2. What is the maximum amount of water which can be produced when 20.0 g of hydrogen is reacted with 30.0 g of oxygen? Which is the limiting reactant? Which is the excess reactant? How much of the excess reactant will be left over? H= 2*9.95%3D19.9 O= 2*.9377= 1.87 1.87*2=3.74

2. What is the maximum amount of water which can be produced when 20.0 g of hydrogen is reacted with 30.0 g of oxygen? Which is the limiting reactant? Which is the excess reactant? How much of the excess reactant will be left over? H= 29.95%3D19.9 O= 2.9377= 1.87 1.87*2=3.74

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 30A

See similar textbooks

Related questions

Q: For the following reaction, 15.9 grams of chlorine gas are allowed to react with 7.20 grams of…

A: Mass of chlorine = 15.9 g Mass of water = 7.20 g Molar mass of Chlorine = 70.90 g/mol Molar mass of…

Q: For the following reaction, 4.74 grams of butane (C,H10) are allowed to react with 20.7 grams of…

A: The limiting reagent in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: When the reaction is complete, how many molecules of NH, are produced? What is the limiting…

Q: For the following reaction, 28.9 grams of sulfur dioxide are allowed to react with 6.29 grams of…

Q: A combustion reaction wherein 15.0 g of propane (C3H3) is burned with 75.0 g of oxygen (O2). a.…

Q: For the following reaction, 335 grams of iron are allowed to react with 96.0 grams of oxygen gas.…

Q: What is the formula for the limiting reagent? What mass of the excess reagent remains after the…

A: Number of moles = mass/molar mass Mass = moles × molar mass

Q: For the following reaction, 0.400 grams of hydrogen gas are allowed to react with 54.7 grams of…

Q: For the following reaction, 5.96 grams of ammonia are allowed to react with 17.1 grams of oxygen gas…

A: First take out the moles of both reactants then from the reaction stoichiometric calculate the…

Q: For the following reaction, 7.70 grams of sodium are allowed to react with 10.4 grams of water .…

A: Introduction : We need to calculate what is amount of NaOH in grams Also,we need to calculate the…

Q: A 7.50 g sample of hydrogen peroxide decomposes according to the reaction b 2 H2O2(aq) - 2 H20(1) +…

Q: The Ostwald process is used commercially to produce nitric acid, which is, in turn, used in many…

A: Given:Mass of Ammonia = 58.1 gMass of Oxygen = 58.1 gWhat is the maximum mass of H2O produced?The…

Q: Salt mixture: 2.64 g Mass of filter paper: 1.223 g Mass of filter paper and CaC2O4⋅H2O: 1.997 g…

A: Limiting reactant is the one which is present is smaller amount in the reaction mixture and which…

Q: Consider the reaction of solid P4 and chlorine gas to form gaseous phosphorus trichloride. a) Write…

Q: Consider the following reaction: 4Al + 3O2 ⟶ 2Al2O3 If 7.4 moles of Al are reacted with 9.2 moles…

A: The given reaction is 4 Al + 3O2 ⟶ 2 Al2O3. Given data: The moles of Al are 7.4 mol. The moles of…

Q: Teanu Tsaidoi maI Use the References to access important values if needed for this question. For the…

A: Given: Mass of H2 = 0.400 g Mass of I2 = 54.0 g Molar mass of H2 = 2.01588 g/mol Molar mass of I2 =…

Q: For the following reaction, 22.9 grams of diphosphorus pentoxide are allowed to react with 13.1…

A: Given, mass of diphosphorus pentoxide = 22.9 g mass of water = 13.1 g

Q: The Ostwald process is used commercially to produce nitric acid, which is, in turn, used in many…

A: Given - Balanced Chemical equation - 4NH3(g) + 5O2(g) ⟶ 4NO(g) + 6H2O(g) Mass of each Reactant…

Q: Methane (CH4) reacts with oxygen in the air to produce carbon dioxide and water. Ammonia (NH3)…

Q: For the following reaction, 14.7 grams of phosphorus (P4) are allowed to react with 39.7 grams of…

A: Given: mass of P4 = 14.7 g mass of Cl2 = 39.7 g molar mass of P4 = 123.895 g/mol molar mass of Cl2 =…

Q: Aspirin (C9H8O4) is synthesized by reacting salicylic acid (C7H6O3) with acetic anhydride (C4H6O3).…

A: The balanced chemical reaction is, C7H6O3 + C4H6O3 ---> C9H8O4 + HC2H3O2 a) From the given…

Q: For the following reaction, 14.0 grams of phosphorus (P4) are allowed to react with 33.9 grams of…

A: First we need to write a balanced reaction. After that, using the balanced reaction, the limiting…

Q: For the following reaction, 21.5 grams of sulfur dioxide are allowed to react with 9.75 grams of…

A: A question based on kinetics of chemical reaction that is to be accomplished.

