3) At T= 2200K, K = 3200 for the reaction shown below. N2 (g)+ 02 (g) 2 NO (g) a) Using successive approximations, determine the molar concentrations of all species at equilibrium given that the initial molar concentration of N2 was 0.65 M and that the initial molar concentration of 02 was 0.45 M. In this situation, you will have to assume the reaction goes to completion, and then use the method of successive approximations. b) Using the quadratic formula, determine the molar concentrations of all species at equilibrium. In this case, you will NOT need to take the reaction to completion

3) At T= 2200K, K = 3200 for the reaction shown below. N2 (g)+ 02 (g) 2 NO (g) a) Using successive approximations, determine the molar concentrations of all species at equilibrium given that the initial molar concentration of N2 was 0.65 M and that the initial molar concentration of 02 was 0.45 M. In this situation, you will have to assume the reaction goes to completion, and then use the method of successive approximations. b) Using the quadratic formula, determine the molar concentrations of all species at equilibrium. In this case, you will NOT need to take the reaction to completion

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 69P

See similar textbooks

Similar questions

What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)
For the given chemical equilibrium, these data are determined experimentally: T K 350K 3.76102 450K 1.86101 Determine H for this reaction.
Carbon dioxide decomposes into CO and O2 at elevated temperatures. What is the equilibrium partial pressure of oxygen in a sample at 1000 C for which the initial pressure of CO2 was 1.15 atm?
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
Show that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
Explain why there may be an infinite number of values for the reaction quotient of a reaction at a given temperature but theme can he only one value for the equilibrium constant at that temperature.
Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?
At 1100 K, KP = 0.25 for the reaction 2SO2(g)+O2(g)2SO3(g) Calculate the equilibrium partial pressures of SO2, O2, and SO3 produced from an initial mixture in which PSO2=PO2=0.50atm and PSO3=0. (Hint: If you don t have a graphing calculator, then use the method of successive approximations to solve, as discussed in Appendix 1.4.)