Answered: What is the theoretical yield of…

What is the theoretical yield of bismuth when 481 g of Bi2O3 reacts with excess carbon as shown below?Bi2O3 + C(s) => Bi(s) + CO(g) (not balanced)

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.19PAE: 4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according...

See similar textbooks

Related questions

Q: In a blast furnace, iron (III) oxide is used to produce iron by the following (unbalanced) reaction:…

Q: how many moles of ammonia would be required to react exactly with 0.470 moles of copper(ll) oxide in…

Q: Coal gasification is a process that coverts coal (mostly carbon) into methan, Ch4(g): 2 C(g) + 2…

A: The balanced given reaction is as follows, 2 moles of C gives 1 moles of methane, then obviously 4…

Q: (a)If 12.06 g of NH4+ was found in the soil, how many ions of NH4+ was present initially? (b)If 500…

A: Given : Mass of NH4+ = 12.06 gm Mass of H2O produced = 500 gm

Q: How many grams of Fe can be produced when 10.0g of Al is reacted with 10.0g of Fe2O3?

A: 2Al + Fe2O3 ------------> 2Fe + Al2O3 This is required Balanced chemical equation.

Q: How many kg of CO2 are produced when 1.00 galloon of octane (C8H18, density = 0.703 g/mL) is…

A: Density of a substance is the ratio of its mass and volume. It is expressed in equation (1) in which…

Q: An important reaction that takes place in a blast furnace during the production of iron is the…

A: Balanced chemical reaction between Fe2O3 and CO

Q: 1. Balance the following reaction: Cr + O2 -> CrO3

A: Cr + O2 -> CrO3 after the balancing this equation :

Q: In a reaction, 0.77 kg of V2O5 are reacted with 0.88 kg of Ca as the following chemical. Equation:…

A: (a) The balanced Chemical equation is - V2O5 + 5Ca ----> 2V + 5CaO (b) Molar mass of different…

Q: What mass, in grams, of C2H2 is needed to form 210.4 g of CO2? Assume excess oxygen. 2C2H2(g) +…

A: Ans. 62.16 g C2H2 required to form 210

Q: Molten iron and carbon monoxide are produced in a blast furnace by the reaction of iron(III) oxide…

Q: Balance the following equations and indicate whetherthey are combination, decomposition, or…

A: In a combination reaction, two substances combine together to form a single substance. In a…

Q: Decide if the following reaction is balanced or not. Explain. C2H6 + 7 O2 → 2 CO2 + 3 H2O

Q: How many kg of Co2 are produced when 1.00 gallon of octane (C8H18, density = 0.703 g/mL) is…

A: Combustion reaction is a type of chemical reaction in which a given hydrocarbon is burnt in the…

Q: 1.When the following equation is balanced, the coefficient for oxygen is: C8H18(g) + O2(g)…

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: How many moles O2 are required to produce with 0.36 moles of P2O5 What is the stoichiometric…

A: (1) The balanced Chemical equation between phosphorus and oxygen to give phosphorus pentaoxide - 4P…

Q: Pure iron can be formed from iron ore through the process below. Suppose 158 g of Fe2O3 reacts with…

A: Ratio of experimental yield to the the theoretical yield multiply by 100 is known as percentage…

Q: How many grams of solid Ca3(PO4)2 can be formed from a reaction of 51.8 mL of 0.754 M CaCl2 and 21.5…

Q: 2/How many grams of aluminum oxide are produced from the synthesis reaction of 32.5 g of Al? Balance…

A: The balanced equation and Amount of Aluminum the oxide formed from 32.5 g of Al is given below

Q: What mass, in grams, of C2H2 is needed to form 270.4 g of CO2? Assume excess oxygen. 2C2H2(g) +…

Q: Consider this reaction, which occurs in the atmosphere and contributes to photochemical smog:…

Q: Lead(II) oxide from an ore can be reduced to elemental lead by heating in a furnace with carbon.…

