What is the general formula of cycloalkanes?

Q: Describe the main structural characteristics of alkane molecules.

A: The main structural characteristics of alkane molecules have to be described.

Q: Provide the IUPAC name the compound CH3(CH2)4-C=C-CH2CH=CH(CH2)7CH3. Parent name: Locants: IUPAC…

A: Given compound is :

Q: how to draw the condensed formula of Cyclohexane & Cyclohexene?

A: Hydrocarbons are the ones which contain carbon and hydrogen in them. The condensed formula of a…

Q: What is the general formula for alkynes?

A: Given :-  Class of compounds = alkyne  To be determined :-  It's general formula

Q: Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the…

A: Given: 3-ethyl-1,4-dimethylcycloheptane

Q: Distinguish between saturatedand unsaturated hydrocarbons

A: Distinguish between saturated and unsaturated hydrocarbons

Q: What is a Propane

A: Porpane is a Hydrocarbon which contain 3 carbon atoms and 8 hydrogen atom. Proapne = C3H8

Q: Iupac name of cycloalkane

A:

Q: What is the condensed formula of 3-ethylpent2ene?

A: The condensed formula is similar to structural formula. In former the arrangement of atoms is done…

Q: Name these branched-chain alkanes

A: Select the longest chain i.e. the principle carbon chain  Numbering Naming (prefix + word root +…

Q: Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the…

A: The given name is, 4-ethyl-3-isopropylheptane

Q: Naming of Alkanes, Cycloalkanes, and Alkynes 13. Write the IUPAC name for the given molecule

A:

Q: Explain cyclohexane and cycloalkane ?

A:

Q: What is the molecular formula of hopane?

A: Hopane is a triterpene. It forms a number of chemical compounds of the family hopanoids.

Q: Explain the process of Naming Cycloalkanes ?

A: In order to name a Cycloalkane, a cyclic ring must be present in the given compound. There is a list…

Q: What is the molecular formula for a monocyclic hydrocarbon with 14 carbons and 2 triple bonds?

A: Since it is the hydrocarbon. Hence, it will have only Carbon and hydrogen. Now we know that an…

Q: Describe the IUPAC rules for naming cycloalkanes.

A: IUPAC nomenclature is the International Union of Pure and Applied Chemistry. It is the method for…

Q: What is the general formula for an alkane

A: Alkanes are hydrocarbons that is they contain only carbon and hydrogens attached by single bonds…

Q: IUPAC naming cycloalkane

A: IUPAC naming of compound...

Q: What is the name of the cycloalkane containing five carbon atoms?

A: Cycloalkane contains -CH2 group present in a cyclic ring. In cyclo alkanes all single bonds. The…

Q: What is the CONDENSED structural formula for 2,3-dimethylpentane?

A:

Q: Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the…

A: Name of the compound is given as 1-ethyl-3-methyl-5-isopropylcyclohexane.

Q: How many hydrogen atoms are present in a cycloalkane that contains four carbon atoms?

A: Explained as follows

Q: Which molecular formula corresponds to a straight-chain alkane?

A:

Q: Naming Cycloalkanes

A:

Q: Draw the structure of cyclohexane.

A: In this question, we have to draw the structure of cyclohexane

Q: Draw the structure and give the molecular formula for a compound(a) 3-ethyl-1,1-dimethylcyclohexane

A: A molecular formula can be described as a way of representing the information about chemical…

Q: Definition of hexane isomers

A: Isomers are those which have same molecular formula but different structural formula.

Q: What is the condensed structural formula for methylcyclohexane?

A: The condensed structural formula is a way to represent the molecule’s no. of carbon atoms and…

Q: Draw the condensed STRUCTURAL formula for:   1,4-dichlorocyclohexane

A:

Q: Draw the structure of each alkane and cycloalkane from the given incorrect name. Then, give the…

A: The structure of the given compound from the given incorrect name has to be given,

Q: State the carbon atoms of Cycloalkanes ?

A: Cycloalkanes are rings which can be one or more than one rings. The general formula of the…

Q: A. Give the complete IUPAC names of the 1. 3. 2.

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub- parts for…

Q: Naming Cycloalkane

A: NOTE: The compounds given are not cycloalkanes but are rather alkynes due to the presence of…

Q: Differentiate Cyclohexane vs Benzene

A:

Q: What is the difference between saturated and unsaturated hydrocarbons?

A: The compounds in which only carbon and hydrogen atoms are present are known as hydrocarbon. They can…

Q: Determine the unique properties of Carbon and hydrocarbon compounds

A: Since, hydrocarbon are made up of carbon and hydrogen but it doesn't show much similarity with each…

Q: Line structural formula for pentane

A: Pentane corresponds to the carbon chain containing 5 carbon atoms. Therefore, it's structural…

Q: Name the following Alkanes and Cycloalkanes.

A: The rules of IUPAC nomenclature should be followed while naming the compound. The longest carbon…

Q: What is the line structure and structural formula of 2-ethyl-3,4-demithyl-1-hexanal?

A: Given :-  name of compound = 2-ethyl-3,4-dimethyl-1-hexanal  To draw :-  line structure  structural…

Q: What is the IUPAC name of this compound? CH 3 CH 2 CH 2 CH 2 CH 3 hexane pentane methylbutane octane…

A: We can write the IUPAC name of the compound according to the given rule... 1. first we identify the…

Q: What happened to the sigma bonds when a cycloalkane forms

A: Hydrocarbons are the compound formed by carbons and hydrogen through covalent bond. There are two…

Q: Name these organic compounds: structure name || CH;- CH,- CH — С — н || Н—С — ОН - - Он Н Н н ||| |…

A: On following the IUPAC guidelines , for the nomenclature of any organic compound the prefix and…

Q: Types of Structural Molecular formula Hydrocarbon formula Methane Ethene Propene Butane Pentane

A: Hydrocarbons:

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.