Answered: (1) The weakest oxidizing agent is:…

(1) The weakest oxidizing agent is: enter formula (2) The strongest reducing agent is: (3) The strongest oxidizing agent is:

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter8: Electrochemistry And Ionic Solutions

Section: Chapter Questions

Problem 8.10E: For each of the following reactions, determine the overall balanced electrochemical reaction, its...

See similar textbooks

Related questions

Q: Can one half-reaction in a redox process take place independently of the other? Explain

A: Redox reaction is defined as the reaction in which oxidation and reduction take place…

Q: he reducing agent oxidized he oxidizing agent o of these are correct he oxidation number for the…

A: As oxidation number is decreased it means loss of electrons takes place So, it get reduced. Hence it…

Q: An oxidizing agent undergoes a/an ________ in oxidation state

A: In this question, we will see that an oxidizing agent is undergoes reduction or oxidation in…

Q: Briefly explain the difference between oxidation and reduction electrochemical reaction also state…

A: Gaining electron is reduction while donating electron is reduction

Q: Copper statues, such as the Statue ofLiberty, begin to appear green after they have beenexposed to…

A: REDOX REACTION: A chemical reaction which includes both reduction and oxidation process is known as…

Q: What are the different methods of changing the electrochemical potential?

A: there is various methds of this. i can say the names,but if i try to explain each process this will…

Q: Balance the following equation in acidic solution: Identify the reducing agent: Oxidizing agent:…

A: the process which involves loss of electron is called oxidation the process which involves gain of…

Q: Balance the following equation for the reaction in an acidic and basic environment.

A: The solution is as follows:

Q: McQuarrie • Rock • Gallogly presented by Macmillan Learr The oxidizing agent undergoes reduction,…

A: Given: The compound is H2O2 which can act as both oxidizing and reducing agents.

Q: In the Iodide Clock reaction is the oxidizing agent and is the reducing agent.

A: oxidation is the loss of electrons or increase in the oxidation number. reduction is the gain of…

Q: What type of cell is this/ what is the name of this cell? What reaction, oxidation or reduction,…

A: The process of applying a metal coating to another metal object via an electro-deposition method is…

Q: Predict whether, to any significant extent, (b) O2 (g) will oxidize Cl- (aq) to Cl2 (g) in acidic…

Q: Magnesium, the element, is produced commercially byelectrolysis from a molten salt (the…

A: Magnesium is a metal which is present in the second group and third period of the periodic table.…

Q: ‘ Corrosion is an electrochemical phenomenan’, explain.

A: Corrosion is the phenomenon of substance degradation by chemical processes. Electrochemical…

Q: Magnesium, the element, is produced commercially by electrolysis from a molten salt (the…

A: It is given that the Chlorine gas is evolved as voltage is applied this means that the electrolyte…

Q: Balance the following redox equations by the ionelectron method:

A: Ion electron method include: (a) Balance the atoms other than H and O for each half reaction using…

Q: Balance in the following redox reaction.

Q: With the data given how do you calculate the Faradays passed?

A: In electrolysis, one Faraday is defined as the charge of 1 mole of electrons passed during…

Q: Use the rules (in order) to assign oxidation numbers to each of the elements in the compounds below.…

A: Oxidation number is the charge on a single atom which represents the number of electron that an atom…

Q: Select the FALSE proposition: (a) An electrode is any piece of a metallic chemical element that is…

A: We can convert electrical energy to chemical energy and chemical energy to electrical energy with…

Q: Complete and balance the following redox reaction in basic solution.

Q: Complete and balance the following half-reaction in basic solutions:

A: The balance half reaction are given in following steps

Q: 4 Write down half-equations for the processes occurring during electrolysis at: a the anode: b the…

A: Extraction of aluminum carried out from alumina or aluminum oxide, by charcoal or Carbon. In this…

Q: Balance the following redox reaction under acidic conditions.

