Answered: Why do the complexes a,b,c,d display…

Why do the complexes a,b,c,d display such different colours a) trans-Ru(II)Cl2(py)4 b) trans-Ru(II)Cl2(acpy)4 c) trans-Ru(II)(NCS)2(py)4 d) trans-Ru(II)(NCO)2(py)4

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 37QAP

See similar textbooks

Related questions

Q: How many different molecules are drawn below?

A: Organic molecules are molecules that contain carbon and hydrogen atoms.We have been given molecules…

Q: a. b. C. type: OH type: type: -OH 2 OH TSOH cat. H Acetal formation TsOH cat.

A: Acetal- ketal reaction is used for blocking of carbonyl compounds. For the protection process…

Q: A molecule with the molecular formula of C3H9N produces the IR spectrum shown below. Draw a…

A: The molecular formula of the compound is C3H9N. The double bond equivalence of the compound is…

Q: B. What is the hybridization on any carbon atom and the oxygen atom in phenol (shown)? (A) C = sp…

A: In the question it asking about the hybridization of carbon and oxygen atom.

Q: رجوع > ↑ 41 من 58 3.8. By pK, measurements it can be shown that 1,1,1-bicyclopentanecarboxylic acid…

A: The objective of the question is to explain why 1,1,1-bicyclopentanecarboxylic acid is more acidic…

Q: Classify the substances according to the type of bonds (nonpolar covalent, polar covalent, or…

A: When atoms share an equal number of electrons, a non-polar covalent bond is formed. There is no…

Q: The following three equations represent equilibria that lie far to the right. Identify the strongest…

A: In the given equilibrium reactions, the equilibrium position can be used to identify the strongest…

Q: Practice Question - Chapter 5 (Solutions and Aqueous Reactions) 13B. During a titration, a strong…

A: Titration: Titration is method of determination of concentration of analyte by using known…

Q: Polymers may be composed of thousands of monomers. Draw two repeat units of the polymer (dimer)…

A: Given that, the reaction is:

Q: Consider the following equilibrium system: 2 NF3(g) N2(g) + 3 F2(g) A 10.8 L evacuated flask is…

A: The objective is to compute the value of equilibrium constnat, Kc.Given Data:Volume, V is 10.8…

Q: An aromatic amine with a molecular formula of C1₁2H₁7NO gives the following IR and NMR data. Predict…

A: The objective is to determine the aromatic amine's structure with the formla; C12H17NO. The IR and…

Q: Give the structure for the compounds with the molecular formula and H-NMR data given below.…

A: The question is based on the concept of organic spectroscopy. We need to analyse the spectral data…

Q: You react the following molecule with a strong bulky base (like KOtBu), and you know that the Br…

A: Answer:In elimination reaction, atoms or groups leave the molecule and without any addition of any…

Q: 1: For a certain reaction, Kc = 1.63×105 and kf= 2.79 M−2⋅s−1. Calculate the value of the reverse…

A: Equilibrium is a state for a system when rate of forward reaction becomes equal to rate of backward…

Q: Write down the electronic configuration of As (Z=33). How many electrons are there in the following…

A: Electrons are filled in a different atomic orbital in an atom. According to the Aufbau rule, the…

Q: When a certain strong-field ligand forms an octahedral complex with Re cation, the energies of the…

A: Normally, the five d orbitals of the metal have the same energy. When a ligand approaches, the…

Q: 1) The following reaction were stirred for 2 hours: A NaBH, D MeOH If the TLC taken for the reaction…

A: The given question describes the monitoring the progress of the reaction by using TLC.

Q: What is the predicted major product of the reaction shown? A A Ar-N ClRus CI PCY3 CH₂=CH₂ Ph

A: Olefin metathesis is the formation of new C=C bond in the presence of Grubbs catalyst when two…

Q: 2NH3(g) + 3N₂O(g)- →4N₂(g) + 3H₂O(g) Using standard thermodynamic data at 298K, calculate the free…

A: The objective of the question is to calculate-The free energy change for the reactionThe Gibbs free…

Q: 32 g of sulfur will react with 48 g of oxygen to produce 80 g of sulfur troxide. If 20 g of sulfur…

A: Mass of S = 20 gMass of Oxygen(O2) = 100 gMolar mass of S = 32.06 g/molMolar mass of O2 = 32…

Q: Draw all possible conformations for the next molecule: H₂N NH₂

Q: You have two containers at a pressure of 1.00 bar. One contains 1.00 mol of H₂O(g) at 450 K, and the…

A: Given,For H2O (g): mole(n)=1 mol, Po=1 bar P=20 bar, temperature(T)=450KFor H2O (l): mole(n)=1 mol,…

Q: Draw the major organic product of the following reaction, and select the mechanism which would…

A: The reactant is an organic compound consisting of a cyclohexane ring and a chiral carbon. The chiral…

Q: 7. The smallest alkene that requires a numbered position for the double bond when naming the…

A: Organic compounds are compounds that contain carbon-carbon or carbon-hydrogen bonds.

Q: Calculate the [H+] of a 0.82 solution of HSCN (pKa = 4.00).

