What is the calculated value of the cell potential at 298K for an electrochemical cell with the followingreaction, when the H2 pressure is 1.53×10* atm, the H* concentration is 1.01M, and the Fe2* concentrationis 7.45×104M ?2+2H" (аq) + Fe(s) Н. (9) + Fe-"(aq)Answer:VThe cell reaction as written above is spontaneous for the concentrations given: true

Answered: Image /qna-images/answer/a28736d5-0167-44b5-9ef8-f384f5ce0057.jpg

2H"(aq) + Fe(s) H2(g) + Fe2+ What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the H2 pressure is 1.53×10³ atm, the H* concentration is 1.01M, and the Fet concentration is 7.45×104M ? "(aq) Answer: V The cell reaction as written above is spontaneous for the concentrations given: (true

2H"(aq) + Fe(s) H2(g) + Fe2+ What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the H2 pressure is 1.53×10³ atm, the H* concentration is 1.01M, and the Fet concentration is 7.45×104M ? "(aq) Answer: V The cell reaction as written above is spontaneous for the concentrations given: (true

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 105QAP: Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a)...

See similar textbooks

Similar questions

The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Zn|Zn2+(0.50M)Cd2+(0.020M)|Cd (b) Cu|Cu2+(0.0010M)H+(0.010M)|H2(1.00atm)|Pt
Calculate the voltages of the following cells at 25°C and under the following conditions: (a) Cu|Cu+(0.80M)Hg22+(0.10M)|Hg|Pt (b) Cr|Cr3+(0.615M)Ni2+(0.228M)|Ni
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Iron in an NaCl solution, pH=1, shows a potential of +0.2 volts vs. SHE. What are the possible anodic and cathodic reactions, assuming that the Pourbaix diagram of Figure 2.4 is applicable? 2-8. A student suggests that two possible reactions for Problem 2.7 are Cl2 + 2e = 2CI and Na = Na* + e". = Do you agree with either or both? If so, what assumptions must you make?
Calculate the cell potential of the lead dipole electrode when its concentration is (0.3) at a temperature of 25°C and after reducing it to single lead, its concentration becomes (0.6 M), knowing that the electromotive force is (v -0.126).
6) Chromium can be electroplated from aqueous potassium dichromate, with thereduction shown below. If a current of 6.0A and a voltage of 4.5V are used:Cr2O7+(aq) + 14H+(aq) + 12e- -> 2Cr(s)+7H2Oa) How many hours would it take to completely convert215mL of 1.25M K2Cr2O7 to elemental chromium?b) How many kilowatt-hours of electrical energy arerequired to plate 1.00 g of chromium?
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the H2 pressure is 1.08×10-3 atm, the H+concentration is 1.30M, and the Co2+ concentration is 9.41×10-4M ? 2H+(aq) + Co(s) ---->H2(g)+ Co2+(aq)Answer: ______VThe cell reaction as written above is spontaneous for the concentrations given: _______t or f.
What is the calculated value of the cell potential at 298 K for an electrochemical cell with the following reaction, when the H2 pressure is 7.53×10-3bar, the H+ concentration is 1.15 M, and the Zn2+ concentration is 5.73×10-4 M ? 2H+(aq) + Zn(s) H2(g) + Zn2+(aq)Answer: VThe cell reaction as written above is product-favored (spontaneous) for the concentrations given
What is the calculated value of the cell potential at 298K for an electrochemical cell with the following reaction, when the Cu2+ concentration is 1.34 M and the Mg2+ concentration is 8.81×10-4 M ?Cu2+(aq) + Mg(s) Cu(s) + Mg2+(aq)Answer: _____ VThe cell reaction as written above is spontaneous for the concentrations given: tue or false?