A: H2S+NO3−⟶NO2+S8(acidic) Balance all atoms other than H and O. 8H2S+NO3−⟶NO2+S8(acidic) The…

Q: Balance

A: Balance chemical equation is defined as which has equal number of atoms or ions in both sides…

Q: an automobile battery the O Oxidized Reduced Both oxidized and reduced Chemically inert Converted…

A: In lead storage battery which is used in automobile is secondary battery. Which can be recharge…

Q: Oxidizing agent:

Q: what is the oxidizing agent and reducing agent in here

A: Oxidation is a process which involves loss of electrons and reduction is a process which involves…

Q: Some years ago a unique proposal was made to raise theTitanic. The plan involved placing pontoons…

A: Since 1 mole electrons = 96500 C The coulombs of electrical charge would be calculated as:

Q: Use the References to access important values if needed for this question. Enter electrons as e".…

Q: Write a balanced half-reaction for the reduction of iodate ion (Io, to solid iodine dioxide (IO,) in…

A: Given: Reduction of iodate i.e. IO3- ion to solid iodine dioxide i.e. IO2 in an acidic medium.

Q: Write a balanced half-reaction for the oxidation of gaseous nitrogen dioxide (NO,) to nitrate ion…

Q: Represent the reaction of chlorine gas with aqueous sodium bromide to produce liquidbromine and…

A: Half cell equations are xidation reaction and reduction reaction. In the oxidation reaction, lose of…

Q: omplete the half-reactions for the cell shown, and show the shorthand notation for the cell. The…

Q: -g is a stronger reducing agent (easily oxic

A: We have to write given statement is right or wrong

Q: Which of the following is the weakest oxidizing agent?

A: Oxidizing agent are those species which gains electrons from other species and oxidize them. Weakest…

Q: Explain in detail at least TWO (2) methods of corrosion prevention using equations in your answer.

A: Metals are shiny in nature. But, due to their high reactivity nature they interacts with…

Q: Can one half-reaction in a redox process take place indepen-dently of the other? Explain.

A: A redox reaction is an oxidation-reduction chemical reactions which involves the displacement of…

Q: During operation oCcurs at the cathode and occurs at the anode. oxidation reduction

A: Oxidation is known as the loss of electrons and reduction is known as the gain of electrons during a…

Q: Determine the half-reaction at the cathode.

Q: Clorox is a laundry bleaching agent used to remove stains from white clothes. Suggest why the name…

A: The active ingredient in Clorox bleach is sodium hypochlorite , which performs the bleaching, stain…

Q: (Give clear handwritten detailed solution) Find out oxidising agent from the mentioned reaction.

Q: Diagram, in general terms, the standard reduction potentials of electron donors as compared to…

Q: Using data from table, place the following in order of increasing strength as reducing agents (all…

A: Reducing agents- Species which itself undergo oxidation are called as reducing agents. Reducing…

Q: Ammonia is oxidising agent or reducing agent?

A: A reducing agent has tendency to donate electrons to an electron seeking element and thereby reduced…

Q: The electromotive force (emf) of the Li and Al voltaic cell is ___and is considered

A: Standard reduction potential of Al and Li are -1.66 & -3.04 respectively. E°cell = E°c - E°a =…

Q: Identify the reducing and oxidizing agent. Give detailed solution 4Fe + 3O2 = 2Fe2O3

A: The oxidizing agent is a species that gains electrons that is, its oxidation state decreases in a…

Question

Consider the following half-reactions:
Half-reaction
E° (V)
Ag*(aq) + e- Ag(s)
0.799V
Sn2*(aq) + 2e Sn(s)
-0.140V
Mn2+(aq) + 2e →
Mn(s) -1.180V
(1) The weakest oxidizing agent is:
enter formula
(2) The strongest reducing agent is:
(3) The strongest oxidizing agent is:
(4) The weakest reducing agent is:
(5) Will Ag(s) reduce Mn2*(aq) to Mn(s)? |
(6) Which species can be oxidized by Sn2*(aq)?
If none, leave box blank.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
Use the following half-equations to write three spontaneous reactions. Justify your answers by calculating E° for the cells. 1. MnO4(aq)+8H+(aq)+5eMn2+(aq)+4H2OE=+1.512V 2. O2(g)+4H+(aq)+4e2H2OE=+1.229V 3. Co2+(aq)+2eCo(s)E=0.282V
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a voltaic cell in which the following reaction takes place in basic medium at 25°C. 2NO3-(aq)+3S2(aq)+4H2O3S(s)+2NO(g)+8OH(aq) (a) Calculate E°. (b) Write the Nernst equation for the cell E. (c) Calculate E under the following conditions: PNO=0.994atm,ph=13.7,[S2]=0.154M,[NO3-]=0.472M, .
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)