Which of the following statements concerning the hydrogen-oxygen fuel cell is incorrect? O a. The efficiency of energy conversion of the fuel cell is 60-70% of the theoretical maximum, about twice the efficiency of burning hydrogen in a heat engine with a generator. O b. The H₂/02 cell is nonpolluting, only H₂O is released. O c. The cathode reaction is: H₂ + 2OH- → 2H₂O +2e™. O d. Most of the chemical energy from the formation of H-O bonds is converted directly into electrical energy. O e. Fuel cells are voltaic cells in which the reactants are continuously supplied to the cell and the products are continuously removed.

Which of the following statements concerning the hydrogen-oxygen fuel cell is incorrect? O a. The efficiency of energy conversion of the fuel cell is 60-70% of the theoretical maximum, about twice the efficiency of burning hydrogen in a heat engine with a generator. O b. The H₂/02 cell is nonpolluting, only H₂O is released. O c. The cathode reaction is: H₂ + 2OH- → 2H₂O +2e™. O d. Most of the chemical energy from the formation of H-O bonds is converted directly into electrical energy. O e. Fuel cells are voltaic cells in which the reactants are continuously supplied to the cell and the products are continuously removed.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 125AE

See similar textbooks

Similar questions

A voltaic cell can be built using the reaction between Al metal and O2 from the air. If the Al anode of this cell consists of 84 g of aluminum, how many hours can the cell produce 1.0 A of electricity, assuming an unlimited supply of O2?
Consider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?
Calculate the maximum work available from 50.0 g of aluminum in the following cell when the cell potential is 1.15 V. Al(s)Al3+(aq)H+(aq)O2(g)Pt Note that O2 is reduced to H2O.
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
A fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?
A factory wants to produce 1.00 103 kg barium from the electrolysis of molten barium chloride. What current must be applied for 4.00 h to accomplish this?
Consider a cell based on the following half-reactions: a. Draw this cell under standard conditions, labeling the anode, the cathode, the direction of electron flow, and the concentrations, as appropriate. b. When enough NaCl(s) is added to the compartment containing gold to make the [Cl] = 0.10 M, the cell potential is observed to be 0.31 V. Assume that Au3+ is reduced and assume that the reaction in the compartment containing gold is Au3+(aq)+4Cl(aq)AuCl4(aq) Calculate the value of K for this reaction at 25C.