Answer 1-5 1. Which of the following statements is NOT TRUE?a. In redox reactions, electrons are transferred from one substance toanother.b. Oxidation can occur without reduction occurring at the same time.c. Reducing agent donates electrons.d. Oxidizing agent accepts electrons.2. Which of the following terms signifies the number of charges the atomwould have in a molecule (or an ionic compound) if electrons were transferredcompletely?a. Redox reactions.b. Half reactionsc. Oxidation numberd. Oxidizing and reducing agentsFor numbers 3-6, consider the equation below.Fe(s) + 2H+(aq)Fe2+ (aq) + H₂(g)3. Which of the following is the oxidation reaction?a. Fe(s)Fe2+ (aq) + 2e-b. 2H+(aq)+ 2eFe²+ (aq)c. Fe(s)H₂(g)d. 2H+ (aq) + 2eH₂(g)4. Which of the following is the reduction reaction?a. Fe(s)Fe²+ (aq)2e-b. 2H+ (aq)+ 2eFe²+ (aq)c. Fe(s)H₂(g)d. 2H+ (aq) + 2e- → H₂(g)5. Which of thefollowing is the reducing agent?a. Hydrogenb. Ironc. Both of themd. None of them6. Which of the following elements is the oxidizing agent?a. Hydrogenb. Ironc. Both of them d. None of them7. What is the oxidation number of phosphorus in HPO3?a. +3b. -5c. +1d. +58. What is the oxidation number of phosphorus in H3PO₂?a. +3b. -5c. +1d. +59. What is the oxidation number of the underlined atom in C₂04²-?a. -3b. -510. What is the oxidationc. +3d. -1/2number of the underlined atom in NaBH4?c. +3d. -1/2a. -3b. -5

(1) A redox reaction is the process in which one Substance get electrons from another Substance.…

1. Which of the following statements is NOT TRUE? a. In redox reactions, electrons are transferred from one substance to another. b. Oxidation can occur without reduction occurring at the same time. c. Reducing agent donates electrons. d. Oxidizing agent accepts electrons. 2. Which of the following terms signifies the number of charges the atom would have in a molecule (or an ionic compound) if electrons were transferred completely? a. Redox reactions b. Half reactions c. Oxidation number d. Oxidizing and reducing agents For numbers 3-6, consider the equation below. Fe(s) + 2H+ (aq) Fe²+ (aq) + H₂(g) 3. Which of the following is the oxidation reaction? a. Fe(s) Fe²+ (aq) + 2e- b. 2H+ (aq) + 2e- Fe²+ (aq) c. Fe(s) H₂(g) d. 2H*(aq) + 2e- H₂(g) 4. Which of the following is the reduction reaction? a. Fe(s) Fe²+ (aq) + 2e- b. 2H*(aq) + 2e Fe²+ (aq) c. Fe(s) H₂(g) d. 2H+(aq) + 2e- H₂(g) 5. Which of the following is the reducing agent? a. Hydrogen b. Iron c. Both of them d. None of them 6. Which of the following elements is the oxidizing agent? a. Hydrogen b. Iron c. Both of them d. None of them 7. What is the oxidation number of phosphorus in HPO₂?

1. Which of the following statements is NOT TRUE? a. In redox reactions, electrons are transferred from one substance to another. b. Oxidation can occur without reduction occurring at the same time. c. Reducing agent donates electrons. d. Oxidizing agent accepts electrons. 2. Which of the following terms signifies the number of charges the atom would have in a molecule (or an ionic compound) if electrons were transferred completely? a. Redox reactions b. Half reactions c. Oxidation number d. Oxidizing and reducing agents For numbers 3-6, consider the equation below. Fe(s) + 2H+ (aq) Fe²+ (aq) + H₂(g) 3. Which of the following is the oxidation reaction? a. Fe(s) Fe²+ (aq) + 2e- b. 2H+ (aq) + 2e- Fe²+ (aq) c. Fe(s) H₂(g) d. 2H(aq) + 2e- H₂(g) 4. Which of the following is the reduction reaction? a. Fe(s) Fe²+ (aq) + 2e- b. 2H(aq) + 2e Fe²+ (aq) c. Fe(s) H₂(g) d. 2H+(aq) + 2e- H₂(g) 5. Which of the following is the reducing agent? a. Hydrogen b. Iron c. Both of them d. None of them 6. Which of the following elements is the oxidizing agent? a. Hydrogen b. Iron c. Both of them d. None of them 7. What is the oxidation number of phosphorus in HPO₂?

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.96E

See similar textbooks

Similar questions

Complete and balance the equations for the following acid-base neutralization reactions. If water is used as a solvent, write the reactants and products as aqueous ions. In some cases, there may be more than one correct answer, depending on the amounts of reactants used. (a) Mg(OH)2(s)+HCl4(aq) (b) SO3(g)+H2O(l) (assume an excess of water and that the product dissolves) (c) SrO(s)+H2SO4(l)
In an ordinary flashlight battery, an oxidation reaction and a reduction reaction rake place at different locations to produce an electric current that consists of electrons. In one of the reactions, the zinc container of the battery slowly dissolves as it is converted into zinc ions. Is this the oxidation or the reduction reaction? Is this reaction the source of electrons, or are electrons used to carry out the reaction? Explain your answers with a reaction equation.
Why is it that when something gains electrons, it is said to be reduced? What is being reduced?
hat is a “driving force”? What are some of the driving forces discussed in this section that tend to make reactions likely to occur? Can you think of any other possible driving forces?
Classify the reactions represented by the following unbalanced equations by as many methods as possible. Balance the equations. msp;I4O9(s)I2O6(s)+I2(s)+O2(g) msp;Mg(s)+AgNO3(aq)Mg(NO3)2(aq)+Ag(s) msp;SiCl4(l)+Mg(s)MgCl2(s)+Si(s) msp;CuCl2(aq)+AgNO3(aq)Cu(NO3)2(aq)+AgCl(s) msp;Al(s)+Br2(l)AlBr3(s)
4.112 A metallurgical firm wishes to dispose of 1300 gallons of waste sulfuric acid whose molarity is 1.37 M. Before disposal, it will be reacted with calcium hydroxide (slaked lime), which costs $0.23 per pound. (a) Write the balanced chemical equation for this process. (b) Determine the cost that the firm will incur from this use of slaked lime.
Complete and balance the following acid-base equations: (a) HCl gas reacts with solid Ca(OH)2(s). (b) A solution of Sr(OH)2 is added to a solution of HNO3.