Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Q16. The structure (I) is converted to its chair form; the wedge groups are kept in an upward…
Q: The distribution constant for compound A between an organic solvent and water is 65. Calculate the…
A: The distribution constant (Kd) is a measure of the distribution of a compound between two immiscible…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A:
Q: a) For n-hexane the vaporization enthalpy and entropy are given (AHvap = 29.6 kJ mol 1; ASvap =…
A: Step 1: Step 2: Step 3: Step 4:
Q: Given that 2 NO2(g) N₂O(g) → N2(g) + 202(g) ΔΗ = -67.7 ΚΙ - N2(g) + 202(g) AH = -9.7 kJ Use Hess's…
A: The given reactions are:2 NO2(g) → N2O4(g), ΔH = -67.7 kJ (Reaction 1)N2(g) + 2O2(g) → 2 NO2(g), ΔH…
Q: The type of polymer formed by sequential addition of an alkene is a(n) A addition polymer. B…
A: In polymer chemistry, there are several types of polymers, including addition polymers, condensation…
Q: None
A: To solve for the new pressure P2 when the temperature changes from T1 to T2, you can use the ideal…
Q: What is the pH of a solution of Na₂HPO3? (The pK₂ values for H3PO3 are: pKa1 = 2.15, pKa2 = 7.20,…
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:Step 2:Step 3: Step 4:
Q: Describe electron transfer between atoms to form ionic bonds. Illustrate covalent bond formation…
A: An ionic bond is a type of chemical bond that involves a metal and a nonmetal ion (or polyatomic…
Q: None
A: Based on the chemical structures shown in the image, the molecule labeled B appears to be the most…
Q: A miniature volcano is made in the laboratory with ammonium dichromate. When ignited, it decomposes…
A: Given:…
Q: Solve the following proporti (y)/(8)=(5)/(3) Round your answer to the ne
A: The problem is a proportion, which is an equation that states that two ratios are equal. In this…
Q: None
A: Part 2:Explanation:Step 1: Derive Rate EquationsThe rate equations for the given consecutive…
Q: Question Refer to the precipitation reaction below. 2KOH (aq) + CaCl2 (aq) → > Ca(OH)2 (s) + 2KCl…
A: The balanced chemical equation for the reaction is 2KOH + CaCl2 → Ca(OH)2 + 2KCl. This tells us that…
Q: The number of sublevels in the "nth" level is equal to the number "n". (Hint: substitute a real…
A: In atomic structure, electrons are arranged in energy levels around the nucleus. Each energy level…
Q: None
A: Step 1: The number of formula units of the given compound, FeCl3, can be determined by multiplying…
Q: Predict the Intermediate and Mechanism. Predict the esterification intermediate resulting from the…
A: Step 1:Detailed mechanism with arrow pushing:1. Protonation of the carbonyl: [ \text{R-C(=0)-Cl…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: The balanced equation for the reaction of Aluminium and copper nitrate…
Q: 6. Write the structure of the MAJOR product for each of the following reactions, and show any…
A:
Q: Z 6. The following kinetic data are collected for the initial rates of a reaction 2X+ products:…
A: Given: Expt123[X],M0.250.500.50[Z],M0.250.500.75Initialrate,M/s4.0x1013.2x1027.2x102Step 1:…
Q: General Information Compound Name : Curcumin HO O acetyl acetone vanillin a. Draw the reaction…
A:
Q: The mass of 0.46 moles of H2O is: Give your answer to the hundredths place in g. Do not put units in…
A:
Q: 1. Plot a graph of beight of the air colunn vs tenpersture in °C, Place both TRIALS on the same…
A: the image, as it appears to be a copyrighted textbook or solution manual. However, I can help you…
Q: Question 16 What is the name of the following polymer? OH OH OH OH OH OH 666666 OH OH OH OH OH OH OH…
A: D-glucose: Option 1 : Amylose (Straight chain polymer of D-glucose) Option 2 : Galactose (not a…
Q: k1 The mechanism A + A A2* A2* + M k2 K2 A2+ M k.1 is common in reactions of the type A + A + M → A2…
A: Step 1: DimerizationA + A <-> A2*In this step, two molecules of A collide and form an excited…
Q: bo Carbonic anhydrase of erythrocytes (M, 30,000) has one of the highest turnover numbers known. It…
A: We can determine how efficient carbonic anhydrase is by calculating its turnover number (kcat). This…
Q: 4. Predict the product of the following aldol condensation reaction which produces a ẞ-…
A: CH3CH2C−(O)CH2CH3+CH3CH2COCH3→CH3CH2C(OH)CH2CH3CH3CH2C(O)CH3
Q: Chemistry
A: Step 1: Firstly Born Haber cycle is constructed then using the given data, lattice enthalpy of s…
Q: At a certain temperature the rate of this reaction is first order in C1205 with a rate constant of…
A: The given values in the problem are:The initial concentration of C1205, [C1205]=0.740 MThe rate…
Q: None
A: There are several steps that can be taken to lessen the harmful consequences of pollution by metals.…
Q: Please help me with the organic chemistry question below. Please share explanations to aid in…
A: the conversion of linear polyene E4 to tetracyclic natural product E5.Pericyclic reactions are a…
Q: The orbital diagram that follows shows the valence electrons for a 4+ ion of an element. Part A What…
A:
Q: How many grams of iron need to react to produce 91.4 g iron(III) oxide according to the balanced…
A: Step 1: Calculation of the moles of Fe2O3 produceGiven,mass of Fe2O3 = 91.4 gwe know, molar mass of…
Q: PLS HELP ASAP ON ALL ASKED QUESTIONS PLS
A:
Q: esc 1 Given the following reactions N2 (g) + O2 (g) → 2NO (g) AH=+180.7 kJ 2N2O (g) → O2 (g) + 2N2…
A:
Q: 1. Give the products of the reaction between the following compounds with 1-penten-3-one:…
A: Step 1: Step 2:Reaction with CH3CH2MgBr gives us 4-hepten-3-ol.Grignard reagents are strong…
Q: None
A: Answer image:a.
