16. For the following half-reactions, answer the questions below. Co+(aq) + e- → Co²+(aq) E° = +1.953 V Fe+(aq) + e-→ Fe2+(aq) E° = +0.769 V %3D I,(aq) + 2e--→ 21-(aq) E° = +0.534 V Pb2+(aq) + 2e¯ → Pb(s) E° = -0.127 V Cd²+(aq) + 2e- →Cd(s) E° = -0.402 V Mn2+(aq) + 2e- → Mn(s) E = -1.182 V (a) Which is the weakest reducing agent? (b) Which is the strongest reducing agent? (c) Which is the strongest oxidizing agent? (d) Which is the weakest oxidizing agent? (e) Will Pb(s) reduce Fe3+(aq) to Fe2+(aq)? (f) Will I-(aq) reduce Pb2+(aq) to Pb(s)? (g) Which ion(s) can be reduced by Pb(s)? (h) Which if any metal(s) can be oxidized by Fe3+(aq)?

16. For the following half-reactions, answer the questions below. Co+(aq) + e- → Co²+(aq) E° = +1.953 V Fe+(aq) + e-→ Fe2+(aq) E° = +0.769 V %3D I,(aq) + 2e--→ 21-(aq) E° = +0.534 V Pb2+(aq) + 2e¯ → Pb(s) E° = -0.127 V Cd²+(aq) + 2e- →Cd(s) E° = -0.402 V Mn2+(aq) + 2e- → Mn(s) E = -1.182 V (a) Which is the weakest reducing agent? (b) Which is the strongest reducing agent? (c) Which is the strongest oxidizing agent? (d) Which is the weakest oxidizing agent? (e) Will Pb(s) reduce Fe3+(aq) to Fe2+(aq)? (f) Will I-(aq) reduce Pb2+(aq) to Pb(s)? (g) Which ion(s) can be reduced by Pb(s)? (h) Which if any metal(s) can be oxidized by Fe3+(aq)?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 26QAP: For the following half-reactions, answer the questions below....

See similar textbooks

Similar questions

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
The following oxidationreduction reactions are used in electrochemical cells. Write them using cell notation. (a) 2Ag+(aq)(0.50M)+Ni(s)2Ag(s)+Ni2+(aq)(0.20M) (b) Cu(s)+PtCl62-(aq)(0.10M)Cu2+(aq)(0.20M)+PtCl42-(aq)(0.10M)+2Cl(aq)(0.40M) (c) Pb(s)+SO42-(aq)(0.30M)+2AgCl(s)PbSO4(s)+2Ag(s)+2Cl(aq)(0.20M) (d) In a galvanic cell, one half-cell contains 0.010 M HCI and a platinum electrode, over which H2 is bubbled at a pressure of 1.0 atm. The other half-cell is composed of a zinc electrode in a 0.125 M solution of Zn(NO3)2.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For the following half-reactions, answer the questions below. Co3+(aq)+eCo2+(aq)E=+1.953VFe3+(aq)+eFe2+(aq)E=+0.769VI2(aq)+2e2I(aq)E=+0.534VPb2+(aq)+2ePb(s)E=0.127VCd2+(aq)+2eCd(s)E=0.402VMn2+(aq)+2eMn(s)E=1.182V (a) Which is the weakest reducing agent? (b) Which is the strongest reducing agent? (c) Which is the strongest oxidizing agent? (d) Which is the weakest oxidizing agent? (e) Will Pb(s) reduce Fe3+(aq) to Fe2+(aq)? (f) Will I-(aq) reduce Pb2+(aq) to Pb(s)? (g) Which ion(s) can be reduced by Pb(s)? (h) Which if any metal(s) can be oxidized by Fe3+(aq)?
Use Table 17.1 to answer the following questions. Use LT (for is less than), GT (for is greater than), EQ (for is equal to), or MI (for more information required). (a) For the half reaction 12Br2(l)+eBr(aq)Ered1.077 v. (b) For the reaction 2Br(aq)+Co2+(aq)Br2(l)+Co(s)E0. (c) If the half reaction Co2+(aq)+2eCo(s) is designated as the new standard where Ered is 0.00, then Ered for 2H+(aq)+2eH2(g) is 0. (d) For the reaction 2Cr3+(aq)+3Co(s)2Cr(s)+3Co2+(aq) the number of electrons exchanged is6. (e) For the reaction described in (d), the number of coulombs that passes through the cell is9.648104 .
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
Why is it not possible for hydroxide ion (OH-) to appear in either of the half-reactions or the overall equation when balancing oxidation—reduction reactions in acidic solution?
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?