Which of the following is the oxidation state of phosphorus in H3PO: compound?12 -O A) -1О В) -3С) +4D) +2O E) +3

Oxidation number of P in H3PO3 ?

Answered: Which of the following is the oxidation…

Science

Chemistry

Which of the following is the oxidation state of phosphorus in H-PO> compound? O A) -1 O B) -3 OC) +4 O D) +2 O E) +3

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter18: Representative Metals, Metalloids, And Nonmetals

Section: Chapter Questions

Problem 93E: Determine the oxidation state of sulfur in SF6, SO2F2, and KHS.

See similar textbooks

Related questions

Q: The oxidation number of the phosphorus atom in P³¯ is

A: We know that, Oxidation number of atom in case of anion is equal to charge of its ion.

Q: What does the mean in the chemical equation: water %3D hydrogen + oxygen a. to produce O b. reacts…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: 1. What is the purpose of the potassium iodide? 2. Balance the equation H2O2- H2O + O2 3. What type…

A: 1. Potassium Iodide is used to avoid the absorption of radioactive iodine in the thyroid gland…

Q: The oxidation number of a nitrogen atom in N2O3 is

A: The oxidation number gives information about how much electrons an atom has gained or lost.

Q: The oxidation number of the phosphorus atom in P3- is

A: oxidation number defined as the charge developed on atom assuming ioinc bond.

Q: Determine the oxidation state for each of the elements below. boric acid The oxidation state of…

A: Here, we have to find the oxidation states of boron in H3BO3 nitrogen in NH3 bismuth in Bi(OH)3.

Q: Determina el estado de oxidación de cada uno de los elementos de las siguientes substancias ¿En cuál…

Q: Indicate the oxidation state of every individual element in the following compounds. Fractional…

A: Oxidation state: It represent that how many electrons are lost and gain by the element in the…

Q: Is 2Mg(s)+O2(g)=2MgO(s) a redox reaction?

A: In redox reaction oxidation and reduction occurs simultaneously.

Q: Write the chemical formula for each of the following compounds,and indicate the oxidation state of…

A: (a) The chemical formula for Sodium nitrite can be written as NaNO2 Na+ NO2- Oxidation state of…

Q: Determine the oxidation state for each of the elements below. The oxidation state of phosphorus in…

A: The charge on an atom is known as oxidation state. Oxidation state can be zero ,positive and…

Q: The oxidation state of sulfur in H2SO4 is Group of answer choices +6 +4 +8 +2 0

A: Oxidation state of sulfur in H2SO4 is

Q: determine the oxidation state of carbon in the molecule CH3Li

A: In the given question we have to calculate the oxidation state of carbon atom in the molecule CH3Li…

Q: How is a hydride ion diff erent from a hydrogen ion? What is the involvement of both ions in redox…

A: Ions are formed by the losing or gaining of electrons from a neutral atom. The ions with positive…

Q: Determine the oxidation state for each of the elements below. The oxidation state of ... zinc ...…

A: The oxidation state of zinc in zinc hydroxide is

Q: What is the oxidation number for S in AI(HSO4)3. Include the sign

A: The oxidation number of the elements are given below - - > Al = +3 H = +1 S = X O = - 2

Q: Identify the oxidation number of the atom/s 1. NaCl 2. Cu2O 3. CaH2 4. S8 5. H2O2

A: We know that,. For neutral atom, some of oxidation number is equal to zero. If molecule present in…

Q: For anhydrous formula unit A below, determine the oxidation states of all 5 atoms.…

A: The compound given is (NH4)2Fe(SO4)2. The ions present in the above ionic compound are 1) NH4+ 2)…

Q: Identify the oxidation state of nitrogen in the following: (b) NO2 (a) NO3- (c) NO,-

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: When the following skeletal equation is balanced under basic conditions, what are the coefficients…

Q: Determine the oxidation state for each of the elements below. cadmium hydroxide is Cd(OH)2 The…

A: The oxidation state is a very important factor in redox reactions. It helps in the prediction of the…

Q: In which of the following does phosphorus have the highest oxidation number?

A: Oxidation number of Oxygen is -2 as it belongs to group 16. Oxidation number of Halogen is -1…

Q: Fe2S3(s) Oxidation state of Fe : Oxidation state of S : HNO3 Oxidation state of H : Oxidation…

A: Oxidation state of all the compounds has been given below.

Q: The oxidation numbers of C in H2C2O4 and CH4 are ____ and ____, respectively. A) +4,-4 B) +3,0…

A: Oxidation number or state is the number of electrons that are either gain or lose by an atom in a…

Q: What is the oxidation number of phosphorus in the anion H2PO4-?

Q: Oksidasietoestand / Formule / Formula Naam / Name Oxidation state -1 Cl a) b) OC- Hipochloriet /…

A: a) chloride b)+1 X-2 =-1 X=-1+2 =+1 c)ClO2-

Q: Which of the following is not a common oxidation state of phosphorus when it is in compounds? O 3- O…

A: 1- In this question, we will see the non-common oxidation state of P when it's in compound formed.…

Q: the oxidation number of sulfur atoms in thiosulfate O a. 2 O b. 2, 8 O c. 0, 4 O d. -2, 8

A: Oxidation state: The covalent bond between the atoms of different electronegativity is polar. If we…

Q: Assign the oxidation state for nitrogen in each of the following. a. Li3N b. NH3 c. N2H4

Q: 14) The oxidation number of sulfur in the thiosulfate ion, S2O32- is A) +2 в)-2 C) +3 D) +4 E) +6

A: Oxidation state or oxidation number refers to the number assigned to the atom of a chemical compound…

Q: Give the oxidation state of the atoms in the following compounds: Cl2, Pb(OH)2, MnO4-, C2H6

A: The questions involves calculation of Oxidation State. Oxidation state is defined as the…

Q: The oxidation state of hydrogen in most of its compounds is +1 unless it is combined with a metal,…

A: Oxidation state of hydrogen can be +1 : hydrogen is attached to atom which is more electronegative…

Q: The oxidation state of sulfur in Li2SO3 is Group of answer choices +4 +2 0 +6 -2

A: The Oxidation state is the number of charge present at particular atom in a Molecule. The Oxidation…

Q: Which one of the following contains nitrogen in the lowest oxidation state? A.…

A: E. N2H4

Q: What happens to the chlorine (in CIO3) in the following redox reaction? CIO3 +l→ Cl +12 O a. It is…

A: In this question we have to tell change in oxidation number of chlorine in redox reaction.

