A1 Magnesium and lead have similar first and second ionization energies, yet theirreactivity with acid:M (s) + 2H* (aq) → M²* (aq) + Hz2 (g)AHrxn(where M = Mg or Pb)is very different. (a) Split the chemical equation into oxidative and reductive half-reactions.(b) Sketch a suitable thermodynamic cycle (similar to the Born-Haber cycle) that will allow youto calculate AHrxn for M = Mg or Pb, based on the data available in your text book's tables(suggestion: keep the oxidative and reductive parts of the cycle separate). (c) Calculate AHrxn forM = Mg and Pb using your thermodynamic cycle and appropriate data from the text book'stables. (d) What thermodynamic parameter appears to cause the difference in AHrxn for the twometals? (e) What physical difference between Pb and Mg would cause the difference in thethermodynamic parameter of part (d)?

Only part (a) is mentioned to be solve. For the other parts to be solved available data is not…

2 Magnesium and lead have similar first and second ionization energies, yet their reactivity with acid: M (s) + 2H* (aq) → M²* (aq) + H2 (g) AHrxn (where M = Mg or Pb) is very different. (a) Split the chemical equation into oxidative and reductive half-reactions.

2 Magnesium and lead have similar first and second ionization energies, yet their reactivity with acid: M (s) + 2H* (aq) → M²* (aq) + H2 (g) AHrxn (where M = Mg or Pb) is very different. (a) Split the chemical equation into oxidative and reductive half-reactions.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 83QRT

See similar textbooks

Related questions

Q: An electrochemical cell constructed from the following half cells, linked by a NaNO3 salt bridge. -…

A: Correct answer is : (2) The silver electrode gains mass and the silver electrode is the cathode.

Q: A galvanic cell consists of a cathode with a cadmium electrode in a 0.252 M solution of Cd(NO3)2 and…

A: The concentration of cadmium ions at anode is equal to the concentration of cadmium nitrate solution…

Q: For the cell reaction, Zn(s) | Zn2+(aq, 1 M) || Cu2+(aq, 1 M) | Cu(s), the electrode potential of…

A: In the given question we have to calculate the cell potential. cell Reaction, Zn(s) + Cu2+(aq)…

Q: 1. What mass of the following substances can be produced in 1.0 h with a current of 15 A? a. Co from…

Q: In the standard electrochemical cell, Pt(s)|H2SO3laq), H*(aq), SO4 (aq)||Ag*(aq)|Ag(s), v¥hat can be…

A: In a electrochemical cell representation RHS is cathode s reduction all happen over there, LHS in…

Q: (a) In the electrolysis of aqueous NaCl, how many liters of Cl2(g) (at STP) are generated by a…

A: i = 81.2 A t = 59.2 min

Q: Given a redox reaction: 3S(k) + 2KClO3 (k) 3SO2 (g) + 2KCl (k) a) Identify and underline the element…

A: # In oxidation, oxidation number of element increases. # In reduction, oxidation number of…

Q: Write the half - reaction of each redox reaction and determine the oxidizing and reducing agent. 4.…

Q: Substances A, B, and C can all act as oxidizing agents. In solution, A is green, B is yellow, and C…

Q: Enter your answer in the provided box. A constant current is passed through an electrolytic cell…

Q: Manganese dioxide (MnO2) for use in dry cell batteries is made by electrolyzing solutions of Mn2*…

Q: 5. Consider the following reactions: 3 Ni 2"taq) + 2Cr(OH)3 (s) + 10 OH ¯ (aq) → 3 Ni (s) + 2 CrO4…

Q: Predict the products and balance the following eqn. and identify the type of reaction FeCl 3(aq) +…

Q: Consider the following redox reaction with nitrogen (N): NO3 + H* + 8e +→ _NH4* a. Balance this…

Q: If a salt bridge contains KNO3 as its electrolyte, which ions diffuse into solution in the anode…

A: A galvanic cell is an electrochemical cell that is used to supply electric current through the redox…

Q: A voltaic cell is constructed in which the cathode is a standard hydrogen electrode and the anode is…

A: Given Ecell = 0.233V Ecell = - RTnFln [H+]0.233= - 8.314 x2981 x 96500ln [H+]- 9.075 = ln [H+] [H+]…

Q: Which of the following factors does not affect the electrode potential of an electrode? Size of the…

A: Temperature ,metal and molarity of solution affect the electrode potential .

