Question 10Which of the following descriptions is true for the cell below?Cu (s) | Cu* (0.1 M) || Fe3 (0.5 M), Fe (0.2 M) | Pt (s)A. O When the reaction quotient, Q, changes from its original value to when it equals 1, E does not change.cellB. O At 25 °C, when the reaction quotient, Q, is equal to the equilibrium constant, K, E°cell = 0.C.O When the cell reaches equilibrium, Ecell=0, and the cell will no longer work.D. OE can be determined by using the standard half-cell potentials alone.eall

Ecell calculated with the help of Nernst equation... At equilibrium Ecell = 0 (zero) , Q = Keq...

Question 10 Which of the following descriptions is true for the cell below? Cu (s) | Cu (0.1 M) || Fe (o.5 M), Fe (0.2 M) | Pt (s) A. O When the reaction quotient, Q, changes from its original value to when it equals 1, E does not change. B. O At 25 °C, when the reaction quotient, Q, is equal to the equilibrium constant, K, E°cell - o. C.O When the cell reaches equilibrium, E- o, and the cell will no longer work. "cell D. OE can be determined by using the standard half-cell potentials alone.

Question 10 Which of the following descriptions is true for the cell below? Cu (s) | Cu (0.1 M) || Fe (o.5 M), Fe (0.2 M) | Pt (s) A. O When the reaction quotient, Q, changes from its original value to when it equals 1, E does not change. B. O At 25 °C, when the reaction quotient, Q, is equal to the equilibrium constant, K, E°cell - o. C.O When the cell reaches equilibrium, E- o, and the cell will no longer work. "cell D. OE can be determined by using the standard half-cell potentials alone.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 110QRT

See similar textbooks

Similar questions

Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)
Consider the reaction low at 25°C: 3SO42(aq)+12H+(aq)+2Cr(s)3SO2(g)+2Cr3+(aq)+6H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 3.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (c) Is the reaction spontaneous at a pH of 8.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M and all gases at 1.00 atm?
Consider the reaction below at 25°C: 2MnO4(aq)+16H+(aq)+10Br(aq)2Mn2+(aq)+5Br2(l)+8H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 2.00 with all other ionic species at 0.100 M? (c) Is the reaction spontaneous at a pH of 5.00 with all other ionic species at 0.100 M? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M?
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.
The cell potential of the following cell at 25C is 0.480 V. ZnZn2+(1M)H+(testsolution)H2(1atm)Pt What is the pH of the test solution?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?