Q: which or the Folowins トhe re dox evements in reaction below have oxidation state of zen? H2 t0…

A: Since we know that in a redox reaction both oxidation and reduction occurred simultaneously . I.e…

Q: 3. Zn NaOH (aq) Na,ZnO,+ Aqueous As" ions react with hydrogen sulfide gas to produce arsenic…

A: Precipitation Reaction :- When two or more solution combine together to give one insoluble salt is…

Q: O sơ; O H2S204 H2SO3 O H2S

A: The net number of electrons that are being taken from an element (forming positive oxidation state)…

Q: A From the following reachion Mn0g + Br - Mno, + BrOg A) MnOy B) Br c) 3 D) 6 O Reducing Agrnt is…

A: The given redox reaction is as follows: MnO4- + Br- → MnO2 + BrO3-

Q: the oxidation number of a nitrogen atom in N2O3 is

A: Oxidation number or oxidation state can be defined as the number of electrons lose or gain by an…

Q: Consider the reaction: 2 NH3(g) → N2(g) + 3 H2(g) .The oxidation numbers for the N in NH3,…

A: The given reaction involves dissociation of ammonia gas into nitrogen and hydrogen gas. Ammonia is a…

Q: Determine

A: KNO3 is broken into it's individual ions, KNO3(s) ------> K+(aq) + NO3-(aq)

Q: What is the oxidation state of the imaginary element Zeffer (Zf) in the polyatomic ion ZfO2^4-? The…

A: During a particular reaction, ions that doesn't change, that ions are called spectator ions. NOTE -…

Q: Determine the oxidation state for each of the elements below. The oxidation state of carbon dioxide…

A: The oxidation state of the given compounds can be calculated as follows:

Q: The oxidation state of phosphorus in Mg3(PO4)2 is Group of answer choices +6 0 +5 +2 +4

A: Oxidation state of the any element in its compound is depends upon its valency and the…

Q: Give

A: We will. Calculate oxidation number

Q: 2HPO32- + Si+ H2O = SiO32- + 2H2PO2- In the above reaction, what are the oxidation states of…

A: The balanced chemical equation is given as follows:

Q: Which of the following slatements is NOT rue for sulphur dioxide? -A. It is a reducing agent B 24.…

A: WHICH OF THE FOLLOWING IS TRUE FOR SULPHUR DIOXIDE ?

Q: Which of the following is the oxidation state of phosphorus in H3 PO3 ?

A: Given :- H3PO3 (orthophosphorus acid) To determine :- oxidation state of P in H3PO3

Q: Assign an oxidation state to each atom SO3

A: Assign an oxidation state to each atom in SO3.

Question

Which of the following is the oxidation state of phosphorus in H3PO: compound?
12 -
O A) -1
О В) -3
С) +4
D) +2
O E) +3

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Determine the oxidation state of sulfur in SF6, SO2F2, and KHS.
Why does hydrogen- not exhibit an oxidation state of 1- when bonded to nonmetals?
What volume of 0.250 M H2SO4 solution is required to neutralize a solution that contains 5.00 g of CaCO3?
Balance the following equations by oxidation-reduction methods; note that three elements change oxidation state.. Co(NO3)2(s)Co2O3(s)+NO2(g)+O2(g)
The amount of sodium hypochlorite in a bleach solution can be determined by using a given volume of bleach to oxidize excess iodide ion to iodine; ClO- is reduced to Cl-. The amount of iodine produced by the redox reaction is determined by titration with sodium thiosulfate, Na2S2O3; I2 is reduced to I-. The sodium thiosulfate is oxidized to sodium tetrathionate, Na2S4O6. In this analysis, potassium iodide was added in excess to 5.00 mL of bleach (d=1.00g/cm3) . If 25.00 mL of 0.0700 M Na2S2O3 was required to reduce all the iodine produced by the bleach back to iodide, what is the mass percent of NaClO in the bleach?
Give the hybridization and oxidation state for sulfur in SO2, in SO3, and in H2SO4.
Calculate the oxidation number of: a. N in NO2- b. P in P2O5
Determine the oxidation state of the following: 1. O22. Cr in K2Cr2O73. S in MgSO44. P in Zn3(PO4)25. Group VIA elements
Determine the oxidation state of the following: 1. P in Zn3(PO4)22. Group VIA elements
7 Which of the following is the oxidation state of phosphorus in H3 PO3 ? a) +2 B) +3 NS) -one D) -3 TO) +4
Selenium is prepared by the reaction of H₂SeO₃ with gaseous SO₂. (a) What redox process does the sulfur dioxide un-dergo? What is the oxidation state of sulfur in the product? (b) Given that the reaction occurs in acidic aqueous solution,what is the formula of the sulfur-containing species? (c) Write the balanced redox equation for the process
oxidation state of carbon in C5O2? a. 1 b. -4 c. 0.8 d. 0