Answered: Why is the reference electrode placed…

Science

Chemistry

Why is the reference electrode placed near the working electrode in a three electrode cell?

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter21: Potentiometry

Section: Chapter Questions

Problem 21.1QAP

See similar textbooks

Related questions

Q: Describe structure of the glass electrodes cell membrane with aid of diagrams

Q: Explain the principle behind the working of an ion selective electrode

A: Ion selective electrode are electrochemical ion sensors that convert the activity of the target ion…

Q: Define electrode potential. How is it different from liquid junction potential? How and why is the…

A: A question based on electrochemistry, which is to be accomplished.

Q: sources of uncertainty in pH measurements with a glass/calomel electrode system.

Q: The table below gives the standard electrode potential values of some electrode. What standard…

A: The potential of all electrodes are measured by comparing their potential to that of standard…

Q: Define the term a standard hydrogen electrode?

A: An electrode is a point in the electrolyte where current enters and exits. The cathode is where the…

Q: Why is it important that the electrodes do not touch each other inside the lemon?

A: Electrochemical cells, also called batteries, require three things—two electrodes and one…

Q: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

A: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

Q: hat are the advantages of the glass electrode over t

A: Electrochemistry is a branch of chemistry that deals with electrical and chemical energy generation…

Q: Identify the components of a pH electrode and explain their functions. Explain throughly.

A: pH electrodes are analytical electrodes that are used to measure the pH of the solution depending on…

Q: Why

A: The standard hydrogen electrode is also known as a redox electrode and has a platinum electrode at…

Q: What is the calculated value of the cell potential at 2

Q: culate the potential of an aluminum electrode immersed in C satu

Q: Give the Nernst equation for the electrode potential of a redox electorode.

A: The nernst equation can be used to determine the cell potential of a cell in non-standard state.

Q: Draw the standard hydrogen electrode diagram by writing down the reference electrode types.

A: STANDARD HYDROGEN ELECTRODE USES: The electrode that is utilized to determine the electrode…

Q: What is the electrode potential of an electrode consisting of Zinc metal in a solution in which the…

A: Given, The electrode potential of an electrode consisting of Zinc metal in a solution in which the…

Q: How does a compound electrode differ from a simple ion-selective electrode?

A: An electrode is a material that connects to the non-metallic part of a device such as semiconductors…

Q: What are the advantages of glass electrode over hydrogen electrode? Please explain briefly.

A: An electrode is a solid electrical conductor that carries current into non metallic solids, or…

Q: What are the components of the fluoride ion selective electrode

A: Given: fluoride ion-selective electrode.

Q: (iii) Standard Hydrogen Electrode (SHE) is used to measure standard potential of electrodes.

A: This is the concept of electrochemistry

Q: what are the differences between the indicator electrodes and reference electrodes?

A: Introduction : Electrodes can be defined as the any substance that is a good conductor of…

Q: Inert metal electrodes, such as platinum and gold, generate an electrode potential that responds to…

A: Electrodes :- Electrodes are the good conductor of electricity and these are mainly two type…

Q: The conductivity of a 0.1 M [Co(NH3)6]Cl3 solution in an electrolytic cell containing an electrode…

A: Given conductance = 1.5×10-³ S electrode with a length of 0.15 cm and a cross-sectional area of 2…

Q: Given the over-all equation below, determine the value of standard cell potential (E of cell).

Q: List the sources of error associated with pH measurements made with the glass electrode.

A: The pH electrode is usually made of glass. Coatings on the glass surface can alter the pH readings…

Q: In a three-electrode cell, the [Select] is used to measure the potential of the working electrode…

A: Refrence Electrode - The ultimate purpose of Reference Electrode is used to provide a stable…

Q: Calculate the standard potential for the cell.

A: The first step is to determine the cell potential at its standard state — concentrations of 1 mol/L…

Q: How is the cell potential of an electrochemical cell related to the potentials of the half-cells?

A: An electrochemical cell or a galvanic cell is a device that can generate electricity due to the…

Q: Which of the following is not a type of electrode? A-) Three phase electrode Four Phase electrode…

A: Electrode is any substance which is a good conductor of electricity and these substances usually…

Q: a) Explain the working principle of a glass membrane electrode which can be used to measure H + or…

A: a) Glass electrode is a secondary standard electrode that is ; its emf is measured by coupling with…

Q: reference electrode

A: Individual half cell potential depends on temperature, pressure and concentration of solution. So…

Q: = standard potential of the cell, E°cell?

Q: Which of the following reference electrodes is least likely for its potential to change if some…

A: Saturated Calomel electrode is composed of Hg and HgCl2. The saturation is done by using KCl.

Q: What do you mean by ( i) negative standard electrode potential and(ii) positive standard electrode…

A: Standard electrode potential is defined as the potential of the electrode at the standard conditions…

Q: Draw a galvanic cell consisting of a chromium and cobalt electrode and calculate the standard cell…

Q: Calculate the exact half-cell potential for the Ag-AgCl electrode in 1 M NaCl.

A: Note - Since you have asked multiple question, we will solve the first question for you. If youwant…

Q: In a standard hydrogen electrode: A) delta G°<0 B) delta G°>0 C) delta G°=0?

A: C) delta G°=0

Q: 1. Describe the source of pH dependence in a glass membrane electrode.

A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…

Q: the standard electrode potential is measured by: a electrometer b voltmeter c galvanometer d…

A: The standard electrode potential is measured by electrometer is an instrument used for measuring…

Q: primary reference electrode and Secondary reference electrode?

A: A reference electrode is an electrode which has a stable and well-known electrode potential. The…

Q: Give an example of an inert electrode.

A: Inert electrode is defined as that electrode which is used for the flow of electron; it doesn't take…

Q: What electrode is X and Y?

A: charge flow from positive electrode to negative then electrons move from negative to positive…

Q: cell diagram of fluoride ion selective electrode

Q: By convention, the standard hydrogen electrode (SHE) is assigned a voltage of V.

A: Standard hydrogen electrod is a setup used to determine potential of other cells. It is also called…

Concept explainers

Potentiometric Titrations

Potentiometric titration is one of the important titration methods and is mainly carried out to characterize acid solutions. It follows a method similar to that of the normal titration technique, but the main difference is that there is no indicator used in the potentiometric titrations. Instead of using an indicator, electrodes are employed for monitoring the whole titration process. A scientist named Robert Behrend did the potentiometric titration for the first time, and it was done using the mercurous solution and potassium chloride.

Question

Why is the reference electrode placed near the working electrode in a three electrode cell?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
Is it reasonable to conclude that a potential could be assigned to each half-cell in a voltaic cell, based on these data for three voltaic cells? Explain. Zn(s)|Zn2+(aq)||Cu2+(aq)|Cu(s) cell potential=1.10 V Zn(s)|Zn2+(aq)||Ag+(aq)|Ag(s) cell potential=1.56 V Cu(s)|Cu2+(aq)||Ag+(aq)|Ag(s) cell potential=0.46 V