When a lead acid car battery is recharged by the alternator, it acts essentially as an electrolytic cell in which solid lead(II) sulfate (PbSO4) is reduced to lead at the cathode and oxidized to solid lead(II) oxide (PbO) at the anode. Suppose a current of 98.0 A is fed into a car battery for 34.0 seconds. Calculate the mass of lead deposited on the cathode of the battery. Round your answer to 3 significant digits. Also, be sure your answer contains a unit symbol. olo Ar

When a lead acid car battery is recharged by the alternator, it acts essentially as an electrolytic cell in which solid lead(II) sulfate (PbSO4) is reduced to lead at the cathode and oxidized to solid lead(II) oxide (PbO) at the anode. Suppose a current of 98.0 A is fed into a car battery for 34.0 seconds. Calculate the mass of lead deposited on the cathode of the battery. Round your answer to 3 significant digits. Also, be sure your answer contains a unit symbol. olo Ar

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
Assume the following electrochemical cell simulates the galvanic cell formed by copper and zinc in seawater at pH 7.90 and 25 C. Zn | Zn(OH)2(s) | OH(aq) || Cu(OH)2(s) | Cu(s) a. Write a balanced equation for the reaction that occurs at the cathode. b. Write a balanced equation for the reaction that occurs at the anode. c. Write a balanced chemical equation for the overall reaction. d. Determine the potential (in volts) of the cell.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.