Q: Can chlorine gas oxidize water to oxygen gas under standard conditions in basic solution?

A: Chlorine gas will oxidize water to oxygen gas under standard conditions, because the standard…

Q: A digital watch battery draws 0.35 milliamperes of current, which is provided by a mercury battery…

A: Moles of HgO and Zn is calculated as shown,

Q: The amount of lactic acid, HC3H;O3, produced in a sample of muscle tissue was analyzed by its…

Q: A fuel cell is constructed in which both electrodes make use of the oxidation of methane. The…

A: (a)

Q: Electrolysis of an aqueous solution of sodium chloride produces chlorine, Cl2 (9). The reaction that…

Q: 1. What is a cell potential? 2. In what way does a galvanic cell becomes an electrolytic cell?

A: Galvanic cell is the spoteneous redox reaction where chemical energy transferred to electrical…

Q: A digital watch battery draws 0.20 milliamperes of current, which is provided by a mercury battery…

A: Number of moles = given mass / molar mass

Q: 2- You have a voltaic cell and when calculating the cell potential, found to be non-spontaneous…

A: As the given cell potential is negative, that is the reaction is non spontaneous reaction.

Q: A digital watch battery draws 0.10 milliamperes of current, which is provided by a mercury battery…

A: When a current gets passed in any electrolytic solution, it causes the deposition of chemical at the…

Q: Redox reaction of Hydrogen Peroxide 2H202—->2H2O+O2 • Describe the reaction. •Write the…

A: The process of losing electrons is called oxidation and the process of losing electrons is called…

Q: calculate the value of the electrode potential of hydrogen: a) in the 0.05 M solution of sulfuric…

A: a) Given : Concentration of sulfuric acid i.e H2SO4 = 0.05 M Since H2SO4 is a strong acid which will…

Q: 4. In a process called flash electroplating, a current of 2.5 x 10'A passes through an electrolytic…

Q: (27) What is the value of the equilibrium constant (Kea) when the following redox reaction takes…

Q: In the redox reaction 6 Fe2* + Cr,0,² + 14 H* → 2 Cr** + 6 Fe³+ + 7 H,0, what is the reducing agent?

A: Oxidation : The process of addition of oxygen or removal of hydrogen or increase in oxidation…

Q: What mass of each of the following substances can be produced in 1.4 h with a current of 10. A? (a)…

Q: If the standard voltage of the reaction of Cu(s) with Ag*(aq) is 0.46 V, what is the standard gibbs…

Q: A student measures the potential of a cell made up with 1 M CuSO4 in one solution and 1 M AgNO3 in…

Q: Can mercury produce zinc metal from aqueous zinc sulfate under standard conditions?

A: The mercury will not produce zinc metal from aqueous zinc sulfate under standard condition. Because,…

Q: Electrolysis of an aqueous solution of sodium chloride produces chlorine, . The reaction that occurs…

A: Give that: the reaction of anode is: 2Cl- (aq) →Cl2 (g) + 2e- Mass of Cl2 produced, w =182 g, time…

Q: Determine the equilibrium constant at 25 ºC for the dissolution of magnesium hydroxide in acidic…

A: From given datas

Q: What is the potential of a concentration cell at 25.0 °C if it consists of copper electrodes dipping…

A: We have to find Ecell

Q: Electrolysis of an aqueous solution of sodium chloride produces chlorine, Cl, (g). The reaction that…

Q: 5. A student performs a acid-base titration reaction and finds that it takes 16.5 ml of a 2.50M…