A: Given reaction; PbO (s) + C (s) → Pb (℩) + CO (g) given amount of lead oxide (PbO) =…

Q: The first step in the Ostwald process for making nitric acid is the formation of NO according to:…

A: The first step in the Ostwald process for making nitric acid is the formation of NO according to:…

Q: Balance the equation below such that it has the smallest, whole-number coefficients.…

A: The given chemical equation is, CH3CH2CH2CH2OH+O2g→CO2g+H2Og The name of reactant CH3CH2CH2CH2OH is…

Q: identify the limiting reactant, and calculate the theoretical yield. c) If 3.52 g of Cisplatin is…

A: Number of moles = mass / molar mass Percent yield = (actual yield/theoritical yield) x 100

Q: If 25.0 g of CO is reacted with 6.00 g of H2, which is the limiting reagent?

A: Given data contains, Mass of carbon monoxide is 25.0g. Mass of hydrogen is 6.00g. Carbon monoxide…

Q: The balanced equation for the reaction of metallic iron with O₂ gas to produce ir oxide is shown…

Q: (b) Reaction between carbon monoxide and hydrogen produced methanol as the only product. (i) Write a…

A: First we will write balanced chemical equation, then using stoichiometric calculations, find the…

Q: The boride Pd5B2 is made by the direct combination of palladium and boron at high temperature. How…

A: 5 Pd + B ==> Pd5B2 Actual yield of Pd5B2 =155 g Percent yield = 95.0 %

Q: Consider this reaction, which occurs in the atmosphere and contributes to photochemical smog: 4Fe(s)…

Q: Tungsten metal, used in light bulb filaments, is produced from the reaction between tungsten (VI)…

A: Given, Mass of tungsten (VI) oxide, WO3 = 34.5 kg = 34500 g % yield = 75 %

Q: What is the coefficient of O2 when the following equation is completed and balanced? C4H8O2 + O2 →…

A: Given, Reaction C4H8O2 + O2 → ? First we complete the Reaction and then balance it.

Q: If the theoretical yield for the synthesis of the pain reliever acetaminophen in a reaction was…

A: Recall the expression for percentage yield Percentage yield=amount of acetaminophen recovered during…

Q: For the following reaction: C3H8(g) + O2(g) ------> CO2(g) + H2O(g) Q:…

A: Given reaction: C3H8 (g) + O2(g)→CO2(g) + H2O(g) To find: The theoretical yield of carbondioxide in…

Q: Consider the hypothetical reaction: 2X + Y 4Z 0.250 mol of Compound X is reacted with 0.100 mol of…

A: The given equation is 2X + Y → 4Z Given the number of moles of X is 0.250mol and the number of…

Q: 1. Pure iron can be prepared by reacting ferric oxide with carbon monoxide. Fe203 + 3CO → 2Fe + 3CO2…

A: a) For identification of limiting reagent and excess reagent we will determine the moles of each…

Q: Balance the following equation: Fe(s) + O2(g)——-> Fe2O3(s)

A: When atoms and charges on both sides (reactants as well as products) of the reaction are equivalent,…

Q: What is the maximum amount (in grams) of sulfur dioxide that can be produced by the reaction of 440…

A: Given equation is, 2 H2S(g) + 3 O2(g) → 2 H2O(g) + 2 SO2(g) Mass of H2S = 440 g Mass of O2 =1860 g…

Q: When a large amount of water was poured on 100 gr of calcium carbide CaC₂, 28.3 gr acetylene C₂H₂…

A: Percentage Yield = 70%

Q: Calculate the percent yield of the reaction if the combustion of 13.6 g C6H6 (MW = 78.12 g/mol) with…

Q: 2. If 2.500 g of Na2CO3 is used in the reaction, calculate the theoretical yield of NaCl.

