Answered: with an explaination, state whether you…

with an explaination, state whether you would expect the OH bond in water to be longer or shorter than the SH bond in hydrogen sulfide.

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter7: Covalent Bonding

Section: Chapter Questions

Problem 10QAP: Follow the directions of Question 9 for the following species: (a) (b) Br2Câ€”CF2 (c) H3Câ€”NH2

See similar textbooks

Related questions

Q: Below is a picture of the structure of water or H2O. Why do you think there is a “d+” or a positive…

A: In the polar molecule, one end occupies the partial positive charge while the other end occupies the…

Q: Arrange the following ionic COMPONS in order of increasing magnitude Lattice eney: Base, cas, Csl

A: Lattice Energy is the energy required to completely separate the one mole of the solid ionic…

Q: When comparing binary acids of the elements in the same row of the periodic table, acid strength…

A: In the periodic table the acidic strength increase on going from left to right.

Q: Why is there only a double bond between the oxygen and carbon but not the chlorine?

A: We have to answer why only a double bond is formed between the carbon and oxygen atoms but not…

Q: Which is the correct order of acidity of the following silicon halides? A. SIF4<SICI4<SiBr4<Sil4 B.…

A: Silicon halides are lewis acids. And the lewis acidity depends on the positive charge on central…

Q: Which is the sronger acid CCl3CH2COOH or CCl2FCH2COOH (explain or draw lewis structures)

A: Order of acidity in between two molecules can be either differentiated based on Resonance structure…

Q: Write the chemical name for BF3, Type of Bonding: Show Lewis Structure or Bonding in the solution…

Q: Calculate the [H3O+] when pOH = 5.43

A: The [H3O+] is to be calculated when pOH = 5.43.

Q: b) Diagram 9 shows the elements from a Period found in the periodic table 23.0 24.3 27.0 28.1 31.0…

A: Metals generally form basic oxides whereas non-metals form acidic oxides. Some metals form oxide…

Q: Predict whether the N—O bonds in NO 3 are stronger or weaker than the N—O bonds in NO+.?

A: The N—O bonds in NO3- are stronger or weaker than the N—O bonds in NO+ has to be given,

Q: Explain why difluorine monoxide is a polar molecule but carbon tetrafluoride is a non-polar…

A: Given molecules: difluorine monoxide (OF2) and carbon tetrafluoride (CF4). We have to explain why…

Q: Two possible Lewis electron-dot diagrams for fulminic acid,

A: Given Data: The bond energy of N-O bond is 201 kJ/mol. The bond energy of C=O bond is 745 kJ/mol.…

Q: Explain the chemical bonding between Ca and a atoms with the help of Lewis electron dot structure?

A: The chemical bonding between Ca and Cl atoms with the help of lewis electron dot structure has to be…

Q: 3. Give a and the for the Owing compound: a. Lithium sulfate b. KCIO3 c. Aluminum carbonate d. Al…

A: We will give name of the the compound

Q: Choose the MOST acidic hydrogen from the structure below. II III IV O II O IV

A: The most acidic hydrogen will be present at alpha position to the electron withdrawing group. The…

Q: Draw the Lewis-Acid base adduct with formal charges for the reaction of BH3 with THF

A: Acid and Base are classified according to Lewis theory Here we are required to draw the acid Base…

Q: Would you expect that an anion would be physically closerto the oxygen or to the hydrogens of water…

A: The interaction between an anion and a water molecule can be represented as -

Q: Draw Lewis structures of the peroxide ion and the oxygen molecule

A: The Lewis structures of peroxide ion is:

Q: What is the purpose of the sulfuric acid?

A: Purpose of sulphuric acid

Q: Each of the following properties shows a regular trend inGroup 1A(1). Predict whether each increases…

A: NOTE ; Since you've posted multiple sub-parts,we'll solve only first three sub-parts for you. To get…

Q: Calculate the number of total valence electrons and draw the Lewis structure for the hypothetical…

A: H -1e- At -7e- (7A group element Astatine) O - 12e- (each 6e- × 2) Total = 20e- (valence)

Q: Sketch and label 6-8 H2O molecules interacting in the liquid phase.

Q: 3) What is the [H'] when [OH]= 8.1 x 10°?

A: Given, [OH-] =8.1×10-5 Mwe are asked to calculate the [H+]

Q: substitute for each of those elements? The oxygen can be substituted by the sulfur. Hence, H,0 can…

A: For comparison we have to consider intermolecular forces , size and electronegativity in our…

Q: Write the formula of the compound more likely to form from: a) Cuprous ion and peroxide ion b)…

Q: With the aid of a diagram, describe the covalent bonds that an oxygen atom with atomic number 8 can…

A: When two or more elements have incomplete octet ,then if they share their valence electrons in such…

Q: Draw all of the Lewis structures of O22- which obey the octet rule and use this Lewis structure or…

A: We have to choose Correct statement.

