Which one of the following is the equilibrium reaction of basic C6H5NH2 with H20? Select one: a. C6H5NH2 + C6H5NH2 2 C6H5NH3* + C6H5NH b. C6H5NH2 + H20 2 C6H5NH¨ + H30* с. C6H5NH2 + H202 C6H5NH3* + OH° d. C6H5NH2 2 C6H5NH + H*

Which one of the following is the equilibrium reaction of basic C6H5NH2 with H20? Select one: a. C6H5NH2 + C6H5NH2 2 C6H5NH3* + C6H5NH b. C6H5NH2 + H20 2 C6H5NH¨ + H30* с. C6H5NH2 + H202 C6H5NH3* + OH° d. C6H5NH2 2 C6H5NH + H*

Appl Of Ms Excel In Analytical Chemistry

2nd Edition

ISBN:9781285686691

Author:Crouch

Publisher:Crouch

Chapter5: Equilibrium, Activity And Solving Equations

Section: Chapter Questions

Problem 4P

See similar textbooks

Related questions

Q: Which equation below describes basic solution? [H3O+] [OH-]

A: The answer is given below

Q: what are the molar H3O+ and OH- concentrations in (a very brief but concise solution will do)…

A: 0.0300 M HOCl 0.0600 M butanoic acid 0.200 M NaOCI

Q: What is the equilibrium constant expression, Ki, for the following weak acid? H3PO4(aq) + H*(aq) +…

Q: Which of the following dissociations will increase the pH scale significantly? Select one: O a.…

A: pH scale is high when the basicity increases that is the concentration of the hydroxy ions…

Q: In polyprotic acids, when two adjacent dissociation reactions combine, the Ka of the net reaction is…

Q: In a 0.1000 M acetic acid solution at 25 , the acid ionizes to the extent of about 1.34 %. Since…

A: Introduction: According to the Bronsted-Lowry theory, an acid is a substance that can donate…

Q: When ammonium (NH4+) is placed in water, a chemical reaction occurs and an equilibrium is…

A: By applying the Henderson Hasselbalch equation, we can predict the predominant form.

Q: 3. What are the concentrations of each of the following species in 0.100 M Ascorbic acid: H2C6H,O6,…

A: SOLUTION: Step 1: As ascorbic acid is a weak acid, [H2C6H6O6] =0.10 M

Q: A 300 mL of 0.05M ammonia. The density of the solution is 0.88 g/mL. Pka pf ammonium = 9.255. What…

Q: For acetic acid, at equilibrium: Ka- [H3O*][CH;CO2 V [CH, CO2 H] =1.8×10"s In this case, you know Ka…

A: The pH is a negative logarithm of the concentration of hydrogen ions. pH = -log H+

Q: In reaction D: CuO + H2SO4= CUSO4 + H2O Students will occasionally use HNO3 (aq) instead of H2SO4…

Q: If we used H2C4H4O5 as the weak diprotic acid, which of the four species, H2C4H4O5, HC4H4O51-,…

Q: 2. What is [OH-] in a solution of 0.125 MCH3NH₂ and 0.130 MCH3NH3CI? CH3NH2(aq) +H₂O) CH3NH3(aq) +OH…

A: Given: The concentration of CH3NH2 = 0.125 M The concentration of CH3NH3Cl = 0.130 M Kb = 4.4×10-4…

Q: Which of the following equations represents the acid equilibrium associated with Kaz for H3PO3? A)…

A: Given : To write the acid equilibrium associated with Ka3 for H3PO3.

Q: 1. At 25°C, a 50mL solution is found to contain 20% by mass acetic acid (CH3COOH). The density of…

Q: Phosphoric acid (H3PO4) is a triacid (pKa1 = 2.2 ; pKa2 = 7.2 ; pKa3 = 12.3). Write the balanced…

Q: Calculate the pHof (a) a solution that is 0.060 M in potassium propionate(C2H5COOK or KC3H5O2) and…

A: (a) Given, 0.060 M in potassium propionate 0.085 M in propionic acid The equilibrium reaction is,…

Q: Which of the following reactions shows how hydronium ion is formed? OH + H3O2+ → H3O+ + H2O H+…

A: ->Formation of hydronium ion .

Q: What component of the buffer solution reacted with the addition of the strong acid, HCl? Watter…

A: Buffer is a solution that resists the change in pH when small amount of acid or base is added to it.…

Q: Ihe following reactiohs all have K > 1. 1) HNO2 (aq) + CIO" (aq)=NO, (aq) + HC1O (aq) 2) C,H5COOH…

Q: PrePan Ben Zois acid 10 mL 5.% in

A: The question is based on the concept of solutions. It involves preparation of solution based on the…

Q: Which of the following aqeuous solutions has the highest percent ionization? (The Ka of benzoic acid…

Q: rite the expression for the Ka when HC₂H3O2 is dissolved in water 2H3O2 + H₂O C₂H3021 + H30+1 ][ Ka…

Q: Amino acids such as glycine are the building blocks of large molecules called proteins that give…

A: Glycine: It is an organic compound that consists of both the carboxylic acid group and the amine…

Q: A diprotic base (B) has pK, values of 3.33 (pKpi) and 6.66 (pK62). Which of the equalities is true…

Q: What is the pOH of a 0.1563 M NH4NO3? Kb for NH3 is 1.86e-5.