Q: • A project cost 150,000 USD • Will last for 6 years, the salvage value of 20,000 USD • The…
A: Project Details:- Initial Cost: 150,000 USD- Duration: 6 years- Salvage Value: 20,000 USD- Cash…
Q: can you show the expanded structural formula for: octa-4,6-dien-1-amine - show every atom and…
A: The name of the compound is octa-4,6-dien-1-amine. This name is based on the IUPAC nomenclature for…
Q: Calculate the pH at each point of a titration where 30.0 ml of 0.25M HNO, are titrated with the…
A: various points during the titration of 30.0 mL of 0.25 M HNO3 with 0.15 M LiOH. Here's how to…
Q: Please give Step by Step Answer Otherwise i give Dislike
A: Step 1: Step 2: Step 3: Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: According to given reaction 4FeS2(s) + 11O2(g)→2Fe2O3(s) + 8SO2(g)4 moles of FeS2 react to form 8…
Q: Indicate the molecularity of the reaction represented in the figure diagram. Explain it. A A A A
A: Let us dive deep into the diagram and explain it.Step 1The diagram provided is a representation of…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Given: 715X;612X;713X;818X;714X;614X;816X;613X;817XStep 1: Define the A-Z notation.ZAXA is…
Q: Please correct answer and don't use hend raiting
A: Step 1: Given that Temperature at hot = 25 degrees Temperature at cold = 2 degrees Height of…
Q: 7. Write the structure(s) of the major product(s) for each of the following reactions and show any…
A: Step 1:Reaction (a):Reaction Conditions:Reagent: Br2Conditions: hv (light), in CCl4, room…
Q: A process starts with a 26.47 kg reactant mixture and ultimately produces 11.19 kg of product, 9.45…
A: Given:Initial reactant mixture: 26.47 kgProduct produced: 11.19 kgBy-products: 9.45 kgWater: 5.83 kg…
Q: What are the structures of the aldehyde and/or ketone precursors for preparation of 1 by a mixed…
A:
Q: Suppose a student needs to determine the concentration of a NaOH solution. He performed a…
A: First, we need to calculate the number of moles of benzoic acid used in the titration. The number of…
Step by step
Solved in 2 steps with 2 images
- 15. Predict the major fragments and their m/z that would appear in the mass spectra of these compounds: A D B E C F HO O OH7 Predict the masses and the structures of the most abundant fragments observed in the mass spectra of the followingcompounds. 4-methylpentan-2-olConsider the mass spectrum below. 100 80- 60- 20 0.0- 0.0 60 100 miz SDBS, National Institute of Advanced Industrial Science and Technology Which peak is the molecular ion? Choose one OA OB OD. OG
- 1. Which one of the given compounds is consistent with the mass spectrum below? 100 40 20 10 20 25 30 35 40 5o 55 45 60 65 70 75 m/z Courtesy of SDBS: National Institute of Advanced Industrial Science and Technology A. CH,CH,CH(CH,), В. CH,CHOHCH,CH, C. CH,CH,OCH,CH, D. CH,CH,NHCH,CH, E. CH,CH,CH,CH, Relative htensityAssign each mass spectrum to the molecule on the list. Write down the molecule that corresponds to the main fragments. 1. 60 80 100 0 20 80 m/z B. Jadi 71 100 0 20 00 10 40 miz m/z D. MY. -Taut A. C. 8 2Pent-1-ene and pent-1-yne are low-boiling hydrocarbons that have differentmolecular ions in their mass spectra. Match each hydrocarbon to its massspectrum.
- What is the most likely base peak in the mass spectrum of the given compound? oe H. Select one: H. cöInterpret the mass spectra of Methylene chloride. draw atleast 4 possible fragments1. Draw all possible isomers for the molecular formula C6H14 Next predict mass spectra of all isomers and explain how you would use mass spectra to identify each of the isomers.
