Why does NH3 forms intermolecular hydrogen bonds whereas PH3 doesnot?

Q: Compare the nature of the bonds in PbCl2 to that of the bonds in PbCl4.

A: The bond that is formed by the transference of electron completely from one atom to the other atom…

Q: in an average O3 molecules "lives" only 100-200 seconds in the stratosphere before undergoing…

A: Decomposition is a process in which single molecules break into more molecules. The reaction in…

Q: what is the chemical formula created when sodium (11) bonds with the polyatomic ion chromate?

A: The chemical formula for a compound consisting of a cation Am+ and an anion Bn- can be written like…

Q: Why does sodium fluoride have a melting point of 993°C but nitrogen has a melting point of -210°C?

A: Please find your solution below : Melting point of any substance is defined as the temperature at…

Q: radius atom C. The more acidic compound has a more stable conjugate base because of addition…

A: In the given question we have to define why hydrogen sulphide (H2S)  is more acidic than Water (H2O)…

Q: Explain in detail why a catalyst is used to produce SO3.

A: Solution- SO3 is produced by the oxidation of SO2 .This was done during contact process.H usually a…

Q: Write the chemical equation involved in the preparation of sodium hydroxide. Name the process ?

A: Given preparation,            Sodium hydroxide preparation.

Q: Calculate the concentration of chloromethane (CH;CI) in water (mg/L to four significant figures) if…

A: Gas concentration = 0.25 % Lets total pressure = 1 atm As percent of concentration is similar in…

Q: What is the electron- pair geometry of the central oxygen atom of O-Zone (O3) ?

A: Ozone molecular formula O3  In ozone Central oxygen atom can share 3 electron pairs .

Q: What forms when the oxides of pollution react with water? O acid rain O carbon dioxide O kerogen

A: The sulphur oxides and nitrogen oxides are common oxides which causes pollution.

Q: What would we call the molecule H2CO3 if it disassociates in water to form h+ and HCO3-

A: The concept of acids and bases is explained by the following theories Arrhenius theory…

Q: How do the acidities of aqueous solutions of Tl₂O and Tl₂O₃ compare with each other? Explain.

A: Concept introduction: Acidic substance are those substance which has pH is lower than 7. Basic…

Q: 9. Draw the structure of the major organi- HBr H₂O

A: Organic reaction are those in which organic reactant react to form organic products.

Q: Explain why thallium(I) fluoride is very soluble in water but other thallium(I) halides are much…

A:

Q: What is the structure? The chemical formula is C4H8O3

A: IR spectrum is used to identify the functional group present in an organic compound. And 13C NMR is…

Q: What is the chemical formula for VC2H3O2?

A: It is vanadium acetate This is a salt formed by vendium hydroxide and acetic acid.

Q: why PCL5 act as an effective chlorinating agent?

A: The given compound is PCl5.The chemical name of PCl5 is phosphorus pentachloride. The shape of PCl5…

Q: What acid is produced by the reaction of I2O5 with water?

A: Acids are the species that produce hydronium ion when dissolved in an aqueous solution.

Q: The boiling points of group 16 binary hydrides are as follows: H2O 100 oC; H2S -60 oC; H2Se -41 oC.

A: Boiling points is directly affected by the intermolecular forces. Stronger the intermolecular…

Q: What is the balanced chemical equation for the reaction that occurs when (NH4)2CO3 is heated?

A:

Q: pH of the salt NH4Br

A:

Q: Complete and balance the equation Co(C2H3O2)2•4H2O

A: A balanced equation can be defined as the equation in which equal number of atoms of each element is…

Q: For each compound (all water soluble), would you expect theresulting aqueous solution to conduct…

A: A substance which when dissolved in water, dissociate into its corresponding ions in the solution,…

Q: What is the chemical formula of ammonium hydrogenphosphate? (NH4)3PO4 O (NH4)2HPO4 NH4HPO4 NH4H2PO4

A: A set of chemical symbol present showing the element present in the compound and their relative…

Q: Write an equation to show the reaction between plaster of Paris and water.

A:

Q: What is the concentration of HOCI required to oxidize 30 mg/L of dissolved nitrogen in NH3 to form…

A:

Q: What is the oxidation number of C in CCl4?

A: We have to find the oxidation number of C in CCl4.

Q: Calculate the percentage composition for C2H6O.

A: To determine the percentage composition for C2H6O. The molar mass of C2H6O is 46 g/mol.

Q: with an explaination, state whether you would expect the OH bond in water to be longer or shorter…

A: The bonds given are O-H bond and S-H bond.

Q: Complete and balance the following equations: (a) CaO1s2 + H2O1l2 ¡

A: Calcium oxide reacts with water to form calcium hydroxide. This reaction is highly exothermic in…

Q: Write a balanced chemical equation for the decomposition of CaCO3 on heating and explain what the…

A: ✓CaCO3(s)=CaO(s)+CO2(g) ✓ following are two important sources of carbon dioxide when this Reaction…

Q: What is the ratio of N2 to NH3 according to this chemical equation ? 3/1 2/1 1/2 1/1

A: Nitrogen reacts with hydrogen to form ammonia. The equation for the balanced chemical reaction is…

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Write the equation for the formation of silver acetylide by adding ammoniacal silver nitrate to…

A:

Q: Classify and describe the properties of the following nitrogen containing compound. Provide a…

A: Ther eis more than one question, and all are different. I will answer only the first one, if you…

Q: Sulfurous acid has Ka1 = 0.0123 and Kaz = 6.607 x 108. At what pH does [HSO3] = [SO3²]?

A: H2SO3  ↔  HSO3-  +  H+                     Ka1 = 0.0123HSO3-  ↔  SO32-  +  H+…

Q: Classify the relationship between the two structures show and Br

A: Constitutional isomers have the same formula but not the same connectivity of atoms. Enantiomers are…

Q: What is the stoichiometric ratio between Cu2+ and Na2S2O3

A: In the reaction between Na2S2O3 and Cu2+ in a solution, copper thiosulfate CuS2O3 is expected to be…

Q: Write the Lewis dot structure for dicarbon tetrahydride.

A:

Q: A solution of potassium chloride is neutral whereas a solution of bismuth (III) chloride is quite…

A: Potassium chloride (KCl) is the salt of a strong acid, HCl and strong base, KOH. Potassium ions (K+)…

Q: Give reason 2 a) PCl5 acts as an oxidising agent. b) Dinitrogen is chemically inert

A: If the compound itself try to reduce then it will oxidise other . If the compound oxidise other…

Q: Chemical formula of Pb2+ and SCN-

A: A chemical formula is formed by following the method of criss-crossing the valencies of ions.

Q: MCQ 109: In nature, Magnesium Oxide (MgO) is A. acidic B. alkaline C. catalyst D. neutral

A: Magnesium is an element placed in group 2 of the periodic table. It is a metal and on combining with…

Q: Explain why phosphine, PH3, is less polar than ammonia?

A: The less polarity of PH3 than NH3 is discussed below,

Q: When 0.001 M of aqueous solution of each of the following compounds is prepared, which solution will…

A: In this question, we will see which compound have greatest electrical conductivity.  You can see the…

Q: Chemical formula of NH4+ and CO32-

A: The NH4+ is the ammonium ion. It is a cation as it contains a positive charge. The CO32- is the…