5. Erina observed that the borax she uses to clean the house is only partially soluble withwater. She found on the internet that borax is composed of sodium tetraborate(Na,B,0;(OH), • 8H,0) and wanted to analyze its solubility. The dissolution of borax is:Na,B,0;(OH), • 8H20(9 = 2 Na (aq) + B40;(OH), (aq) + 8 H20oA 50.0 mL saturated solution was prepared for the experiment. After filtering the solution,a 5.00 mL aliquot was transferred to a 25.0 mL Erlenmeyer flask and was titrated usingpre-standardized 0.4320 M HCI. The endpoint was reached after the addition of 4.73 mLtitrant.Since the tetraborate anion (B,0;(OH),?) is a weak base, the tetraborate ion reacts withHCI by the reaction:B,0,(OH), (aq) + 2 H*(aq) + 3 H,0g = 4 H;BO3(aq)a. Write the K, expression for the dissolution process.

Solubility product: It is defined as the product of its dissolved ion concentrations raised to the…

Answered: Write the K, expression for the…

Science

Chemistry

Write the K, expression for the dissolution process.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.103QE

See similar textbooks

Related questions

Q: What is the pH of a hydrocyanic acid/sodium cyanide buffer in which the concentration of the weak…

A: we have to calculate pH of the given buffer solution

Q: In the laboratory, a general chemistry student measured the pH of a 0.546 M aqueous solution of…

A: Since you have posted multiple questions which are not sub-parts, we are entitled to answer the…

Q: Write the Ksp expression for the sparingly soluble compound silver iodide, AgI. If either the…

A: Since we know that for a sparingly soluble compound AgI the dissociation into its ions will be…

Q: Why is it important that the color change occurs by the addition of a single drop? Explain in terms…

A: Colour change is the main indication for the completion of a titration.

Q: During the titration of sodium carbonate with sulphuric acid why are two indicators used and what is…

A: The above titration is the titration of a weak base against a strong acid. In such cases, the acid…

Q: The solubility product value for copper(II) 1odate, LullU same temperature. Express the solubility…

Q: Complete the text with the correct words! The Le Chatelier-Brown principle declares that the effect…

A: Introduction: According to Le Chatelier's principles, the changes in external factors like pressure,…

Q: Complete the following solubility constant expression for Ni(OH),. Ksp 믐

A: The solubility product, Ksp, of ionic compound is the product of concentration of the ions which…

Q: A saturated solution of a slightly soluble electrolyte in contact with some of the solid electrolyte…

A: Saturated solution : A saturated solution is one which has maximum amount of solute dissolved…

Q: How will Le Chatlier’s Principle be used to? Cause an insoluble salt to become more soluble

A: Lechatelier's principle can be used to explain the solubility of insoluble salt by disturbing…

Q: Enter the Ksp expression for the solid AB2 terms of the molar solubility x

A: AB2 Type Ag2CrO4, PbI2,CaF2 Ksp=solubility product

Q: . Commonly used standards for the direct determination of the normality of an acid. 2. It is used…

A: Given: 1. Commonly used standards for the direct determination of the normality of an acid. 2. It…

Q: The molar solubility of nickel(II) sulfide in a 0.193 M ammonium sulfide solution is

Q: What is the secondary interaction betw heat? By changes in pH?

A: This question belongs to Biomolecules.

Q: The addition of an acidic solution to a buffer solution with a pH of 8.3 would most likely result in…

Q: Complete the following solubility constant expression for BaSO . K = 0 sp

A: Solubility product constant is equilibrium constant when solid dissolves in aqueous solution.…

Q: Consider a mixture of 1.36 M HCIO and 1.65 M NaCIO. Given that the K, for HCIO = 2.9 x 10-8…

Q: In terms of pH indicators, please fully explain what must occur in a solution to observe a colour…

Q: What mass of NaCH,CO, should the student dissolve in the HCH,CO, solut

Q: Determine the K, for iron(IIl) hydroxide if it has a molar solubility of 1.3 x 10^-10 mol/L. at 25…

A: The dissociation of iron(III) hydroxide is given by following equation Fe(OH)3 →Fe3+ + 3OH-

Q: What is the definition of titer? Specifically in analytical chemistry.