A: Given that - Molarity of M(OH)2 , M1 = 2.50 M Volume of M(OH)2 ,V1 = 16.5 mL Molarity of H3X , M2…

Q: 4. Write half-reactions for these changes: a) Oxidation of zinc to Zn²+ ions b) Reduction of H,O+…

A: When a Substance is oxidised then Oxidation Number increases. But on reduction Oxidation Number…

Q: Enter your answer in the provided box. A constant current is passed through an electrolytic cell…

Q: Which of the following statements associated with the pH meter is incorrect? (A) The pH meter should…

A: A question based on electrolysis that is to be accomplished.

Q: At 18°C a 0.001-M aqueous solution of potassium hydrogen carbonate, KHCO3 , conducts a current in a…

A: Potassium bicarbonate dissolve in water. It dissociate into water to produce potassium ion ( K+)…

Q: The amount of lactic acid, HCa Hg O3, produced in a sample of muscle tissue was analyzed by its…

A: Since 2 moles of electrons is required to produce 2 moles of OH- ion as per the reaction hence…

Q: A voltaic cell is constructed in which the cathode is a standard hydrogen electrode and the anode is…

A: In the given question we have to calculate the pH of unknown solution, by electrochemical method.…

Q: If the given statement is true, write T. Otherwise, write F and explain why it is false 1)An…

A: Electrolytic cell Electrolytic cell converts electrical energy into chemical energy. Equilibrium…

Q: Which of the following is not correct ? Electrode potential or cell potential is an intensive…

A: 1) Electrode potential or cell potential is independent of the amount of substance involved. It is…

Q: The process of decomposition of an electrolyte by passing electric current through its solution is…

A: 1) Electrolysis is a process by which electric current is passed through a substance to effect a…

Q: A digital watch battery draws 0.10 milliamperes of current, which is provided by a mercury battery…

A: m=Mass of Hg=1.10g Equivalent wt of Hg =200.59/2 =100.295 Current = 0.10 mA or 0.10x10-3 F=96500C…

Concept explainers

Electrolysis

Electrolysis is defined as the process of breaking down ionic compounds into their constituent elements by passing a direct electric current through the compound in a fluid state. The cathode reduces cations, while the anode oxidizes anions. An electrolyte, electrodes, and some form of external power source are the main components required for conducting electrolysis. A partition, such as an ion-exchange membrane or a salt bridge, may also be used, but this is optional. These are primarily used to prevent the products from diffusing near the opposing electrode.

Question

Magnesium and lead have similar first and second ionization energies, yet their
reactivity with acid:
M (s) + 2H* (aq) → M²* (aq) + Hz2 (g)
AHrxn
(where M = Mg or Pb)
is very different. (a) Split the chemical equation into oxidative and reductive half-reactions.
(b) Sketch a suitable thermodynamic cycle (similar to the Born-Haber cycle) that will allow you
to calculate AHrxn for M = Mg or Pb, based on the data available in your text book's tables
(suggestion: keep the oxidative and reductive parts of the cycle separate). (c) Calculate AHrxn for
M = Mg and Pb using your thermodynamic cycle and appropriate data from the text book's
tables. (d) What thermodynamic parameter appears to cause the difference in AHrxn for the two
metals? (e) What physical difference between Pb and Mg would cause the difference in the
thermodynamic parameter of part (d)?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1 Question 2(a)

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?
Actually, the carbon in CO2(g) is thermodynamically unstable with respect to the carbon in calcium carbonate(limestone). Verify this by determining the standardGibbs free energy change for the reaction of lime,CaO(s), with CO2(g) to make CaCO3(s).
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calcium metal can be obtained by the direct electrolysis of molten CaCl2, at a voltage of 3.2 V. (a) How many joules of electrical energy are required to obtain 12.0 1b of calcium? (b) What is the cost of the electrical energy obtained in (a) if electrical energy is sold at the rate of nine cents per kilowatt hour?