0.050 M of H2 and 0.050 M of Br2 are placed in an evacuated 5.0 L flask and heated to 700 K. What is the concentration of HBr in the flask when equilibrium has been established? The equation for the reaction is as follows: H2(g) + Br2(g) = 2HB1(g) K= 64 @ 700 K

0.050 M of H2 and 0.050 M of Br2 are placed in an evacuated 5.0 L flask and heated to 700 K. What is the concentration of HBr in the flask when equilibrium has been established? The equation for the reaction is as follows: H2(g) + Br2(g) = 2HB1(g) K= 64 @ 700 K

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 95QRT

See similar textbooks

Related questions

Q: A student ran the following reaction in the laboratory at 1094 K: 2503(g)2s02(g) + O2(g) When she…

A: First, determine the equilibrium mixture for the determination of equilibrium constant Kc as…

Q: the equilibrium constant K for the following reaction is 385.: At a certain temperature, NO₂(g) +…

A: given K= 385 NO=1.5 MOl CO2=1.5 MOl V=20L

Q: The equilibrium constant, K, for the following reaction is 1.64×103 at 455 K. PCI5(g) PCI3(g) +…

A: EQUILIBRIUM constant is defined as the ratio of concentration of products to the ratio of…

Q: 2) When 0.4 mol SO2 and 0.6 mol O2 were placed in an evacuated 1.0L flask , the following reaction…

A: Given Initial Number of mole of SO2 = 0.4 mole Initial Number of mole of O2 =…

Q: Phosphorous pentachloride decomposes according to the reaction PC15 (g) = PC13(g) + Cl₂ (g) A 15.7 g…

A: Here we have to determine the equilibrium constant of the following given reactions.

Q: 2NOBr(g) 2NO(g) + Br2(g) A sample of NOBR gas was placed in a container fitted with a frictionless…

A: "Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: The equilibrium constant for the reaction, 3 H2(g) + N2(g)= 2NH3(g), at a given temperature is 1.4 x…

Q: Write the Equilibrium Constant Expression for the equation below: 4 NH, (g) + 50, (g) 4 NO () + 6…

A: The equilibrium constant is the constant that tells us about the relationship between concentration…

Q: 4. The equilibrium constant, K, for the reaction: SO3(g)_+ NO (g) NO2 (g) + SO2 (g) was found to be…

A: Given data,K=0.500Initial moles of SO3=0.30molInitial moles of NO=0.300molVolume of container=2.00L…

Q: 1. Write the equilibrium constant expressions (K, and K) for the following reactions: 4NH,(g) +…

A: Write expression of Kc and Kp of the given reaction--

Q: Consider the following equilibrium reaction: 2 NO (g) + Cl2 () 2 NOCI (g) After the system had come…

Q: 3. The following reaction has the equilibrium constant, K, = 5.7 x 10°. N28) + Ozg) 2 2NO(g)…

A: To solve this problem first we have to write the equilibrium constant expressions then we will find…

Q: Suppose a 250. mL flask is filled with 1.7 mol of H,S, 2.0 mol of CS, and 0.80 mol of H,. This…

A: Given- Volume of flask = 250 mL Mole of H2S = 1.7 mole Mole of CS2 = 2.0 mole Mole of H2 = 0.80…

Q: 1.00 x 10-3 mol PCI5 is introduced into a 250 mL flask, and equilibrium is established at 284°C.…

A: We have given that Moles of PCl5 at initial = 1×10-3 mole Moles of Cl2 at equilibrium = 9.65×10-4…

Q: Write the equilibrium constant expression for the reaction: 2 SO3(9) = 2 SO2(g) + 02(9). K = [so ] K…

A: Write equilibrium constant expression of the given reaction---

Q: The equilibrium constant, K, for the following reaction is 1.04×10² at 548 K: NH,CI(s) NH3(g) +…

