When 17.2 g of cesium sulfate (Cs2SO4) is dissolved in 120 g of water in a styrofoam calorimeter of negligible heat capacity, the temperature drops from 25.00 to 23.31 °C. Based on this observation, calculate q for the water and AH° for the process, assuming that the heat absorbed by the salt is negligible. Cs₂SO4(s)-2Cs* (aq) + 504² (aq) The specific heat of water is 4.184 3 °C¹g¹. Give the answers in kl. 9H₂0 AH = kJ kj

When 17.2 g of cesium sulfate (Cs2SO4) is dissolved in 120 g of water in a styrofoam calorimeter of negligible heat capacity, the temperature drops from 25.00 to 23.31 °C. Based on this observation, calculate q for the water and AH° for the process, assuming that the heat absorbed by the salt is negligible. Cs₂SO4(s)-2Cs* (aq) + 504² (aq) The specific heat of water is 4.184 3 °C¹g¹. Give the answers in kl. 9H₂0 AH = kJ kj

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter12: Thermodynamic Processes And Thermochemistry

Section: Chapter Questions

Problem 74AP

See similar textbooks

Similar questions

When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
What is the sign of the work when a refrigerator compresses a gas (the system) to a liquid during the refrigeration cycle?
Identify the sign of the work when a fuel-oxygen mixture (the system) burns, propelling an automobile (part of the surroundings).
When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
The enthalpy of vaporization for water is 40.65 kJ mol-1. As a design engineer for a project in a desert climate, you are exploring the option of using evaporative cooling. (a) If the air has an average volumetric heat capacity of 0.00130 J cm-3 K-1, what is the minimum mass of water that would need to evaporate in order to cool a 5 m? 5 m room with a 3 m ceiling by 5°F using this method? (b) Is this a spontaneous or nonspontaneous process?
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
The standard enthalpy of formation of H2O(l) at 298 K is 285.8 kJ/mol. Calculate the change in internal energy for the following process at 298 K and 1 atm: H2O(l)H2(g)+12O2(g)E=? (Hint: Using the ideal gas equation, derive an expression for work in terms of n, R, and T.)
You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.
How is the sign of q, heat, defined? How does it relate to the total energy of the system?
A student performing a calorimetry experiment combined 100.0 ml. of 0.50 M HCI and 100.0 ml. of 0.50 M NaOH in a StyrofoamTM cup calorimeter. Both solutions were initially at 20.0 C, but when the two were mixed, the temperature rose to 23.2 C (a) Suppose the experiment is repeated in the same calorimeter but this time using 200 mL of 0.50 M HCl and 200.0 ml of 0.50 M NaOH. WIII the AT observed be greater than, less than, or equal to that in the first experiment, and why? (b) Suppose that the experiment is repeated once again in the same calorimeter, this time using 100 mL of 1.00 M HCI and 100.0 ml. of 1.00 M NaOH. Will the T observed be greater than, less than, or equal to that in the first experiment, and why?