Answered: Which of the following changes will…

Science

Chemistry

Which of the following changes will always be true for a spontaneous reaction? +ΔG –ΔG +ΔS –ΔH

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 29QRT

See similar textbooks

Related questions

Q: Calculate AG°nxn: AG°rxn= kJ Part 3 Which phrase best describes this reaction under standard…

A: The standard enthalpy change and the entropy change of the reaction are given by: ∆H° = ∑∆H°f…

Q: a) H2(g)→ 2H(g) b) N2 (g. 1 atm) → N, (g, 8 atm) C) 2SO3(g) → 2SO,(g) + O2(g) d) C (Diamond) → C…

Q: For a chemical reaction to be spontaneous at all temperatures in the reverse direction, which of the…

A: First option. ∆S° > 0, ∆H° < 0

Q: COCl2(g) ---> CO(g) + Cl2(g) 6. Is this reaction spontaneous under standard conditions? 7. If…

A: If there is an increase in the moles of gaseous compounds then the entropy change for the reaction…

Q: Consider the reaction in the previous problem H2O2 0 H20 + O2e) Is the reaction spontaneous or…

A: A spontaneous reaction is one which takes places on its own. For a spontaneous reaction, ∆G∘should…

Q: At what temperatures is the following process spontaneous at 1 atm? ΔH° = +20 kJ and ΔS° = - 50 J/K

A: The reaction is always non-spontaneous at all temperatures.

Q: A spontaneous process usually involves an increase in temperature (an exothermic reaction), yet when…

A: Solution- The reaction is favorable when it causes an enthalpy decrease and an increase in system…

Q: Consider the reaction at 298 K: 2 NO(g) + O2(g)¡2 NO2(g) ΔG°rxn = -71.2 kJCalculate ΔGrxn under…

A: The equation for Gibbs free energy of a reaction is given below,…

Q: Write the CAPITAL Letter of the correct answer. A if both statements are true B if the 1st…

A: Given that, two statements are If the change in free energy, ΔG is negative, the reaction is…

Q: ΔΗ 1353. kJ J AS = K 2co,() + 4H,0 (g) → 2CH,OH (g) + 30,(g) AG = 10. kJ Which is spontaneous? this…

A: Given , temperature, T =123°C = (123 +273 )K=396 K Pressure = constant

Q: For the below endothermic chemical reaction, ASsys is [ Select ] and ASsurr is [ Select ] * meaning…

Q: Is the following reaction spontaneous at room temperature (25.0 °C) ? 2 H2S(g) + 3 O2(g) 2 SO2(g) +…

A: Interpretation: The given reaction is spontaneous at room temperature or not is to be determined. At…

Q: SO3 + H2O -> H2SO4 Is this chemical reaction spontaneous or non- spontaneous? Fast or slow?

A: The importance of Gibbs energy is that it gives information about the spontaneity of the reaction or…

Q: Which of the following are spontaneous processes? a. Silverwares tarnish when exposed to air b. A…

A: Spontaneous processes = These are the process which occur without any external force. a.…

Q: Predict the sign of ΔU, q, and w in the reaction given. 2C₆H₆ (s) + 7O₂ (g) → 4CO₂ (g) + 6H₂O (g)

A: ∆U = +ve q = +ve w = -ve

Q: Calculate the free energy change for the following reaction at 25°C. Is the reaction spontaneous at…

A: Given: ΔHrxn = −1269.8 kJ ΔSrxn=−364.6 J/K T = 25°C = 298 K

Q: Above what temperature does the following reaction become nonspontaneous? 2 H2S(g) +…

A: The balanced reaction taking place is given as, => 2 H2S (g) + 3 O2 (g) → 2 SO2 (g) + 2 H2O (g)…

Q: SO2(g)+2H2S(g) --> 3/8S8(s)+2H2O(g) at what temperature does the reaction become spontaneous?

A: Since the reaction becomes spontaneous when the net gibbs free energy change of the reaction becomes…

Q: Calculate the temperature at which the reaction changes from a spontaneous to non-spontaneous…

Q: Consider the following reaction: CH3OH(g) --> HCHO(g) + H2(g); DHo = 85 kJ (2)…

A: As this reaction is endothermic in nature as Del H is positive

Q: For a reaction to be spontaneous, the change in Gibbs free energy (AG) must be which of the…

Q: For a chemical reaction to be spontaneous at all temperatures in the reverse direction, which of the…

Q: The standard enthalpy change and standard entropy change for the reaction are: A,HP = -666.2 kJ…

A: The spontaneous nature of the reaction is determined by calculating the change of free energy of the…

Q: (2)Consider the following reaction at constant pressure. Use the information here to determine the…

A: 1. ∆Ssurr = -∆Hsys/T 2. ∆G = ∆H - T∆S

Q: For the reaction 2 NH3 (g) --> N2 (g)+ 3 H2 (g) , ∆H = +92 kJ. Which of the following is true?…

A: The given reaction is, 2 NH3 (g) --> N2 (g)+ 3 H2 (g) , ∆H = +92 kJ ∆H is positive, that means…

Q: Select all of the following reactions that would be expected to provide a positive change in…

A: Entropy is the randomness in the system. Means if a System is more disordered than it has more…

Q: The graph below shows the change in Gibbs free energy for two reactions. Change in Gibbs Free Energy…

A: Given:

Q: The element oxygen was prepared by Joseph Priestley in 1774 by heating mercury(II) oxide: HgO(s) →…

A: Given chemical equation: HgO(s) ------> Hg(l) + 1/2O2(g) For a reaction to be spontaneous,…

Q: CaO (s) + CO2 (g) → CaCO3 (s) At what temperature does the reaction become spontaneous?