A: The objective of this question is to calculate the concentration of hydrogen ions [H+] in a 0.82 M…

Q: Enter your answer in the provided box. Enter your answer in scientific notation. A first-order…

A: Given:Rate constant (K) for first-order decomposition reaction = 0.00393 yr-1We have to determine…

Q: 4. what is the percent concentration(mass/volume) of a 2.5 M NaOH solution?

Q: Determine AGrxn for 2 A(g) + B₂(g) → 2 AB(g) A. -400 kJ B. -250 kJ C. -200 kJ D. -100 kJ E. -50 kJ…

A: ΔG for A (g) = 0 kj/molΔG for AB (g) = -100 kj/molΔG for B2 (g) = -150 kj/molWe have to calculate…

Q: For which of the following reactions is AS° > 0. Choose all that apply. 2NH3(g) +20₂(g) → N₂O(g) +…

A: ∆n(g) = total number of moles of gaseous products - total number of moles of gaseous reactantsIf…

Q: What substances absorb moisture or promote the retention of moisture in the hair? O a. humectants b.…

A: Hair moisture retention is vital for healthy, lustrous locks. To maintain optimal moisture levels,…

Q: On the molecule below, identify all electrophilic carbons by labeling each with a delta plus (8+)…

A: When carbon atom is bonded to highly electronegative atom ( like oxygen, fluorine, nitrogen or…

Q: For a reaction, the larger value of eo (the lower value of peo) the more oxidation reaction is…

A: Oxidation involves the loss of electrons by a substance, leading to an increase in its oxidation…

Q: Examine the molecule below. Highlight all bonds that cannot rotate freely with respect to the rest…

A: Single bonds, also known as sigma (σ) bonds, are the bonds that can rotate freely. Sigma bonds are…

Q: Consider two CH4 molecules between which there is only van der Waals force. In the infrared…

A: As per the Heisenberg uncertainty principle, the exact momentum and exact position of the subatomic…

Q: What will happen if a small amount of hydrohloric acid is added to 0.1 M solution of HF? A. The…

A: The objective of the question is to predict the change in the value of percent ionization.

Q: Answer the questions in the table below about this molecule: What is this molecule's chemical…

Q: 17. Ethane, ethanol, and ethanoic acid have some structural similarities, as suggested by their…

A: In the given question we have to draw the structural diagram, identify the intermolecular forces,…

Q: What are the products of the reaction between HF(ag) and KOH(aq)? a) water and NaF(aq) Ob) water and…

A: The objective is to select the correct option regarding the products formed in the reaction of HF…

Q: Highlight the atoms or groups that are in hydrophobic portions of this molecule in blue, and the…

A: Hydrophobic groups are generally those groups which are non-polar in nature and interact with the…

Q: Enter an equation to show how HC2O4 can act as a base with HS acting as an acid. Express your answer…

A: an acid is a species which donates protons while a base accepts protons.An acid after donating…

Q: The difference between chemical and nuclear reactions is nuclear reactions change the nucleus,…

A: A nuclear reaction is a reaction in which the nuclei of an atom are converted to other nuclei. The…

Q: Draw Newman projection of both eclipsed and staggered conformations F. FF F LL OH

A: The Newman projection represents the dihedral angles of different conformations of a molecule. In…

Q: A crystal was analyzed with x-rays having 2.54 A wavelength. The angle of first-order diffraction (n…

Q: Bq What is the specific activity in if 2.94 kg of an isotope emits 4.07 x 107 B particles per…

Q: me following equation, how many hydrogen atoms are added or lost? 0-8 O one hydrogen atom added O…

A: We have to find how many hydrogen are added or lost in the reaction.

Q: 6. Shown below is the reaction of nitrobenzene (C6H5NO2) with H₂ to form aniline (C6H7N) and water,…

A: C6H5NO2(l) + 3H2(g) -----> C6H7N(l) + 2H2O(l) ∆H°rxn = -552.5…

Q: Predict the major organic product for the following reactions. Clearly indicate the stereochemistry…

A: Elimination reactions are reactions in which the leaving group leaves and a beta proton is…

Q: Please write the major organic product

A: In Micheal's addition reaction, a nucleophilic addition reaction takes place at the carbon-carbon…

Q: What does "X" represent in the following symbol? 65 29 X dysprosium copper O nickel terbium silicon

A: To determine the element represented by "X" in the symbol , we need to understand how atomic…

Q: Give the systematic IUPAC name for the following. CH3

A: This question can be solved easily if we know the nomenclature of bicyclo compounds.

Question

Why do the complexes a,b,c,d display such different colours

a) trans-Ru(II)Cl2(py)4

b) trans-Ru(II)Cl₂(acpy)₄

c) trans-Ru(II)(NCS)₂(py)₄

d) trans-Ru(II)(NCO)₂(py)₄

AI-Generated Solution

AI-generated content may present inaccurate or offensive content that does not represent bartleby’s views.

Unlock instant AI solutions

Tap the button
to generate a solution

Click the button to generate
a solution

SEE SOLUTION

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.