Answered: 2) Would there be a change in the value…

2) Would there be a change in the value of the enthalpy of combustion if the water is heated until a 30 °C change is observed, rather than 20 PC? Why or why not?

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter2: The First Law Of Thermodynamics

Section: Chapter Questions

Problem 2.79E: The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C...

See similar textbooks

Related questions

Q: Complete precipitation of group III cations is assured by keeping the solution O slightly alkaline…

A: Analytical chemistry is branch of chemistry which involves separation, identifications and…

Q: The latent heat of vaporization of water at 100 oC is 539 kcal/kg. Calculate the boiling point of…

A: The boiling point of water can be determined by the Clausius-Calyperon equation. It can be given as:…

Q: A sample of an unknown compound is vaporized at 200. degrees Celsius. The gas produced has a volume…

A: Given, Temperature, T = 200. oC =( 200. + 273)K = 473 K Volume, V = 2200. mL = 2200.1000L = 2.200 L…

Q: the product is given predict from what alkene reactant be made from, write the complete reaction on…

A: Given, the product of A. 2-methyl-2- hexanol B. 3-chloro-3-ethylpentane…

Q: alculate the pH of a solution obtained by m plumes of formic acid and sodium hy- ncentration of 0.2…

A: Ka = 2.04 ×10-4 pKa = -log(Ka) = 3.69 At same concentration of acid and base ,it forms salt.

Q: If a fertilizer bag indicated that it contained 35 percent K2O, a. What does the analysis look like…

A: The percentage composition can be determined based on the molecular formula of the compound. The…

Q: If you have mixture containing 1.20 atm of nitrogen gas and 857 torr of oxygen gas, what is The…

A: Given: Partial pressure of nitrogen gas = 1.20 atm Partial pressure of oxygen gas = 857 torr

Q: Using the Standard Reduction Potential Table, use half-reaction potentials to identify whether the…

Q: Calculate Kp for the following reaction: * PCI,(g) + Cl,(g) = PCI,(g) K. = 1.67 (at 500. K) O 3.07 x…

Q: Anant Gyan Date Page below. over comp0unds A annd Bane arawn which one has ahigher boiding point end…

Q: Write the correct chemical equation for the chlorination of nitrobenzene and give the name of the…

Q: Calculate ΔG° for the electrochemical cell Pb(s) | Pb ⁺²(aq) || Fe ⁺³(aq) | Fe ⁺²(aq) | Pt(s) A)…

Q: The Van't Hoff equation estimates the Ws of a solution. True O False

A: Applications of the an't Hoff equation

Q: (a) Magnesium (Mg) has a hexagonal close-packed (HCP) crystal structure with the lattice parameter…

A: The parameters for the HCP crystal structure are given as: a=b=0.321 nm c=0.521 nm r=0.173 nm

Q: The infrared spectrum of 75Br 19F has a strong line of 380 cm^-1 intensity. Calculate the constants…

A: We have to predict the force constant for given molecule.

Q: 5. Describe the assay for furosemide using alkalimetry method. Write the reactions, stochiometric…

A: Furosemide is a sulfamoylanthranilic acid derivative, used to treat edema and hypertension. To assay…

Q: Write an equation for the formation of the following compounds from the appropriate alcohol

A: Here we are required to find the alcohol from which the ketone can be made.

Q: f 23.1 g of NaOH (MM = 40.00 g/mol) are added to a 500.0 mL volumetric flask, and water is added to…

A: Given data mass of NaOH = 23.1 g Molar mass of NaOH = 40.00 g Volume of the solution = 500.0 mL The…

Q: IUPAC name for this?

Q: Calculate Kp for the following reaction: * PCI,(g) + Cl,(g) = PCI,(g) K. = 1.67 (at 500. K) 3.07 x…

A: The relationship between Kp and Kc is Kp = Kc*(RT)∆n ∆n = [moles of gaseous products] - [moles of…

Q: Name the following organic compounds using the IUPAC system. [K: /10] 1. CH,CH,CH, - N - CH, CH, 2.…

A: This is the question of IUPAC nomenclature.

Q: When 6.29 g of a certain nonvolatile solute is dissolved in 500 g of water, the freezing point of…

Q: Find two (2) articles within the Internet that talks about the benefits/uses of nanotechnology in…

A: Nanotechnology applications in the food industry can be utilized to detect bacteria in packaging, or…

Q: A reaction between liquid reactants takes place at 33.0 °C in a sealed, evacuated vessel with a…

Q: Keep carbonated drinks in cold places, O increases solubility of carbon dioxide gas in water O…

A: Answer: In carbonated drinks, CO2 which is a gas is being dissolved in water which is a liquid.