A: Given: kb for NH3 = 1.86 * 10-5 concentration of NH4NO3 = 0.1563 M

Q: 1. The structure of pyruvic acid is shown below: Draw the acid dissociation equilibrium reaction…

A: Given : Ka of acid = 3.16 x 10-3 Concentration of solution = 0.3 M

Q: How do I solve for the reactant?

A: Acetic acid has carbon, hydrogen and oxygen in it and acetic acid in its standard state is a…

Q: a. What is the base ionization constant for CH2BrCOO ? Kp: CH -5 r ל ל- Ź CH2B CO0 – "CH 2BV COOlH…

A: The conjugate base of the CH2BrCOOH is CH2BrCOO-. Thus we can find the Ka of the weak acid from the…

Q: What is the Ka for a 0.1459 M acetylsalicylic acid solution, C9H7O4H, if it had a hydronium ion…

A: Using the the Rate constant expression at equilibrium we can find the rate dissociation…

Q: In the reaction between H2Y - and H2Z - , if H2Y - acts like a base, and H2Z - acts like an acid,…

A: Acid is a species loses a proton. Base is a species that receives proton.

Q: What is the fraction of association (a) for each potassium propionate solution? The K, of propanoic…

Q: O.235g of weak benzoic acid CHC6Hfc02) is dissolve el in of solation. A solutionwith o.l08 M NGOH IS…

A: The pH of a solution is used to determine the acidity or alkalinity of a solution. The pH is given…

Q: NaHSO3 is a salt, which ionized completely to give HSO3- ion. the following equations show that…

A: NaHSO3 dissociates as: NaHSO3→Na++HSO3- (A)

Q: Acids & Bases: Understanding the Connection Between Descriptions of Weak Acid Dissociation When…

A: Given,Concentration of Acid = 0.013MPercent dissociation of acid = 0.23%The concentration of…

Q: 1.4 × 10-2 M and Kb is 6.4 × 10-4 at 25.0

A: Given data are as follows: weak basic solution concentration =1.4 × 10-2 M Kb = 6.4 × 10-4

Q: Ammonia, NH3, is a base and will readily accept a proton in accordance with the following reaction:…

A: Given data NH3(aq) + H2O⇔ NH4+(aq) + OH-(aq)∆G° (KJ/mol):…

Q: Write the form of the compound that predominates in a solution with a pH = 5.5. a. CH3CH2OH (pKa =…

A: pH of the solution = 5.5 According to the Henderson Hassel Balch equation, if pH of the solution is…

Q: Calculate the concentration of each species present in a 0.025 M solution of phthalic acid,…

A: Pthalic acid is a weak acid and Ka is an equilibrium expression. The Ka is calculated by the…

Q: At 25°C, what are the molar H3O+ and OH- concentrations in 0.0300 M HOCl? 0.0600 M butanoic acid?…

Q: Carbonic acid (H2CO3) is a diprotic weak acid that undergoes the following dissociation reactions:…

Q: What is the equilibrium-constant expression of the basic dissociation of NaNO2? Kb =…

Q: What is the [OH−] of 0.1763 M hydrazoic acid solution, HN3, if Ka = 1.9000e-5? HN3(aq) + H2O(l) →…

Q: What is the equilibrium-constant expression of the basic dissociation of NaNO2? Kb =…

A: Given-> NaNO2

Q: For the equilibrium CH3NH3* + H2O CH3NH2 + H30* the two substances which are both bases are: a) H2O…

Q: H of 11.9 turns litmus ACIDS BASES H acceptor paper red may have a negative charge generates H TOH…

A: The pH of any chemical substance depends upon the power of the hydrogen atom. Depending upon this we…

Q: Which statement is true if an aquous solution is not neutral at 25°C. ? Explain your reasoning in a…

Q: One key to predicting the relative strength of an acid is to Look at its conjugate base and judge…

A: A Bronsted-Lowry acid is a chemical that generates a conjugated base by donating a proton or H + ion…

Q: A solution of 0.10 M acetic acid and 0.10 M sodium acetatehas a pH of 4.76. Determine the pKaof…

A: Introduction: As per Bronsted-Lowry concept, an acid is a substance that can donate H+ ions and base…

Concept explainers

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red.

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.