Q: At what temperatures is the following process spontaneous at 1 atm? ΔH° = +20 kJ og/and ΔS° = - 50…

A: The spontaneous nature of the reaction is determined by calculating the change of free energy of the…

Q: What is the lowest temperature at which the reaction is spontaneous under standard conditions? H2O…

A: Welcome to bartleby ! We have to tell the temperature at which reaction go in forward direction.

Q: Photosynthesis in plants converts carbon dioxide and water into glucose (C,H1206) and oxygen…

Q: Classify each statement as true or false.

Q: What is the difference between a spontaneous reaction and a non spontaneous reaction?

A: We have to tell the difference between a spontaneous reaction and a non spontaneous reaction

Q: An endothernmic reaction with increase in entropy a. always spontaneous b. spontaneous in low…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: When ∆G is negative, a chemical reaction is spontaneous non-spontaneous endothermic…

Q: The standard enthalpy change and standard entropy change for the reaction are: AHP = -1036.0 kJ mol1…

Q: Calculate the temperature, in Kelvins, at which the decomposition of calcium carbonate becomes…

A: Given:The reaction is

Q: - Which combination of enthalpy and entropy will never result in a spontaneous reaction? a) ДН > 0…

A: A spontaneous reaction is the reaction that occurs by itself without any energy input from the…

Q: Which best describes the entropy change for the following process? CO2(g) + H2(g) CO(s) + H2O(g)

A: Question 1 The number of gaseous compounds decreased in the product. So that randomness decrease…

Q: Which of the following is always true for any spontaneous reaction? A. AH> 0 B. AH0 D. AG <0

A: Since, Spontaneous reaction means reaction favoured without any external disturbance. Thus,

Q: Consider the formation reaction of water, the hydrogen balloon reaction: 2 H,(g) + 0,(g) → 2 H,O(g)…

A: The reaction given is, => 2 H2 (g) + O2 (g) → 2 H2O (g)

Q: Consider each of the following reactions and decide whether the standard entropy change for the…

A: As per guidelines if multi-part questions posted, first three are allowed to answer, please repost…

Q: For a particular chemical reaction, ΔH = 4.3 kJ and ΔS = –19 J/K. Under what temperature condition…

Q: For a particular reaction, AH = 20.1 kJ/mol and AS" = 45.9 J/(mol-K). Assuming these values change…

A: The spontaneous nature of the reaction is determined by calculating the change of free energy of the…

Q: ∆Gº for the reaction, H2(g)+Br2(g)⇄2HBr(g), is -33.3 kJ. Which statement below is true? To make…

A: Given that : For the reaction, H2(g)+Br2(g)⇄2HBr(g), ∆Gº = -33.3 kJ ∆Gº is Gibbs free energy change.

Q: The following AG are for different reactions. Which reactions would be spontaneous if all conditions…

Q: 11. For which of the following reactions will the entropy of the system decrease? A. 2 NH3(g) …

A: Gas has more entropy than liquid which have more entropy than solid. In the above reaction D. there…

Q: Why does water spilled on the floor evaporate even though ΔG0 for the evaporation process is…

A: Because ordinary conditions are not standard conditions and standard gibbs free eenrgy applies only…

Question

Which of the following changes will always be true for a spontaneous reaction?

+ΔG

–ΔG

+ΔS

–ΔH

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Use the data in Appendix G to calculate the standard entropy change for H2(g) + CuO(s) H2O() + Cu(s)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
Indicate whether the following processes are spontaneous or nonspontaneous. (a) Liquid water freezing at a temperature below its freezing point (b) Liquid water freezing at a temperature above its freezing point (c) The combustion of gasoline (d) A ball thrown into the air (e) A raindrop falling to the ground (f) Iron rusting in a moist atmosphere
The molecular scale pictures below show snapshots of a strong acid at three different instants after it is added to water. Place the three pictures in the correct order so that they show the progress of the spontaneous process that takes place as the acid dissolves in the water. Explain your answer in terms of entropy
Explain why absolute entropies can be measured.
Determine whether each of the following statements is true or false. (a) An exothermic reaction is spontaneous. (b) When G° is positive, the reaction cannot occur under any conditions. (c) S° is positive for a reaction in which there is an increase in the number of moles. d) If H° and S° are both negative, G° will be negative.
Define the following: a. spontaneous process b. entropy c. positional probability d. system e. surroundings f. universe
In a spontaneous process, S(universe) is (a) 0 (b) = 0 (c) 0
Chemists and engineers who design nuclear power plants have to worry about high-temperature reactions because it is possible for water to decompose. (a) Under what conditions does this reaction occur spontaneously? 2H2O(g) 2H2(g) + O2(g) (b) Under conditions where the decomposition of water is spontaneous, do nuclear engineers have to worry about an oxygen/hydrogen explosion? Justify your answer.
The free energy for a reaction decreases as temperature increases. Explain how this observation is used to determine the sign of either H or S.
When solid sodium acetate crystallizes from a supersaturated solution, can you accurately predict the sign of H for the crystallization? Why or why not?
Without doing a calculation, predict whether the entropy change will be positive or negative when each of the following reactions occurs in the direction it is written. (a) CH3OH(l)+3/2O2(g)CO2(g)+2H2O(g) (b) Br2(l)+H2(g)2HBr(g) (c) Na(s)+l/2F2(g)NaF(s) (d)CO(g)+2H2(g)CH3OH(l) (e) 2NH3(g)N2(g)+3H2(g)