5.000 g of Compound X with molecular formula C,Hg are burned in a constant-pressure calorimeter containing 35.00 kg of water at 25 °C. The temperature of the water is observed to rise by 1.554 °C. (You may assume all the heat released by the reaction is absorbed by the water, and none by the calorimeter itself.) Calculate the standard heat of formation of Compound X at 25 "C. Be sure your answer has a unit symbol, if necessary, and round it to the correct number of significant digits.

5.000 g of Compound X with molecular formula C,Hg are burned in a constant-pressure calorimeter containing 35.00 kg of water at 25 °C. The temperature of the water is observed to rise by 1.554 °C. (You may assume all the heat released by the reaction is absorbed by the water, and none by the calorimeter itself.) Calculate the standard heat of formation of Compound X at 25 "C. Be sure your answer has a unit symbol, if necessary, and round it to the correct number of significant digits.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 100AE

See similar textbooks

Similar questions

Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
Explain why absolute enthalpies and energies cannot be measured, and only changes can be determined.
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
A 21.3-mL sample of 0.977 M NaOH is mixed with 29.5 mL of 0.918 M HCl in a coffee-cup calorimeter (see Section 6.6 of your text for a description of a coffee-cup calorimeter). The enthalpy of the reaction, written with the lowest whole-number coefficients, is 55.8 kJ. Both solutions are at 19.6C prior to mixing and reacting. What is the final temperature of the reaction mixture? When solving this problem, assume that no heat is lost from the calorimeter to the surroundings, the density of all solutions is 1.00 g/mL, the specific heat of all solutions is the same as that of water, and volumes are additive.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
A piece of titanium metal with a mass of 20.8 g is heated in boiling water to 99.5 C and then dropped into a coffee-cup calorimeter containing 75.0 g of water at 21.7 C. When thermal equilibrium is reached, the final temperature is 24.3 C. Calculate the specific heat capacity of titanium.
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
Under what circumstances is the heat of a process equal to the enthalpy change for the process?