A: Explained as follows

Q: Why is there a discrepancy between the calculated pH and the experimental pH of a prepared buffer…

Q: The titration of a weak acid with NaOH showed two equivalence points. Using only this information…

A: Each equivalence point during titration indicates the neutralization of one replaceable hydrogen…

Q: Compute for the molar solubility of cadmium hydroxide which is slightly soluble in water if the Ksp…

Q: Write the K

A: Kb is the equilibrium constant in case of base. Kb is the ratio of product of concentration of…

Q: What is the relationship between the formula for an insoluble ionic compound and the expression to…

A: For an insoluble ionic compound solubility is determined with the help of solubility product(Ksp) .…

Q: Solid barium nitrite is slowly added to 75.0 mL of a ammonium phosphate solution until the…

Q: What is the solubility product expression for the compound, Ag₂CO3?

Q: Topic: QUALITATIVE ANALYSIS IN ANALYTICAL CHEMISTRY a. Differentiate General Test and Confirmatory…

A: Qualitative analysis is the idenfication of the chemical compounds or its component elements but…

Q: Write the solubility product expression for barium chromate .

A: Solubility product constant (Ksp)is the equilibrium constant for a solid substance dissolving in an…

Q: Which student is correct? Provide evidence from the solubility curve to support your claim.

A: A solubility curve seems to be a data-driven graph that indicates how much solute can disperse in a…

Q: The molar solubility of lead phosphate in a 0.213 M ammonium phosphate solution is М.

A: Given: Concentration of ammonium phosphate i.e. (NH4)3PO4 = 0.213 M Since (NH4)3PO4 is a completely…

Q: How can we calculate the Molar Solubility in the Presence of a Common Ion?

A: To find: How can we calculate the Molar Solubility in the Presence of a Common Ion.

Q: Arrange the salts by their molar solubility in water. Consult the table of solubility product…

Q: For the titration of a strong acid with a strong base, which statement below is FALSE?

A: Answers = only this statement are FALSE The indicator changes color at the end point due to excess…

Q: Complete the following solubility constant expression for CaF2. Ksp =

A: The solubility constant expression for CaF2, can be written by writting its balanced equation so…

Q: Express Ksp in terms of molar solubility, x, for the salts with the given formulas.

A: Solubility is the molality of saturated solution. Solubility equilibrium - when the sparingly…

Q: The molar solubility of M2X5 is 6.44 x 10-9 M. Determine the solubility product constant for M2X5.

A: M2X5 ↔ 2 M+5 + 5 X2-

Q: The volume of water needed to dissolve 0.0600 grams of barium sulfate is L. Assume no volume change…

Q: Complete the following solubility constant expression for Co (OH),. sp =

Q: Write the solubility product expression for the following compound. MnS Ksp

Q: Write the K, expression for the sparingly soluble compound calcium sulfide, Cas.

A: Given: To write the expression for the sparingly soluble compound calcium sulfide, CaS.

Q: What is the Kep expression (in terms of molar solubility) for thallium (0 chromate (Tl,CrO,)?

A: Solubility product (Ksp) is defined as the maximum product of the activities or ionic concentrations…

Q: solubility-product constant for this salt at 25 °C.

A: Since Ksp of LaF3 = 2X10-19 And the reaction is LaF3 ----> La3+ + 3F- Hence Ksp = [La3+][F-]3

Q: In the laboratory, a general chemistry student measured the pH of a 0.558 M aqueous solution of…

A: The base (B) isoquinoline C9H7N in aqueous solution can be represented as,…

Q: Increasing Molar So.. Calcium fluoride Calcium Calcium Calcium jum sulfate hydroxide Ksp 47x10 6…

Q: The correct mathematical expression for finding the molar solubility of SnOH2SnOH2 is

Q: Derive an expression for the temperature coefficient of the solubility, dxB/dT.