Q: Give a complete mechanism with step by step in details OMSO I10'c

A: In this question, we will draw the reaction mechanism step by step with details. You can see below…

Q: 1. List the reasons why pentanol has a higher boiling point when compared to its corresponding…

A: Pentanol is an alcohol which means it contains a hydroxyl group (-OH) in its structure. On the other…

Q: The following sequence of steps has been proposed for the overall reaction between H2 and Br2 to…

A: Given, The overall reaction between H2 and Br2 to form HBr: from 1) Br2(g)---------->2Br(g)…

Q: Isotonic saline solution has a mass % NaCl concentration of 0.900%. Assuming its density is 1.00…

Q: At STP how many liters is four moles sulfur dioxide gas occupy

A: Mole can be defined as the standard unit for measuring large quantities of very small entities such…

Q: Consider the following multistep reaction: CH3 O CH3 O Step 1 CH3-CH2-CH-C-C-OH CH3-CH2-CH-C-s-CoA…

A: 1) Step 1 only This is the step that requires the coenzyme ( Succcinyl coA ) 2) The reaction…

Q: Twenty grams of potassium dichromate (K2Cr207) is dissolved in 150 mL of water. The solution was…

A: Given, Mass of K2Cr2O7 = 20 g Volume of solution in mL = 150 mL Solution produces CrO after…

Q: Na DMSO cat. HCI +

A: SN2 reaction proceeds via single and concerted reaction with inversion of configuration. The rate if…

Q: Furthermore, the following reaction occurs between O (formed either from the photochemical…

A: Propagation step is that step in which a radical is consumed and a new radical is formed. While…

Q: Q7. The correct order of increasing in the first ionization energy: A.B< Be < N<O B. Be <B<N<O C.B<…

Q: 1 Consider the following reaction: 2 A (g) + B (s) ⇌ C (g) + D (g) KC = 0.288 at 25 ºC 0.200…

A: Given, The reaction: 2 A (g) + B (s) ⇌ C (g) + D (g) KC = 0.288 at 25 ºC Initial moles of C =…

Q: Table 1 Synthesis Table for synthesis of p-(acetylamino)benzoic acid Compound Mw Moles Yield Density…

A: %yield of the reaction can be calculated by the formula %yield= (actual yield of the…

Q: 12. When and electron ______ light, it gains energy. A. releases B. absorbs ____13. After a single…

A: 12) we know when an electron is irradiated it is getting excited and gains energy and move to other…

Q: 4. SO3“ (aq) + Cr,0,²- 2- 2- → SO4° (aq) + Cr3+, Caq) [acidic solution] (aq) a. Write the balanced…

A: In the given reaction, chromium goes from oxidation state of +6 to +3. So, it is being reduced.…

Q: Calculate the solubility of MgF2 (MW = 62.3 g/mol) in water at 25 °C if its Ksp is 7.4 x 10-11.? No…

A: From ICE TABLE-

Q: (Q87) If the reduction potential of the species being oxidized is less than that of the species…

A: Here we have to predict whether the following cell reaction will be spontaneous or not.

Q: Write the formula for the conjugate acid of each of the following bases: (a) HS¯, (b) HCO,, (c)…

A: Conjugate acid is the chemical species which is formed when a weak base accept a proton. For writing…

Q: Select all of the intermolecular forces that are present in dimethylamine. A.)London Dispersion…

Q: Question 26 (3 points) The number of copper atoms present in 2.35 ng of copper wire equal...…

Q: Which of the following statements is TRUE for fats and oils?* Fats need more volume of bromine to…

A: Oil composed of mostly unsaturated fatty acid so it will take more amount of bromine.

Q: Which of the following pairs of substances could function as a buffer system in an aqueous solution?…

A: Acidic buffer :- A mixture of weak acid and its salt with strong base is known as acidic buffer For…

Q: A solution contains 43 mEq/L of Cl- and 11 mEq/L of HPO42-. If the only cation in the solution is…

A: An equivalent for an ion is calculated by multiplying the number of mole of that ion by its valence.

Q: Choose the INCORRECT statement. A) The maximum work available in a cell = -zFEcell- B) AG° =…

A: A Galvanic cell is an electrochemical cell, in which the chemical energy is converted into…

Q: 2. A solution with a final volume of 500 mL was prepared by dissolving 25 mL of Methanol (CH3OH; d =…

A: Volume of solvent (chloroform) = 500 ml Density of solvent = 1.49 g/ml Volume of methanol (solute)…

Q: Q9. When the following equation is balanced in acidic solution, the coefficients for H,0, 50,' and…

Question

100%

2) Would there be a change in the value of the enthalpy of combustion if the water is heated until
a 30 °C change is observed, rather than 20 °C? Why or why not?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.
Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
Find the enthalpies of the combustion reactions for methane through n-octane. Plot them versus the number of carbon atoms in the molecule, and determine an equation that gives H for the combustion of a given hydrocarbon. Then use the equation to predict the enthalpy of combustion for n-C12H26 and compare it to experimental values.
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
The octane number of gasoline is based on a comparison of the gasolines behavior with that of 2,2,4-trimethylpentane, C8H18(), which is arbitrarily assigned an octane number of 100. The standard enthalpy of combustion of this compound is 5456.6 kJ/mol. (a) Write the thermochemical equation for the combustion of 2,2,4-trimethylpentane. (b) Use the standard enthalpies of formation in Appendix G to calculate the standard enthalpy of formation of 2,2,4-trimethylpentane.
9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?