is as follows: PbO (s) + C (s) = Pb (s) + CO (g) so 1 mole of PbO (s) reacts…

Q: How many moles of nitrogen gas would be produced if 3.23 moles of copper(II) oxide were reacted with…

A: Given CuO = 3.23 mol Ammonia = excess reagent N2 gas =?

Q: How many moles of nitrogen gas would be produced if 3.56 moles of copper(II) oxide were reacted with…

A: Mole of a substance or a mole of a particles is defined as exactly 6×10^23 particles which may be…

Q: What is the maximum amount (in grams) of sulfur dioxide that can be produced by the reaction of 440…

A: Given equation is, 2 H2S(g) + 3 O2(g) → 2 H2O(g) + 2 SO2(g) Mass of H2S = 440 g Mass of O2 =1860 g…

Q: When a large amount of water was poured on 100 gr of calcium carbide CaC₂, 28.3 gr acetylene C₂H₂…

A: Percentage Yield = 70%

Q: How many moles of nitrogen gas would be produced if 8.77 moles of copper(11) oxide were reacted with…

Q: How many moles of oxygen ore produced by the docomposition of 6 moles of polosdum.chloride? 2KCIO,…

A: Balanced chemical equation: 2KClO3 -----> 2KCl + 3O2 From the above equation: Number of mol of…

Q: Vanadium(V) oxide reacts with calcium according to the chemical equation below. When 20.0 moles of…

Q: How many moles of nitrogen gas would be produced if 6.68 moles of copper(II) oxide were reacted with…

A: The balanced chemical equation for the reaction as given in the question is - 2NH₃(g) + 3 CuO (s) →…

Q: What is the maximum amount (in grams) of sulfur dioxide that can be produced by the reaction of 1880…

A: the answer is as follows:

Q: How many grams of NO will be produced from 55.7 g of NO₂ reacted with excess water in the following…

A: The given reaction is as follows: 3NO2(g) + H2O(l) → 2HNO3(g) + NO(g) The given mass of NO2 = 55.7 g…

Q: Silicon carbide is produced by heating silicon dioxide and carbon at high temperatures as shown by…

A: Number of moles of a chemical compound is used to measure the amount of compound in the given…

Q: How many moles of nitrogen gas would be produced if 3.40 moles of copper(II) oxide were reacted with…

A: Consider the given reaction. 2NH3g+3CuOs→3Cus+N2g+3H2Og

Q: How many moles of nitrogen gas would be produced if 4.48 moles of copper(II) oxide were reacted with…

A: The reaction given is 2 NH₃(g) + 3 CuO (s) → 3 Cu(s) + N₂(g) + 3 H₂O(g)

Q: How many moles of ammonia would be required to react exactly with 0.352 moles of copper(II) oxide in…

A: Given: moles of CuO = 0.470 mol Chemical reaction is given by, 2NH3(g)+3CuO(s)→3Cu(s)+N2(g)+3H2O(g)

Q: How many moles of nitrogen gas would be produced if 7.19 moles of copper(II) oxide were reacted with…

Q: South Africa is one of the world's largest ion ore producers. From the reaction below, answer the…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: How many grams of Al are produced from the reaction of 18 g of Al203 with excess CO? AlzO3 + CO - Al…

A: The given reaction is as follows: Al2O3 + CO → Al + CO2 The mass of Al2O3 given = 18 g The atomic…

Q: How many grams of NO will be produced from 72.3 g of NO₂ reacted with excess water in the following…

A: Mole is the amount of the substance that contains the same number of particles or atoms or…

Q: Industrially, vanadium metal, which is used in steel alloys, can be obtained by reacting vanadium(V)…

A: The reaction taking place is, => 5 Ca + V2O5 ------> 5 CaO + 2 V Given : Mass of V2O5 = 1.540…

Q: A 0.896 g sample of impure magnesite, MgCO3, was decomposed with HCl; the liberated CO 2 was…

A: MgCO3 decomposed with HCl . The balance chemical equation for this reaction is : MgCO3 + 2 HCl =…

Q: Consider this reaction, which occurs in the atmosphere and contributes to photochemical smog: N2(g)…

A: The reaction taking place is N2(g) + O2(g) →2NO(g) Hence from the above reaction, we can say that 1…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2(g)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The deep blue compound Cu(NH3)4S04 is made by the reaction of copper(II) sulfate and ammonia CuSO4(aq) + 4 NH3(aq) Cu(NH3)4SO4(aq) (a) If you use 10.0 g of CuSO4 and excess NH3, what is the theoretical yield of Cu(NH3)4SO4? (b) If you isolate 12.6 g of Cu(NH3)4SO4, what is the percent yield of Cu(NH3)4SO4?
4.43 Magnesium nitride forms in a side reaction when magnesium metal burns in air. This reaction may also be carried out in pure nitrogen. 3Mg(s)+N2(g)Mg3N2(s) If 18.4 g of Mg3N2forms from the reaction of 20.0 g of magnesium with excess nitrogen, what is the percentage yield?
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
how many moles of ammonia would be required to react exactly with 0.470 moles of copper(ll) oxide in the following chemical reaction 2NH3(g) + 3CuO (s) 3Cu (s) + N2(g) + 3 H2O(g)
How many moles of ammonia would be required to react exactly with 0.470 moles of copper II oxide in the following chemical reaction? 2NH3(g)+ 3CuO(s)--> 3 Cu(s)+ N2(g)+ 3H2O(g)
How many grams of solid Ca3(PO4)2 can be formed from a reaction of 51.8 mL of 0.754 M CaCl2 and 21.5 mL of 1.04 M Na3PO4? Why can't 4.04 g of solid Ca3(PO4)2 be formed under these conditions? This amount is (greater than, less than, or equal to) the theoretical yield.
How many moles of nitrogen gas would be produced if 5.56 moles of copper(II) oxide were reacted with excess ammonia in the following chemical reaction? 2 NH₃(g) + 3 CuO (s) → 3 Cu(s) + N₂(g) + 3 H₂O(g
Industrially, vanadium metal, which is used in steel alloys, can be obtained by reacting vanadium(V) oxide with calcium at high temperatures: 5Ca + V2O5 5CaO + 2V In one process, 1.540 ×103 g of V2O5 react with 1.960 × 103 g Ca. (a) Calculate the theoretical yield of V. (b) Calculate the percent yield if 769.0 g of V are obtained.
Consider the Harber-Basch process for the synthesis of ammonia from its elements. Calculate the theoretical yield in moles NH3 from the complete reaction of 59.8 grams N2 in the presence of excess H2 gas according to the following balanced equation N2(g)+3H2(g)->2NH3(g)
How many grams of chlorine gas can be produced from the decomposition of 73.4 g. of AuCl3 by this reaction: 2AuCl3 --> 2 Au + 3 Cl2
How many grams of iron metal are formed if 81.0 grams of aluminum metal reacts with excess Fe2O3 in the following reaction ? 2Al+Fe2O3->Al2O3+2Fe
Acetylene (C 2 H 2 ) and limewater (Ca(OH) 2 ) can be produced by the reaction calcium carbide (CaC 2 ) with water.a) What is the theoretical yield of acetylene if 0.77 g of water is reacted with calcium carbide?b) If 0.34 g of acetylene is produced, calculate the percentage yield.