When 100. mL of 1.00 M Ba(NO3)2 solution is mixed with 100. mL of 1.00 M Na₂SO4 (both solutions initially at 25.0°C) in a calorimeter, a white solid forms and the temperature of the mixture increases to 28.1°C. Assuming that the calorimeter absorbs only a negligible quantity of heat, that the specific heat capacity of the solution is 4.18 J/g.°C, and that the density of the final solution is 1.0 g/mL, calculate the enthalpy change per mole of solid that was formed. Ba(NO3)2 (aq) + Na₂SO4 (aq) → BaSO4 (s) + 2 NaNO3(aq) 2.59 kJ/mol -2.59 kJ/mol 25.9 kJ/mol -25.9 kJ/mol none of the above

When 100. mL of 1.00 M Ba(NO3)2 solution is mixed with 100. mL of 1.00 M Na₂SO4 (both solutions initially at 25.0°C) in a calorimeter, a white solid forms and the temperature of the mixture increases to 28.1°C. Assuming that the calorimeter absorbs only a negligible quantity of heat, that the specific heat capacity of the solution is 4.18 J/g.°C, and that the density of the final solution is 1.0 g/mL, calculate the enthalpy change per mole of solid that was formed. Ba(NO3)2 (aq) + Na₂SO4 (aq) → BaSO4 (s) + 2 NaNO3(aq) 2.59 kJ/mol -2.59 kJ/mol 25.9 kJ/mol -25.9 kJ/mol none of the above

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 100AE

See similar textbooks

Similar questions

A sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.
9.50 When a 13.0-g sample of NaOH(s) dissolves in 400.0 mL of water in a coffee cup calorimeter, the temperature of the water changes from 22.6°C to 30.7C Assuming that the specific heat capacity of the solution is the same as for water, calculate (a) the heat transfer from system to surroundings and (b) H for the reaction NaOH(s)Na+(aq)+OH(aq)
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
Microwave ovens convert radiation to energy. A microwave oven uses radiation with a wavelength of 12.5 cm. Assuming that all the energy from the radiation is converted to heat without loss, how many moles of photons are required to raise the temperature of a cup of water (350.0 g, specific heat =4.18J/gC) from 23.0C to 99.0C?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
A sample of 0.562 g of carbon is burned in oxygen in a bomb calorimeter, producing carbon dioxide. Assume both the reactants and products are under standard state conditions, and that the heat released is directly proportional to the enthalpy of combustion of graphite. The temperature of the calorimeter increases from 26.74 C to 27.93 C. What is the heat capacity of the calorimeter and its contents?
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
The addition of 3.15 g of Ba(OH)28H2O to a solution of 1.52 g of NH4SCN in loo g of water in a calorimeter caused the temperature to fall by 3.1 C. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat absorbed by the reaction, which can be represented by the following equation: Ba(OH)28H2O(s)+2NH4SCN(aq)Ba(SCN)2(aq)+2NH3(aq)+10H2O(l)
A 5.00-g sample of aluminum pellets (specific heat capacity = 0.89 J/C g) and a 10.00-g sample of iron pellets (specific heat capacity = 0.45 J/C g) are heated to 100.0C. The mixture of hot iron and aluminum is then dropped into 97.3 g water at 22.0C. Calculate the final temperature of the metal and water mixture, assuming no heat loss to the surroundings.