Which of the following statements about a concentration cell is false? O a. The concentration increases in the less concentrated half-cell. O b. The spontaneous reaction is always from the more dilute solution to the more concentrated solution. O.Both half-cells are composed of the same species. O d. E0 is always zero in a concentration cell. O e. The concentration decreases in the more concentrated half-cell.

Which of the following statements about a concentration cell is false? O a. The concentration increases in the less concentrated half-cell. O b. The spontaneous reaction is always from the more dilute solution to the more concentrated solution. O.Both half-cells are composed of the same species. O d. E0 is always zero in a concentration cell. O e. The concentration decreases in the more concentrated half-cell.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 66E: Consider the concentration cell in Fig. 17-10. If the Fe2+ concentration in the right compartment is...

See similar textbooks

Similar questions

Consider the cell described below: Zn|Zn2+(1.00M)||Cu2+(l.00M)|Cu Calculate the cell potential after the reaction has operated long enough for the [Zn2+] to have changed by 0.20 mol/L. (Assume T=25C.)
Consider the concentration cell in Fig. 17-10. If the Fe2+ concentration in the right compartment is changed from 0.1 M to 1 107 M Fe2+, predict the direction of electron flow, and designate the anode and cathode compartments.
A fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?
Consider a battery made from one half-cell that consists of a capper electrode in 1 M CuSO4 solution and another half—cell that consists of a lead electrode in 1 M Pb(NO3)2 solution. (a) What are the reactions at the anode, cathode, and the overall reaction? (b) What is the standard cell potential for the battery? (c) Most devices designed to use dry-cell batteries can operate between 1.0 and 1.5 V. Could this tell he used to make a battery that could replace a dry-cell battery? Why or why not. (d) Suppose sulfuric acid is added to the half—cell with the lead electrode and some PbSO4(s) forms. Would the cell potential increase, decrease, or remain the same?