Which of the following factors does not affect the electrode potential of an electrode?Size of the electrode.a OTemperature of the solution.b ONature of the electrode (metal).c OMolarity of the solution.d O

Temperature ,metal and molarity of solution affect the electrode potential .

Answered: Which of the following factors does not…

Which of the following factors does not affect the electrode potential of an electrode? Size of the electrode Temperature of the solution Nature of the electrode (metal) Molarity of the solution

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 50QRT

See similar textbooks

Related questions

Q: An electrochemical cell constructed from the following half cells, linked by a NaNO3 salt bridge. -…

A: Correct answer is : (2) The silver electrode gains mass and the silver electrode is the cathode.

Q: For the cell reaction, Zn(s) | Zn2+(aq, 1 M) || Cu2+(aq, 1 M) | Cu(s), the electrode potential of…

A: In the given question we have to calculate the cell potential. cell Reaction, Zn(s) + Cu2+(aq)…

Q: Calculate the standard cell potential for the reaction below, and note whether the reaction is…

A: Given, Mg(s)+Ni2+(aq)⟶Mg2+(aq)+Ni(s) Ni2+(aq)+2e−⟶Ni(s) −0.257 Mg2+(aq)+2e−⟶Mg(s) −2.372

Q: Use the tabulated electrode potentials to calculate K for the oxidation of iron by H++ (at 25°C):…

Q: (19) Consider the following redox reaction that occurs in a voltaic cell: Cr2+ (aq) + Cu2+ (aq) →…

Q: For the reaction, 8H+ +5 Fe2+ +MnO, → Mn2+ + 5 Fe3+ + 4H2O what will have the biggest effect on the…

Q: Perchlorate is a serious problem in drinking water as it interfere with the functioning of thyroid…

A: Given information: Concentration of NaClO4 = 1.0*10-4 M Cell potential = -0.146 V After transferring…

Q: Consider the electrolysis of tin (II) sulphate during which tin is deposited at one electrode and…

A: A numerical problem based on electrolysis, which is to be accomplished.

Q: What is the calculated value of the cell potential at 2

Q: How you used the starting concentrations of electrolyte solutions to calculate the expected cell…

Q: How much charge must pass through an electrolytic cell to reduce 0.44 mol Ca2+ ion to calcium metal?

A: The "electrochemical cell" in which any reaction that is non-spontaneous redox (oxidation-reduction)…

Q: A galvanic (voltaic) cell consists of an electrode composed of magnesium in a 1.0 M magnesium ion…

Q: alculate the equilibrium constant, Keq, for the galvanic cell performing the following reaction at…

A: Given : We have to calculate the equilibrium constant.

Q: 19.69 Calculate the standard cell potential of the following cell at 25°C.…

A: In the electrochemical cell notation, chromium electrode function as anode and mercury function as…

Q: What is the cell potential of a galvanic cell that has a reduction potential at the cathode of 0.85…

A: In the galvanic Cell , At cathode : oxidation Reaction occurs & At anode : reduction Reaction…

Q: Describe the standard hydrogen electrode (SHE) and explain its use in determining standard electrode…

A: For a half-cell, we cannot measure the potential directly. We can only measure the overall potential…

Q: What is a cell diagram? Write the cell diagram for a galvanic cell consisting of an Al electrode…

A: For cell diagram representation, there is the need of cathode , anode and salt bridge.

Q: 1. What is a cell potential? 2. In what way does a galvanic cell becomes an electrolytic cell?

A: Galvanic cell is the spoteneous redox reaction where chemical energy transferred to electrical…

Q: A galvanic (voltaic) cell consists of an electrode composed of zinc in a 1.0 M1.0 M zinc ion…

A: In the given galvanic cell, we have electrodes as 1) electrode composed of zinc in a 1.0 M zinc ion…

Q: Calculate the standard cell potential for each of the following electrochemical cells. Standard…

Q: Consider the cell diagram for an electrochemical cell: Pt | Ti2+(aq), Ti3+(aq) || Br2(g), Br-(aq) |…

A: For the electrochemical cell: Pt | Ti2+(aq), Ti3+(aq) || Br2(g), Br-(aq) | Pt having E = 1.40 V , we…

Q: Calculate the standard cell potential of the following cell at 25°C:

A: From electrochemical cells standard reduction potential (SRP) values of Pd and Cu electrodes are…

Q: What is understood by a normal hydrogen electrode? Give its significance.

