1. Aluminum metal reacts with aqueous sulfuric acid to produce aqueous aluminum sulfate and hydrogen gas. If 11.3 g of aluminum reacts with 50.5 g of sulfuric acid, what is the maximum amount of aluminum sulfate that can be produced?

1. Aluminum metal reacts with aqueous sulfuric acid to produce aqueous aluminum sulfate and hydrogen gas. If 11.3 g of aluminum reacts with 50.5 g of sulfuric acid, what is the maximum amount of aluminum sulfate that can be produced?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Related questions

Q: One way to collect zinc is to react solid zinc (II) oxide with carbon, which produces solid zinc and…

A: The number of moles of any substance can be calculated by dividing its mass and molar mass, the…

Q: For the following reaction, 29.9 grams of carbon disulfide are allowed to react with 96.7 grams of…

Q: Consider the following UNBALANCED chemical equation FeS (s) + HCl(aq) → FeCl2(aq) + H2S(g) If 60.6 g…

A: Given, the unbalanced equation: FeS(s) + HCl(aq) → FeCl2(aq) + H2S(g) We have to find the mass of…

Q: Copper(I) oxide decomposes to yield oxygen gas and elemental copper metal. Calculate the mass of…

Q: For the following reaction, 126 grams of silver nitrate are allowed to react with 27.9 grams of…

Q: For the following reaction, 4.00 grams of carbon (graphite) are allowed to react with 14.9 grams of…

Q: Mining companies use this reaction to obtain iron from iron ore: Fe2O3(s)+3CO(g) → 2Fe(s)+3CO2(g)…

A: The balanced reaction is given as - Fe2O3(s)+3CO(g) → 2Fe(s)+3CO2(g) The above balanced reaction…

Q: Under certain conditions, the substances nitrogen and hydrogen combine to form ammonia. If 26.0…

Q: Nitrogen (N2) can be reacted with hydrogen (H2) to form ammonia (NH3). Given the following…

A: In a given chemical reaction, the estimation of quantitative or measurable relationships of the…

Q: Consider the reaction between sodium metal and chlorine gas to form sodium chloride (table…

A: Question is to be solved on stoichiometry of equation. given gram atomic mass of Na =23 g Gram…

Q: For the following reaction, 25.7 grams of carbon disulfide are allowed to react with 99.5 grams of…

A: Given, mass of carbon disulfide (CS2) = 25.7 g mass of chlorine gas (Cl2) = 99.5 g Maximum amount of…

Q: In the lab, a student generates 0.450 g of a product in an experiment. The student then calculates…

A: Given :- product obtained from an experiment = 0.450 g Theoretical yield of product = 0.398 g To…

Q: 100.0 g lead(II) nitrate is reacted with 50.00 g potassium iodide (in plenty of water). How many…

A: The chemical equation for the reaction between lead(II) nitrate and potassium iodide is given as -…

Q: A 5.185-g sample of calcium is burned in air to produce a mixture of two ionic compounds, calcium…

A: Given: Mass of calcium burned = 5.185 g. Mass of calcium hydroxide formed = 4.601 g.

Q: For the following reaction, 15.2 grams of nitrogen monoxide are allowed to react with 5.95 grams of…

A: This problem is based on stoichiometry. We have to first determine the limiting reagent and then…

Q: Methanol has tremendous potential to be used as an alternate fuel. Carbon monoxide gas reacted with…

Q: AlI3(s)+3K(s)->3KI(s)+Al(s) Consider the reaction of solid aluminum iodide and potassium metal to…

A: Given :- AlI3(s)+3K(s)->3KI(s)+Al(s) amount of Al produced = 131.75 g To calculate :- Amount…

Q: The patient consumed 1.25 g of calcium iodide and 2.93 g of sodium oxalate in the past 3 days.…

A: The reaction in which the reactant is totally consumed when the reaction is completed is known as…

Q: For the following reaction, 0.173 moles of nitrogen gas are mixed with 0.453 moles of hydrogen gas.…