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: (e) The mobility of H+ ions is very high because of the small size and other reasons. The mobility…

A: A question based on electrolysis that is to be accomplished.

Q: To draw a lewis structure for the phosphate ion you must what?

A: Lewis structure represents the valence shell electrons in a compound. It shows the distribution of…

Q: Assuming that the effect of bond energy is more important than the effect of electronegativity, the…

A: Bond energy of HI is 295 kj per mole while bond energy of HCl is 428 kj per mole . having less bond…

Q: 2. Give the shape and the corresponding bond angle for a molecule of formula QX, where Q is an…

A: The three dimensional arrangement of atoms in a molecule is referred to as its molecular geometry.…

Q: Arrange the following in the order of the property indicated for each set–(a) F2, Cl2, Br2,…

Q: In the van der Waals equation which molecule would you expect to have the largest b value? PH3 SbH3…

Q: In what sense is acetylene a protonic acid? Explain why its reactions with ammoniacal cuprous…

A: Protonic acid is the compound or molecule that has the ability to produce H+ ions in the solution.…

Q: 12. Draw the Lewis Structures for each of the following molecules and ions by first clicking on the…

A: Since you asked multiple questions so as per Q&A guidelines of portal I solve first image…

Q: (e) The mobility of H+ ions is very high because of the small size and other reasons. The mobility…

A: Due to its small size, H+ can move quickly in the aqueous solution. However, its exceptional…

Q: (e) The mobility of H* ions is very high because of the small size and other reasons. The mobility…

A: Mobility is defined as the distance travelled by ion per second under potential gradient of 1 volt…

Q: Describe the bond formation between hydrogen and flourine. What type of chemical bond do they form…

A: Atoms are held together in a molecule because of some attractive and repulsive forces. These forces…

Q: Assuming that the effect of bond energy is more important than the effect of electronegativity, the…

A: An acid H-X is supposed to be more acidic if it can easily donate proton. The more the ease of…

Q: Sulfuric acid is prepared by oxidizing sulfur to sulfur dioxide and then to sulfur trioxide.…

Q: List the acids containing the group 7 elements HF, HCl, HBr and HIin order of increasing bond length…

A: The acids given are HF, HCl, HBr and HI.

Q: below

A: Na2S dissociates in water to it's ions

Q: Draw the lewis dot diagram and lewis structure of Nitric Acid (HNO3)

Q: answer these questions with NaOH *State two examples of another substance of the same type with the…

A: 1.) Sodium hydroxide (NaOH) has ionic bonding and the examples similar to it are- a. Magnesium…

Q: How does the acidity of the binary acid of an element vary as a function of the electronegativity of…

A: The most primitive definition of acid is that an acid is a chemical species that releases H+ ion in…

Q: Ql: Are the van der waals bonds chemical or physical bonds? Explain the formation mechanism of these…

Question

with an explaination, state whether you would expect the OH bond in water to be longer or shorter than the SH bond in hydrogen sulfide.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Which is the sronger acid CCl3CH2COOH or CCl2FCH2COOH (explain or draw lewis structures)
Write an equation to show that hypochlorous acid , HClO , behaves as an acid in water. + H2O = +
Write the balanced Ka and Kb reactions for HSO3 - in water. Include physical states for each species.
Assuming that the effect of bond energy is more important than the effect of electronegativity, the substance HCl is expected to be a stronger acid than the substance HF. _______truefalse
how many ionizable hydrogens are in H 4 P 2 O 5
Use polarity and bond strength arguments to explain why HF is a stronger acid than H2O.
Which of the following is chloric acid? HClO3 HClO HClO4 HClO2
Which of the following elements is likely to form a strong acid with oxygen? Select one: a.N b.Al c.P d.Na The central atom in __________ does not violate the octet rule. Select one: a.KrF2 b.CF4 c.SF4 d.XeF4
Each of the following properties shows a regular trend inGroup 1A(1). Predict whether each increases or decreases downthe group: (a) density; (b) ionic size; (c) E−E bond energy; (d) IE₁; (e) magnitude of ΔH(hydr) of E⁺ion.
Which of the following compound is polar covalent? If a sample of helium gas has a volume of 120 mL and a pressure of 850 mm Hg, what is the new volume if the pressure is changed to 425 mm Hg ?
Draw the lewis dot diagram and lewis structure of Nitric Acid (HNO3)
Write the equations that represent the first and second ionization steps for telluric acid (H2TeO4) in water. (Use H3O+ instead of H+.) First ionization step: + H2O(l) + Second ionization step: + H2O(l) +