A: Given data,Kp=1.04×10-2temperature=548KMoles of NH4Cl=0.480molesVolume of flask=1.00L

Q: A student ran the following reaction in the laboratory at 658 K: 2 NH3 (g) N2 (g) + 3 H2 () When she…

Q: Write the equilibrium constant expressions (K, and K) for the following reactions 4NH,(g) + 5O,(K) =…

A: Eqilibrium constant can be defined as the ratio of concentration of products to concentration of…

Q: For the reaction 2 NH, (g) 3H,(g) + N,(g) the equilibrium concentrations were found to be [NH,] =…

A: Given: A reaction, 2 NH3(g)⇌3 H2(g)+N2(g) Concentration of NH3, [NH3]=0.250 M Concentration of H2,…

Q: The following reaction occurs spontaneously as written in the gas phase with a Kp = 4.6 x 1014 at a…

A: The equilibrium reaction given is, => NH3 (g) + HCl (g) ------> NH4Cl (s)…

Q: At 2000 K the equilibrium constant for the formation of NO(g) is 4.0 x 10-4 N2(g) + O2(g) -> <-…

A: Given, N2 is 0.50 M NO is 4.2 x 10-3 M O2 is 0.25 M K = 4.0 x 10-4

Q: 1.3 3 (ii) In the Haber process for the production of ammonia the following reaction occurs: N₂(g)…

Q: Suppose a 500. mL flask is filled with 0.60 mol of CO, 0.30 mol of NO and 1.7 mol of CO,. The…

Q: For the reaction: I2 + Br2 7 IBr at 300 degrees Celsius, K = 159.2. Are the following mixtures of…

A: The reaction is not at equilibrium as the K>Q Q=[IBr]2/[I2][Br2] = (2.50)2/0.210*0.360…

Q: For the reaction: H2 (g) +Br2 (g) = 2 HBr (g), the value of the equilibrium constant, K, is 2.0 x…

A: In this problem we considered K1 = equilibrium constant for first reaction…

Q: A container with a volume of 1.70 L was evacuated and then filled at low temperature with 0.0370 mol…

A: Given: Total pressure at equilibrium = 0.656 atm. Temperature = 25.0 oC And volume of vessel = 1.70…

Q: The equilibrium constant, K., for the following reaction is 2.25 at 681 K. 2NH3(g)N2(g) + 3H2(g)…

A: Given, 2 NH3 ---> N2 + 3 H2 Kc = 2.25

Q: Write the equiliprium constant expression in terms of K, for the reaction: CS, (g) + 4 H, (g) = CH,…

A: There is a reversible reaction given in the question. We are asked to write the equilibrium constant…

Q: In the gaseous system, N2 + 3H2 → 2NH3 , if 0.20 atm of N2, 0.30 atm of H and 0.40 atm of NH; are at…

A: Equilibrium constant (Kp) – Equilibrium constant (Kp) equals to ratio of pressures of products and…

Q: At a certain temperature, N₂(g) + O₂(g) Use this information to complete the following table. the…

A: given K =1.2 v=50 l N2=0.24 Mol O2=0.24 Mol

Q: At a certain temperature, this reaction establishes an equilibrium with the given equilibrium…

Q: The equilibrium constant K. for the equation CS2 (9) + 4H, (9) # CH4 (9) + 2H, S(g9) at 900°C is…

Q: 1. At 100 C the equilibrium constant, K. is 4.6 x 10⁹ for the reaction, CO (g) + Cl₂ (g) = COC1₂…

Q: Suppose a 500. mL flask is filled with 1.5 mol of NO and 1.3 mol of NO,. The following reaction…

A: The number of moles of NO and NO2 added to the 500.0 mL flask is 1.5 mol and 1.3 mol, respectively.…

Q: A student ran the following reaction in the laboratory at 244 K: 2NOBr(g) =2NO(g) + Br2(g) When she…

Q: The equilibrium constant, Ke, for the following reaction is 5.10x106 at 548 K. NH,CI(s)NH3(g) +…

A: Kc is the ratio of product of concentration of products raised to their stoichiometric coefficient…

Q: Steam reforming of methane ( CH4 ) produces "synthesis gas," a mixture of carbon monoxide gas and…

Q: 4. Which of the following statements is NEVER TRUE about the concept of chemical equilibrium? I. K.…

A: Check if statement one by one who is not in the favour with chemical equilibrium.