A: Given,

Q: For the following reaction, 9.62 grams of nitrogen gas are allowed to react with 5.81 grams of…

A: Given reaction , N2(g)+O2(g)→2NO(g)

Q: A balanced reaction of the combustion of octane created 27 moles of water. How many molecules of…

Q: In the preparation of brass, which is a copper-zinc alloy, 33.0 g copper is added to enough zinc to…

Q: A major component of gasoline is octane. When octane is burned in air, it chemically reacts with…

A: The combustion reaction of octane i.e C8H18 can be written as, => C8H18 + O2 --------> CO2 +…

Q: A 4.90g sample of barium bromide is reacted with 11.7g of silver (i) nitrate to form silver (i)…

A: The balanced chemical equation for the given reaction is shown below.

Q: Predict In a reaction, there must be the same number of atoms of each element in the reactants as in…

Q: For the following reaction,23.1 grams of carbon disulfide are allowed to react with 89.2 grams…

Q: Aqueous hydrobromic acid HBr will react with solid sodium hydroxide NaOH to produce aqueous…

A: Given information, 0.809 g of hydrobromic acid is mixed with 0.55 g of sodium hydroxide

Q: e. The patient consumed 1.25 g of calcium iodide and 2.93 g of sodium oxalate in the past 3 days.…

A: Given, Mass of calcium iodide = 1.25g. Mass of sodium oxalate = 2.93g. Moles of calcium iodide and…

Q: When octane (C,H,5) is burned, the yield of products (carbon dioxide and water) is 93%. What mass of…

A: Calculate the moles of octane, Moles of octane = Calculate the moles of oxygen, Moles of oxygen gas…

Q: If iron (III) oxide and carbon graphite C(s) are reacted at high temperatures, liquid iron and…

A: Oxidation: It is the process of addition of Oxygens or removal of Hydrogens or loss of…

Q: Iron metal reacts with chlorine gas according to the following equation: 2Fe(s) + 3Cl2 (g) ĺ 2FeCl3…

Q: For the following reaction, 68.5 grams of barium hydroxide are allowed to react with 37.5 grams of…

A: Answer: Given reaction is: Ba(OH)2(aq)+H2SO4(aq)→BaSO4(s)+2H2O(l) To find out the limiting reagent,…

Q: A 4.0 g sample of bromine is reacted with 0.50 grams of hydrogen to form hydrogen bromide. How many…

Q: Under certain conditions, the substance hydrobromic acid can be broken down to form hydrogen and…

A: According to law of conservation of mass The total mass of reactants is equal to total mass of…

Q: 58.1 g of solid calcium carbonate is mixed with 51.6 g hydrochloric acid. How many grams of carbon…

A: The mass of calcium carbonate is 58.1 g. The mass of hydrochloric acid is 51.6 g.

Q: Solid lithium hydroxide reacts with carbon dioxide gas to produce solid lithium carbonate and water.…

A: The amount of lithium hydroxide made to react with 11 g of carbon dioxide is 89.6 g.

Q: 0.0123 mol of solid magnesium metal. The student proceeds to burn the magnesium metal in a Bunsen…

Q: Sucrose, C12H22O11, is the common table sugar. If 1.054 g of sucrose are added to a cup of tea how…

A: Mass of Sucrose (m) = 1.054 g Number of molecules (N) = ? Molar Mass of Sucrose (C12H22O11) = (12…

Q: For the following reaction, 6.37 grams of phosphoric acid are mixed with excess potassium hydroxide.…

A: Given :- potassium hydroxide + phosphoric acid → potassium phosphate + water mass of phosphoric…

Q: Use the law of conservation of mass to answer the questions. Consider a hypothetical reaction in…

A: 1. Given that : The mass of A used = 23 g The mass of B used = 22 g The mass of C formed = 19 g We…

Q: The Haber process is a common way of producing ammonia industrially: N2 + H2(g) → NH3(g) (equation…

A: Given mass of N2 = 86.4 g mass of H2 = 10.9 g moles of N2 = given massmolar mass = 86.428 =…

Q: The reaction between aluminum and iron(III) oxide (known as the thermite reaction) can generate…

A: From a balanced reaction we can calculate the mass of product formed in the reaction .

