Which of the following compounds are chiral? 1-Chloropropan-2-ol 2-Methylpropan-2-ol 2-Chloro-1-phenylpropane 2-Methylbutanal (A 1-Chloropropan-2-ol, 2-Methylpropan-2-ol, 2-Methylbutanal B 1-Chloropropan-2-ol,2-Methylpropan-2-ol C 1-Chloropropan-2-ol, 2-Methylpropan-2-ol, 2-Chloro-1-phenylpropane, 2-Methylbutanal D 1-Chloropropan-2-ol, 2-Chloro-1-phenylpropane, 2-Methylbutanal

Which of the following compounds are chiral? 1-Chloropropan-2-ol 2-Methylpropan-2-ol 2-Chloro-1-phenylpropane 2-Methylbutanal (A 1-Chloropropan-2-ol, 2-Methylpropan-2-ol, 2-Methylbutanal B 1-Chloropropan-2-ol,2-Methylpropan-2-ol C 1-Chloropropan-2-ol, 2-Methylpropan-2-ol, 2-Chloro-1-phenylpropane, 2-Methylbutanal D 1-Chloropropan-2-ol, 2-Chloro-1-phenylpropane, 2-Methylbutanal

Organic Chemistry: A Guided Inquiry

2nd Edition

ISBN:9780618974122

Author:Andrei Straumanis

Publisher:Andrei Straumanis

Chapter12: Chirality

Section: Chapter Questions

Problem 27CTQ

See similar textbooks

Similar questions

Which of the following compounds are chiral? 1-Chloropropan-2-ol 2-Methylpropan-2-ol 2-Chloro-1-phenylpropane 2-Methylbutanal
Which of the following molecules are chiral?I. cis-1,3-DibromocyclohexaneII.1-Bromo-1-methylcyclohexaneIII.trans-1-Bromo-3-methylcyclohexaneIV.cis-1-Bromo-3-methylcyclohexane
2-Acetoxycyclohexyl tosylate reacts with acetate ion to form 1,2-cyclohexanediol diacetate. The reaction is stereospecific—that is, the stereoisomers obtained as products depend on the stereoisomer used as a reactant. Recall that because 2-acetoxycyclohexyl tosylate has two asymmetric centers, it has four stereoisomers—two are cis and two are trans. Explain the following observations:a. Both cis reactants form an optically active trans product, but each cis reactant forms a different trans product.b. Both trans reactants form the same racemic mixture.c. A trans reactant is more reactive than a cis reactant.
2-Acetoxycyclohexyl tosylate reacts with acetate ion to form 1,2-cyclohexanediol diacetate. The reaction is stereospecific—that is, the stereoisomers obtained as products depend on the stereoisomer used as a reactant. Recall that because 2-acetoxycyclohexyl tosylate has two asymmetric centers, it has four stereoisomers—two are cis and two are trans. Explain the following observations: a. Both cis reactants form an optically active trans product, but each cis reactant forms a different trans product. b. Both trans reactants form the same racemic mixture. c. A trans reactant is more reactive than a cis reactant
Ketones react with alcohols to yield products called acetals. Why does the all-cis isomer of 4-tert-butyl-1,3-cyclohexanediol react readily with acetone and an acid catalyst to form an acetal, but other stereoisomers do not react? In formulating your answer, draw the more stable chair conformations of all four stereoisomers and the product acetal for each one.
Which of the following molecules exhibits chirality?
1.Draw both cis- and trans-1,4-dimethylcyclohexane in their conformations. (a) How many stereoisomérs are there of cis-1,4-dimethylcyclohexane, and how many of rans-1,4-dimethylcyclohexane? (b) Are of the structures chiral? (c) What are the stereochemicar relationships among the various stereoisomers of 1,4-dimethylcyclohexane?
Is cis-1,2-dibromocyclohexane a meso compound? In its planar structure, it has a line of symmetry but it has two chiral carbons. However, in its chair conformation, it does not look like it has a line of symmetry but it has two chiral carbons.
Tell whether each of the compounds below is achiral (A), chiral (C) or meso (M).
How many gauche interactions are present in the most stable chair conformation of 1,1,2-trimethylcyclohexane?
What is the most stable chair conformation of the 4-methoxy-1,2-dimethylcyclohexane structure given below ?
How many stereoisomers are possible for 10,12-hexadecadien-1-ol? CH3(CH2)2CH=CHCH=CH(CH2)8CH2OH 10,12-Hexadecadien-1-ol