Q: A chemist puts 0.085 mol of N and 0.038 mol of O₂ in a 1.00L container. What are the concentrations…

Q: In an experiment to study the formation of HI(g),H₂(g)+I₂(g)⇌2HI(g) H₂(g) and I₂(g) were placed in…

A: Equilibrium constant (Kc) is the ratio of equilibrium concentrations of products and reactants…

Q: Consider the equilibrium for the synthesis of Z(g) at 500 K, where K = 16.0. %3D X(g) + Y(g) 2 Z(g)…

A: The equilibrium reaction given is, => X (g) + Y (g) ------> 2 Z (g)…

Q: At a certain temperature, 0.4811 mol of N2 and 1.761 mol of H2 are placed in a 3.00 L container.…

A: The given balanced reaction as follows,

Q: Consider the reaction below at a certain temperature and pressure. The reaction begins with only…

A: Note : Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: A 1.50 L reaction vessel contains a gaseous mixture of 2.1 mol NOCl, 0.52 mol NO, and 0.21 mol Cl2.…

A: The reaction is -

Q: The equilibrium constant, K for the following reaction is 1.20×10? at 500 K. PCI(2) PCI,(2) + Clh3)…

A: Given : Kc for reaction PCl3 + Cl2 ----> PCl5 is 83.3 Moles of PCl3 = Moles of Cl2 = 0.324

Q: Phosphorous pentachloride decomposes according to the reaction…

Q: Initially 2.0 moles of N2(g) and 4.0 moles of H2(g) were added to a 1.0 L container and the…

Q: A student ran the following reaction in the laboratory at 241 K:2NOBr(g) 2NO(g) + Br2(g) When she…

A: Given: Moles of NOBr = 0.140 mol Volume of container = 1.0 L Equilibrium concentration of NOBr =…

Q: The equilibrium constant, K. for the following reaction is 83.3 at 500 K. PC13(g) + Cl,(g)=PC!5(g)…

A: Equilibrium Constant Ratio of concentration of products to the concentration of reactants where each…

Question

0.050 M of H2 and 0.050 M of Br2 are placed in an evacuated 5.0 L flask and heated to 700 K. What is the concentration of
HBr in the flask when equilibrium has been established? The equation for the reaction is as follows:
H2(g) + Br2(g) = 2HBr(g)
K = 64 @ 700K

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The equilibrium constant, Kc, for the reaction N2O4(g) 2 NO2(g) at 25 C is 5.9 103. Suppose 15.6 g of N2O4 placed in a 5.000-L flask at 25 C. Calculate the following; (a) the amount of NO2 (mol) present at equilibrium; (b) the percentage of the original N2O4 that is dissociated.
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The density of trifluoroacetic acid vapor was determined at 118.1 C and 468.5 torr, and found to be 2.784 g/L. Calculate KC for the association of the acid.
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
At 25c, K = 0.090 for the reaction H2O(g)+Cl2O(g)2HOCI(g) Calculate the concentrations of all species at equilibrium for each of the following cases. a. 1.0 g H2O and 2.0 g Cl2O are mixed in a 1.0-L flask. b. 1.0 mole of pure HOCI is placed in a 2.0-L flask.
1’he reaction in Exercise 12.33 was repeated. This time, the reaction began when only NO was injected into the reaction container. 110.200 mol L_l NO was injected, what were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L"' ofO2, what were the equilibrium concentrations of all species?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?