Question

Which one of the following is the equilibrium reaction of basic C6H5NH2 with H20?
Select one:
a.
C6H5NH2 + C6H5NH2 2 C6H5NH3* + C6H5NH
b.
C6H5NH2 + H20 2 C6H5NH + H30*
C.
C6H5NH2 + H20 C6H5NH3* + OH
d.
C6H5NH2 2 C6H5NH + H*

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Ammonia, NH3, is a base and will readily accept a proton in accordance with the following reaction: NH3(aq) + H2O <-> NH4+ + OH- ∆G0NH3(ag) = -26.6 kJ/mol ∆G0H2O = -237.1 kJ/mol ∆G0NH4+ = -79.3 kJ/mol ∆G0OH- = -157.2 kJ/mol For NH3 dissolving in water and forming NH4- and OH-, at pH 9.0, [NH3] = 10-5 mol/L, [NH4-] = 10-5 mol/L. Is the reaction at equilibrium? If not, in which direction is the reaction going?
A 300 mL of 0.05M ammonia. The density of the solution is 0.88 g/mL. Pka pf ammonium = 9.255. What is the value for the dissociation constant of the base? 1.897x10^-4 1.459x10^-5 5.559x10^-10 1.799x10^-5 What is the hydroxyl concentration of the ammonia solution? 9.484x10^-4 M 5.272x10^-5 M 9.484x10^-5 M 5.272x10^-6 M What is the pOH of the ammonia solution? 4.023 5.278 4.278 3.023 What is the pH of the ammonia solution? 8.722 10.977 9.977 9.722 Which best characterizes the solution? Weak acid Strong base Strong acid Weak base
Q3- The acid-dissociation constant for chlorous acid, HCIO,, at 25C is 1.0x10. Calcul the concentration of H+ if the initial concentration of acid is 0.100 M. d Q4- How many grams of sodium hydroxide (M.wi=58.5) can be added 0 2.5 liter of a solution mixture of 0.3M ammonia and 0.15M ammonium chloride without changi POH by more than lunit? Ky=1.8x 10°? w
What is the equilibrium-constant expression of the basic dissociation of NaNO2? Kb = [OH-]/([HNO2] [NO2]) Kb = ([HNO2] [NO2])/[OH-] Kb = ([HNO2] [OH-])/[NO2] Kb = ([NO2] [OH-])/[HNO2]
From the following information, determine ΔH°f of malonic acid, CH2(COOH)2(s).CH2(COOH)2(s) + 2O2(g) → 3CO2(g) + 2H2O(l); ΔH° = –861.0 kJSubstance ΔH°f (kJ/mol)CO2(g) –393.5H2O(l) –285.8a. 2613 kJb. 891.1 kJc. −1540.3 kJd. −2613.1 kJe. −891.1 kJ
1.Given: H2SO3(g) → H2O (g) + SO2 (g) Keq = 100 What will the numerical value for Keq be for the following reaction? H2O (g) + SO2 (g) → H2SO3(g) In the following reaction, __________ are Bronsted-Lowry acids. Al(H2O)6+3 + H2O → Al(H2O)5OH+2 + H3O+
Which of the following pairs of mathematical expressions can be used to correctly calculate the pHand pOH of a 0.0015MKOH(aq) solution at 25°C? A. pH=−log(14.00−0.0015) and pOH=−log(0.0015) B. pH=log(0.0015)−14.00 and pOH=−log(0.0015) C. pH=14.00−(−log(0.0015)) and pOH=−log(0.0015) D. pH=−(−log(0.0015)) and pOH=14.00−(−log(0.0015))
if the pH at one half the first and second equivalence points of a dibasic acid is 4.80 and 7.34, respectively, what are the values for pKa1 and pKa2?
Carbonic acid (H2CO3) is a diprotic weak acid that undergoes the following dissociation reactions:H2CO3 ⇌ H+ + HCO3− Ka1 = 4.3 x 10−7HCO3− ⇌ H+ + CO32− Ka2 = 5.6 x 10−11For a 0.020 M solution of carbonic acid in water, which of the following is true? a. [HCO3−] = [CO32−] b. [H+] = Ka2 c. [CO32−] = Ka2 d. Ka1 = Ka2 e. [H+] = Ka1
In the following reaction of tetrafluoroboric acid, HBF4, with acetate ion, C2H3O2-, the formation of tetrafluoroborate ion BF4-, and acetic acid, C2H4O2 is favored. HBF4 + C2H3O2- → BF4- + C2H4O2 Which is the weaker base, BF4- or acetate ion?
H3PO4 is a triprotic acid with the following acid dissociation constants: H3PO4 ⇌ H2PO4- + H+ Ka1 = 1.2 × 10-4 H2PO4- ⇌ HPO42- + H+ Ka2 = 4.3 × 10-9 HPO42- ⇌ PO43- + H+ Ka3 = 7.2 × 10-12 What is K for the following equilibrium: PO43- + 3H+ ⇌ H3PO4
Calculate the pHof (a) a solution that is 0.060 M in potassium propionate(C2H5COOK or KC3H5O2) and 0.085 M in propionic acid(C2H5COOH or HC3H5O2); (b) a solution that is 0.075 M in trimethylamine, (CH3)3N, and 0.10 M in trimethylammoniumchloride, (CH3)3NHCl; (c) a solution that is made bymixing 50.0 mL of 0.15 M acetic acid and 50.0 mL of 0.20 Msodium acetate.