Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended compound. Q.) 1,3-Dimethylbutane

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: Rules to find IUPAC name 1) First select the longest carbon chain including principle functional…

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: What is the IUPAC name for the compound shown in the image?

A: The given compound is saturated hydrocarbon and has a ring structure with 5 carbon atoms. Since it…

Q: What is the IUPAC Name for the attached compound

A:

Q: Give the IUPAC systematically correct name for following molecule.

A: For IUPAC naming, we should give the minimum number to the functional groups.

Q: N-

A: IUPAC nomenclature refers to the systematic approach of naming the organic compounds under the…

Q: The IUPAC name of the compound below

A: Organic compounds are named according to the IUPAC nomenclature which has some general rules. The…

Q: Determine which part/s of the following IUPAC name made them incorrect?Locant Parent length Prefix…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Q1. Name each of the following structures by the IUPAC system? B. C.

A: Given compounds are : IUPAC names of the given compounds = ?

Q: Give the IUPAC name of the ff.

A: IUPAC nomenclature of organic chemistry is a method of naming organic chemical compounds as…

Q: give the IUPAC name of the ff

A: Note : parent hydrocarbon is phenol and methoxy is at second position and allyl (prop-2-enyl)  is at…

Q: H

A:

Q: Give the IUPAC name for the following compound. Spell out the full name of the compound. (View…

A: Some rules to follow for writing names organic compounds: Identify the longest carbon chain. This…

Q: c)

A:

Q: Determine which part/s of the following IUPAC name made them incorrect?

A: Determine which part/s of the following IUPAC name made them incorrect? Isopropylbenzoate,…

Q: IUPAC name with E and Z Relerenc Provide the IUPAC name for this compound.

A:

Q: What is the IUPAC name for the above?

A:

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: IUPAC nomenclature: IUPAC stands for International Union of Pure and Applied Chemistry. The IUPAC…

Q: What is the correct IUPAC name for N2O?

A: Given molecule  N2O here Oxygen is More electronegative than Nitrogen So oxygen act as somewhat like…

Q: Give the IUPAC name for each of the following:

A: The longest possible carbon chain in the above molecule is of 6 carbon as shown below. Hence there…

Q: Determine which part/s of the following IUPAC name made them incorrect? Locant Parent length Prefix…

A: Determine which part/s of the following IUPAC name made them incorrect? Locant, parent length,…

Q: What is the IUPAC name of this compound?

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Q: Write the IUPAC name of each compound

A: IUPAC stands for International Union for Pure and Applied Chemistry. Naming of organic compounds is…

Q: N.

A: IUPAC nomenclature is to provide specific names to each compound representing the each substituent…

Q: Give the IUPAC name for the following compound. Br

A: To give IUPAC name to any compound we must know the rules for IUPAC nomenclature.

Q: F

A: IUPAC NomenclatureInternational union of pure and applied chemistry nomenclature , by this…

Q: What is the correct IUPAC name for the following molecule following the rules learned in this…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Provide the correct complete IUPAC name

A: The IUPAC naming of a chemical compound includes the following points are as follows --- i) At…

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: Organic compounds have a set of rules following which they can be named. These set of rules are laid…

Q: Give the correct IUPAC name for the following compound. Be sure to identify the longest chain! Br

A:

Q: What is the IUPAC name of the molecule shown?

A: When doing IUPAC name of a cycloalkane, start numbering the carbons of a cycloalkane with the…

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: The IUPAC naming is a standard naming system that provides the precise and accurate naming of the…

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: To explain the correct IUPAC name of the above compound we will draw the structure of the compound…

Q: What is the IUPAC name of this compound? H Other Exp

A: Write IUPAC name of the given structure ?

Q: rovide the most correct IUPAC name for the compound draw H₂C CH₂

A:

Q: (b) Give the IUPAC name for the following compound. CI

A:

Q: The IUPAC name for the two following compound is:

A:

Q: FI

A: The substituent group are F and Cl

Q: Give the IUPAC name of each molecule below

A: The IUPAC names of the above given compounds are as follows

Q: Name the following molecule by its IUPAC name. Br CI

A: Nomenclature of the given compound: Start numbering the ring in order to give the priority to…

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: The given IUPAC name is 2-Propylpentane. According to the given name, the structure is,

Q: Provide the IUPAC name for the molecule below:

A:

Q: CH, - C = C- CI

A: Given here a structure of a molecule, we are asked to write the IUPAC name for the compound.

Q: What is the IUPAC name of the illustrated molecule? HO

A: The naming of an organic compound can be done with help of rules of international union of pure and…

Q: Fl in the blank What is the IUPAC name for the following compound? H.

A: The given compound is drawn below :

Q: b) 'N'

A: It is clear that this structure is an amine as it contains an N atom. It has N atom at centre to…

Q: Explain why each is an incorrect IUPAC name and write the correct IUPAC name for the intended…

A: To find: The correct IUPAC name for 2,2-Dimethylcyclopropane

Q: Fill in the blank: What is the IUPAC name for the following compound? N.

A:

Q: SH

A: First numbering the compound in such a way that substituents are placed at least numbering and…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.