A: Normal hydrogen electrode is the electrode that is used as reference to determine the potential of…

Q: standard potential

Q: .What happens to the standard cell potential of a battery when temperature increases? A.The…

A: The potential of an electrode to lose or gain electrons is referred to as its electrode potential.…

Q: How does lowering the concentration of the solution in the anode affect the cell potential? How does…

A: A galvanic cell is a electrochemical cell. It supply electric through a redox reaction. It is…

Q: A current of 0.452 Amps is passed through an electrolytic cell containing molten CaCl2 for 1.50 hrs.…

Q: Suppose the current flowing from a battery is used to electroplate an object with silver. Calculate…

A: The electrochemical reaction of silver is –

Q: For the cell reaction, Zn(s) | Zn2*(aq, 1 M) || Cu2*(aq, 1 M) | Cu(s), the electrode potential of…

A: Cell Notation : Zn(s) | Zn2+(aq,1M) || cu2+(aq, 1M) | Cu(s) Electrode potential of cathode = 0.34…

Q: Use tabulated electrode potentials to calculate AG° for the reaction. 2K(s) + 2H20(1)→H2(g) +2OH…

Q: A galvanic (voltaic) cell consists of an electrode composed of iron in a 1.0 M iron(II) ion solution…

A: Answer: the standard potential for this cell at 25°C is 1.96 V.

Q: nd identify which electrode is p 4+ 2+ (aq) // Sn** (aq)/ Sn² 3+ 2+ (aq) // Cu (aq) / Cu (s) 2+ 2+…

A: In the complete cell reaction, Oxidation takes place at anode and reduction takes place at cathode.…

Q: determine the potential of the hydrogen electrode immersed in an basic solution with pH = 10.7

A: Given : pH = 10.7 And hydrogen electrode Since pH = -log[H+ ] => 10.7 = -log[H+ ] => [H+ ] =…

Q: For the ΔG° values given here, determine the standard cell potential for the cell.(a) 12 kJ/mol, n =…

A: The standard cell potential(E0cell)is the potential difference between cathode and anode measured at…

Q: standard reduction potential, standard oxidation potential, and standard cell potential. Explain…

Q: Given the following cell notation for a galvanic cell, calculate the cell potential. Mg(s) Mg²* (aq)…

Q: What do you mean by ( i) negative standard electrode potential and(ii) positive standard electrode…

A: Standard electrode potential is defined as the potential of the electrode at the standard conditions…

Q: Which of the following statements associated with the pH meter is incorrect? (A) The pH meter should…

A: A question based on electrolysis that is to be accomplished.

Q: Calculate the standard cell potential and note whether the reaction is spontaneous under standard…

A: The more positive reduction potential of reduction reactions are more spontaneous. When viewing a…

Q: Will the potential of the galvanic cell change if we add the same amount of water to the electrolyte…

A: Cell potential is given by Nernst equation , which is as: Ecell = Eocell - RTnFlnQ Cell potential…

Q: In an electroplating operation, the cell potential is sometimes 0 V. Why is zero potential possible…

A: In this question we need to illustrate the fact that cell potential for an electroplating cell can…

Q: Which of the following is not correct ? Electrode potential or cell potential is an intensive…

A: 1) Electrode potential or cell potential is independent of the amount of substance involved. It is…

Q: In what way does a galvanic cell become an electrolytic cell? What is the difference between…

A: (1) Galvanic cell work on an spontaneous electrochemical Reaction in which Chemical energy is…

Q: Use the tabulated electrode potentials to calculate K for the oxidation of iron by H++ (at 25°C):…

A: The question is based on the concept of electrochemistry. the electrode which has higher reduction…

Question

Which of the following factors does not affect the electrode potential of an electrode?
Size of the electrode
.a O
Temperature of the solution
.b O
Nature of the electrode (metal)
.c O
Molarity of the solution
.d O

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.