Q: The thermite reaction has been used for welding railroad rails, in incendiary bombs, and to ignite…

Q: For the following reaction, 3.56 grams of nitrogen gas are mixed with excess hydrogen gas. The…

Q: Magnesium metal reacts with hydrochloric acid to for magnesium chloride and hydrogen gas according…

A: Given data,Mass of Mg=0.5003gGiven reaction,Mg+2HCl→MgCl2+H2

Q: 100g of Carbon monoxide reacts with 150 G of iron(III) oxide to produce iron and carbon dioxide. how…

A: The given data: The mass of carbon monoxide = 100 g The mass of iron (III) oxide = 150 g To…

Q: One technique used in industry to extract gold from gold sulfide is reacting it with hydrogen gas.…

A: Given : mass of gold(III) sulfide = 337.75 g To calculate :- mass of gold (in grams)

Q: Aluminum oxide reacts with carbon to form aluminum metal and carbon dioxide. If a reaction uses 21.8…

A: Given, mass of aluminum oxide = 21.8 g Now, the moles of aluminum oxide can be calculated as,…

Q: A student calculated that a reaction should produce 46.2 grams of carbon. The student collected…

A: Percent yield is calculated with help of Theoritical and experimental yield.

Q: For the following reaction, 5.88 grams of barium hydroxide are mixed with excess sulfuric acid. The…

A: The reaction taking place is given as, => Barium hydroxide (aq) + sulfuric acid (aq) → Barium…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

1. Aluminum metal reacts with aqueous sulfuric acid to produce aqueous aluminum sulfate
and hydrogen gas. If 11.3 g of aluminum reacts with 50.5 g of sulfuric acid, what is the
maximum amount of aluminum sulfate that can be produced?

2. How many mL of a 0.1213 M solution of sodium hydroxide are required to react completely
with 6.91 mL of a 0.1289 M solution of sulfuric acid?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Trending now

This is a popular solution!

Step by step

Solved in 5 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A 5.025-g sample of calcium is burned in air to produce a mixture of two ionic compounds, calcium oxide and calcium nitride. Water is added to this mixture. It reacts with calcium oxide to form 4.832 g of calcium hydroxide. How many grams of calcium oxide are formed? How many grams of calcium nitride?
The element magnesium reacts with the element oxygen to form a white solid compound, magnesium oxide. When a sample of magnesium that weighs 24.30 g reacts with oxygen, it is found that the magnesium oxide produced weighs exactly 40.30 g. (a) Calculate the mass of oxygen in the magnesium oxide. (b) Calculate the mass of magnesium oxide that could be produced from 40.0 g magnesium.
When corn is allowed to ferment, the fructose in the corn is converted to ethyl alcohol according to the following reaction C6H12O6(aq)2C2H5OH(l)+2CO2(g)(a) What volume of ethyl alcohol (d=0.789g/mL) is produced from one pound of fructose? (b) Gasohol can be a mixture of 10 mL ethyl alcohol and 90 mL of gasoline. How many grams of fructose are required to produce the ethyl alcohol in one gallon of gasohol?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Over the years, the thermite reaction has been used for welding railroad rails, in incendiary bombs, and to ignite solid fuel rocket motors. The reaction is :math>Fe2O3(s)+2Al(s)2Fe(l)+Al2O3(s) l type='a'> What mass of iron(III) oxide must be used to produce 25.69 g of iron? What mass of aluminum must be used to produce 25.69 g of iron? What is the maximum mass of aluminum oxide that could be produced along with 25.69 g of iron?
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
When copper(ll) oxide is heated in the presence Of hydrogen gas, elemental copper and water are produced. What mass of copper can be obtained if 32.0 g of copper(ll) oxide is used?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?