Q: The drawing below shows a mixture of molecules: key carbon hydrogen nitrogen sulfur охудen chlorine…

A: The chemical reaction : 2SO2(g) + O2(g) ----> 2SO3(g) Of which reactant are there the most…

Q: For the following reaction, 3.43 grams of hydrogen gas are allowed to react with 42.4 grams of…

A: Given mass of H2 = 3.43 g mass of I2 = 42.4 g

Q: The Ostwald process is used commercially to produce nitric acid, which is, in turn, used in many…

Q: For the following reaction, 9.60 grams of ammonia are allowed to react with 15.1 grams of oxygen…

Q: 3. Which of the following statements is FALSE for the chemical equation given below in which…

Q: For the following reaction, 24.7 grams of sulfur dioxide are allowed to react with 9.95 grams of…

A: The equation for the reaction is: 2 SO2 + O2 → 2 SO3

Q: PCl3 can be produced from the reaction of P4 with Cl2. If 1.00 g P4 reacts with 1.00 g Cl2, which…

A: Given: Mass of P4 = 1.00 g Mass of Cl2 = 1.00 g Known: Molar mass of P4 = 123.89 g/mol Molar mass of…

Q: Consider the following balanced chemical reaction. 2 C2H6 (g) + 7 O2 (g) à 4 CO2 (g) + 6 H2O (l)…

Q: If 15.0 g of nitrogen (N2) and 2.00 g of hydrogen (H2) react to produce 1.38 g of ammonia (NH3),…

A: Given, the balanced chemical reaction is as follows,N2(g)+3H2(g)→2NH3(g) amount of N2 for reaction…

Q: Mass of watch glass and evaporating dish:67.511 g Mass of watch glass, evaporating dish, and Mg…

A: We are given data for the formation of a chloride product of magnesium from Mg(s) metal. Your…

Q: For the following reaction, 13.6 grams of nitrogen monoxide are allowed to react with 5.57 grams of…

A: The given equation is as follows: Nitrogen monoxide(g) + oxygen(g) → Nitrogen dioxide(g) The…

Q: For the following reaction, 14.0 grams of phosphorus (P4) are allowed to react with 33.9 grams of…

A: We have to calculate the maximum mass of product formed, limiting reactant, and excess reactant…

Q: A sample of 5.0 g of hydrogen gas reacts with 5.0 g of oxygen gas. 2H2 (g) + O2 (g) → 2H2O(l) a.…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall be…

Q: For the following reaction, 9.90 grams of benzene (C,Hg) are allowed to react with 15.2 grams of…

A: The reaction given is => C6H6 (l) + O2 (g) -----------> CO2 (g) + H2O (g) Balancing : Since…

Q: For the following reaction, 15.9 grams of glucose (C6H1206) are allowed to react with 12.4 grams of…

A: The given reaction is,

Q: For the following reaction, 12.4 grams of carbon monoxide are allowed to react with 5.60 grams of…

Q: The Ostwald process is used commercially to produce nitric acid, which is, in turn, used in many…

A: Stoichiometry is mainly based on the calculation of moles and volumes. These two values are used to…

Q: For the following reaction, 16.7 grams of chlorine gas are allowed to react with 8.90 grams of…

Q: For the following reaction, 6.70 grams of ammonia are allowed to react with 19.8 grams of oxygen…

Q: For the following reaction, 0.800 grams of hydrogen gas are allowed to react with 14.8 grams of…

A: The reaction taking place is given as, => H2 (g) + C2H4 (g) --------> C2H6 (g) Since all the…

Q: 1. In a reaction of phosphorus and chlorine, both species is 25.0 g, which of the following…

A: Limiting reagent is the reagent which are present in less amount and consume all in reaction.

Q: or the following reaction, 10.1 grams of glucose (CgH1206) are allowed to react with 14.7 grams of…

Q: For the following reaction, 27.2 grams of diphosphorus pentoxide are allowed to react with 14.7…

A: The balanced chemical reaction can be written as follows-

Q: For the following reaction, 9.20 grams of nitrogen gas are allowed to react with with 1.07 grams of…

A: 1.The maximum amount of ammonia formed can be calculated as

Q: For the following reaction, 14.7 grams of phosphorus (P4) are allowed to react with 39.7 grams of…

A: Given: Mass of P4 = 14.7 Mass of Cl2 = 39.7 Molar mass of P4 = 123.895 g/mol Molar mass of Cl2 =…

Q: For the following reaction, 9.30 grams of butane (C4H10) are allowed to react with 16.3 grams of…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

.6262
6= 3.7
4.350-3.757=.593
.593 * 22.9898=13.63g
2. What is the maximum amount of water which can be produced when 20.0 g of
hydrogen is reacted with 30.0 g of oxygen? Which is the limiting reactant? Which
is the excess reactant? How much of the excess reactant will be left over?
H= 2*9.953D19.9
O= 2*.9377= 1.87
1.87*2=3.74
3. How many molecules of hydrogen gas will have been produced when the
reaction runs out between 4.32 g of aluminum metal and 17.65 g of hydrochloric

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

You know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to determine the amount of product that will be produced? Explain.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
ou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Consider the following balanced chemical equation: A+5B3C+4D a. Equal masses of A and B are reacted. Complete each of the following with either A is the limiting reactant because ; B is the limiting reactant because ____ ; or we cannot determine the limiting reactant because _____ i. If the molar mass of A is greater than the molar mass of B, then ii. If the molar mass of B is greater than the molar mass of A, then b. The products of the reaction are carbon dioxide (C) and water (D). Compound A has a similar molar mass to carbon dioxide. Compound B is a diatomic molecule. Identify compound B, and support your answer. c. Compound A is a hydrocarbon that is 81.7 1% carbon by mass. Determine its empirical and molecular formulas.
For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?