Q: Write the K, expression for the sparingly soluble compound copper(II) hydroxide, Cu(OH),. If either…

A: Copper (II) hydroxide or cupric hydroxide [Cu(OH)2] is a blue colour solid. It is sparingly soluble…

Q: Complete the following solubility constant expression for CaF2. K sp

Question

5. Erina observed that the borax she uses to clean the house is only partially soluble with
water. She found on the internet that borax is composed of sodium tetraborate
(Na,B,0;(OH), • 8H,0) and wanted to analyze its solubility. The dissolution of borax is:
Na,B,0;(OH), • 8H20(9 = 2 Na (aq) + B40;(OH), (aq) + 8 H20o
A 50.0 mL saturated solution was prepared for the experiment. After filtering the solution,
a 5.00 mL aliquot was transferred to a 25.0 mL Erlenmeyer flask and was titrated using
pre-standardized 0.4320 M HCI. The endpoint was reached after the addition of 4.73 mL
titrant.
Since the tetraborate anion (B,0;(OH),?) is a weak base, the tetraborate ion reacts with
HCI by the reaction:
B,0,(OH), (aq) + 2 H*(aq) + 3 H,0g = 4 H;BO3(aq)
a. Write the K, expression for the dissolution process.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
The ore cinnabar (HgS) is an important source of mercury. Cinnabar is a red solid whose solubility in water is 5.5 X 10-2 mol L-1. Calculate its \p. What is its solubility' in grams per 100 g of water?
The Handbook of Chemistry and Physics (http://openstaxcollege.org/l/16Handbook) gives solubilities of the following compounds in grams per 100 mL of water. Because these compounds are only slightly soluble, assume that the volume does not change on dissolution and calculate the solubility product for each. (a) BaSiF6, 0.026 g/100 mL (contains SiF62- ions) (b) Ce(IO3)4, 1.5102 g/100 mL (c) Gd2(SO4)3, 3.98 g/100 mL (d) (NH4)2PtBr6, 0.59 g/100 mL (contains PtBr62- ions)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Given the following data: PtCl42(aq)+2ePt(s)+4Cl(aq)Ered=0.73VPt2+(aq)+2ePt(s)Ered=1.20V Find Kffor PtCl42- at 25°C.
What would be the KPs value of Al(OH)3, considering that its solubility is 2,5 x 10^-8 mol/L?
Adenosine triphosphate, ATP, is used to store energy within biological systems. It releases that energy by losing a terminal phosphate group, Pi, to form adenosine diphosphate, ADP, through the hydrolysis reaction ATP(aq) + H2O(I) → ADP(aq) + Pi(aq) + H+(aq) . The standard reaction Gibbs energy, ΔrGΘ, for the hydrolysis of ATP to ADP is+ 10 kJ mol-1 at 298 K.This assumes that the concentration of hydrogen ions is 1 mol dm-3 . (a) In biochemistry, it is common practice to assume an alternative , and more realistic, standard state for which pH = 7. What is the corresponding standard reaction Gibbs energy, denoted ΔrGΘ, for this biological standardstate? (b) What is the Gibbs energy of reaction in an environment at 37 °C and pH = 7 in which the ATP. ADP. and P; concentrations are all (i) 1.0 mmol dm-3, (ii) 1.0 μmol dm-3 ?
The standard reaction Gibbs energy for the reactionH2(g) + (1)/(2)O2(g) → H2O(I) is -237.13 kJ mol-1 at 25 °c. Determine the equilibrium constant in terms of concentration, Kc, at this temperature.
The equilibrium constant for the reaction CO(g) + H2O(g) ⇌ CO2(g) + H2(g) is K = 1.03 × 105 at 298.15 K. Calculate the standard reaction Gibbs energy at this temperature.
One ecologically important equilibrium is that between carbonate and hydrogencarbonate (bicarbonate) ions in natural water. (a) The standard Gibbs energies of formation of CO32−(aq) and HCO3−(aq) are −527.81 kJ mol−1 and −586.77 kJ mol−1, respectively. What is the standard potential of the HCO3−/CO32−,H2 couple? (b) Calculate the standard potential of a cell in which the cell reaction is Na2CO3(aq) + H2O(l) → NaHCO3(aq) + NaOH(aq). (c) Write the Nernst equation for the cell, and (d) predict and calculate the change in cell potential when the pH is changed to 7.0 at 298 K.
Rose was studying the electric field effect on bacterial growth when he unknowingly carried out an anodic reaction on the platinum electrode that led to the discovery of the anticancer drug cisplatin, cis-[PtCl2(NH3)2]. > Determine the formation constant (Kf) of cisplatin at 25 °C.
How many grams of cadmium are deposited from an aqueous solution of cadmium sulfate, CdSO4, when an electric current of 1.70 A flows through the solution for 214 min?