A: Na2CO3 + HCl -----------> NaCl + H2CO3 1 mole of Na2CO3 to 1 mole of NaCl Given : Weight of…

Q: Cryolite, Na, AIF (s), an ore used in the production of aluminum, can be synthesized using aluminum…

Q: Give the theoretical yield, in moles, of CO2 from the reaction of 4.00 moles of C3H18 with 4.00…

Q: How many moles of ammonia would be required to react exactly with 0.470 moles of copper(II) oxide in…

A: Given: moles of CuO = 0.470 mol

Q: South Africa is one of the world's largest ion ore producers. From the reaction below, answer the…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: 1. The final step in the production of chromium metal consists of the reaction of chromium (III)…

A: Reactant reacts in stoichiometric terms to form products. Given reaction, 2 Cr2O3 + 3 Si…

Q: Industrially, vanadium metal, which is used in steel alloys, can be obtained by reacting vanadium(V)…

A: The reaction taking place is, => 5 Ca + V2O5 ------> 5 CaO + 2 V Given : Mass of V2O5 = 1.540…

Q: Consider this reaction, which occurs in the atmosphere and contributes to photochemical smog: N2(g)…

A: The reaction taking place is N2(g) + O2(g) →2NO(g) Hence from the above reaction, we can say that 1…

Question

100%

What is the theoretical yield of bismuth when 481 g of Bi₂O₃ reacts with excess carbon as shown below?
Bi₂O₃ + C(s) => Bi(s) + CO(g) (not balanced)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of propane reacting with excess water yields 270 kg of H2, what is the percentage yield? C3H8(g)+3H2O(l)3CO(g)+7H2(g)
4.43 Magnesium nitride forms in a side reaction when magnesium metal burns in air. This reaction may also be carried out in pure nitrogen. 3Mg(s)+N2(g)Mg3N2(s) If 18.4 g of Mg3N2forms from the reaction of 20.0 g of magnesium with excess nitrogen, what is the percentage yield?
Assume the methanol synthesis has an 85.0% yield and you want to make 1.00 kg CH3OH. Calculate the mass (g) of H2 you should use if you have sufficient CO.
4.19 How many metric tons of carbon are required to react with 7.83 metric tons of Fe2O3 according to the following reaction? 2Fe2O3+3C3CO2+4Fe How many metric tons of iron are produced?
What is the theoretical yield of iron in the reaction of Fe2O3+ 3CO---> 2Fe+ 3CO2 if 180.1 grams of each reactant is used?
silver sulfadiazine burn- treating cream creates a barrier against baterial invasion and realeases antimicrobial agents directly into the wound. if 35.0 g Ag2O is reacted with 70.0g C10H10N4SO2, what mass of silver sulfadiazine, AgC10H9N4SO2, can be produced, assuming 100% yield? Ag2O(s)+2C10H10N4SO2(s) -> 2AgC10H9N4SO2(s)+H2O(L) mass=?
In a reaction, 0.77 kg of V2Os are reacted with 0.88 kg of Ca as the following chemical. Equation : V2O5 + Ca →V + Cao a- Balanced the reaction equation. b- Calculate the moles of given reactants. c-Calculate the moles of product V. d- calculate the mass of V formed in grams. e- Which of the reactants is the limiting reagent ? Given that:- ( V=50.94g/mol, Ca = 40 g/mol, O = 16 g/mol ).
In a blast furnace, iron (III) oxide is used to produce iron by the following (unbalanced) reaction: Fe2O3 (s) + CO(g) -> Fe(s) + CO2(g) If 4000 g of Fe2O3 is available to react, how many moles of CO are needed?
Consider the Haber-Bosch process for the synthesis of ammonia from its elements. Calculate the theoretical yield in moles NH3 from the complete reaction of 59.8 grams N2 in the presence of excess H2 gas according to the following balanced chemical equation: N2(g)+3H2(g)--> 2NH3(g)
Given the following balanced reaction, Fe2O3+3C-->2Fe+3CO if 1140 of fe2o3 were reacted with ecess c, what would be the percent yield for the reaction if 455g of CO were actually collected? density fe2o3=5.24g/cm3, density of co is 1.14kg/m3