Please answer fast I'll rate you sure 51.1 Write the cell reactions, electrode half-reactions, andNernst equations for the following cells:(a) Ag(s)|AgNO3(aq,m)||AgNO3(aq, me|Ag(s)(b) Pt(s)|H₂(g.p.)|HCl(aq)|H₂(g,PR)|Pt(s)(c) Pt(s)|K3[Fe(CN),](aq), K4[Fe(CN)l(aq)||Mn²+(aq),H*(aq)|MnO₂ (s)|Pt(s)(d)Pt(s)|Cl₂(g)|HCl(aq)||HBr(aq)|Br₂(1) Pt(s)(e) Pt(s) |Fe³+ (aq), Fe2+ (aq)||Sn+ (aq),Sn²+ (aq)|Pt(s)(f) Fe(s)| Fe2+ (aq)||Mn2+ (aq), H(aq)|MnO₂(s)|Pt(s)

As per our honour code we can only provide 2-3 parts out of 6 and for the solutions of remaining…

51.1 Write the cell reactions, electrode half-reactions, and Nernst equations for the following cells: (a) Ag(s)|AgNO3(aq, m)||AgNO3(aq, m)|Ag(s) (b) Pt(s)|H₂(g.p)|HCl(aq)|H₂(g.PR)|Pt(s) (c) Pt(s)|K3[Fe(CN)6] (aq), K₂[Fe(CN),l(aq)||Mn²+ (aq), H(aq)| MnO₂ (s)|Pt(s) (d) Pt(s)|Cl₂(g)|HCl(aq)||HBr(aq)|Br₂(1)|Pt(s) (e) Pt(s) |Fe³+ (aq), Fe2+ (aq)||Sn4+ (aq), Sn²+ (aq)|Pt(s) (f) Fe(s)| Fe²+ (aq)||Mn2+ (aq), H(aq)|MnO₂(s)|Pt(s)

51.1 Write the cell reactions, electrode half-reactions, and Nernst equations for the following cells: (a) Ag(s)|AgNO3(aq, m)||AgNO3(aq, m)|Ag(s) (b) Pt(s)|H₂(g.p)|HCl(aq)|H₂(g.PR)|Pt(s) (c) Pt(s)|K3[Fe(CN)6] (aq), K₂[Fe(CN),l(aq)||Mn²+ (aq), H(aq)| MnO₂ (s)|Pt(s) (d) Pt(s)|Cl₂(g)|HCl(aq)||HBr(aq)|Br₂(1)|Pt(s) (e) Pt(s) |Fe³+ (aq), Fe2+ (aq)||Sn4+ (aq), Sn²+ (aq)|Pt(s) (f) Fe(s)| Fe²+ (aq)||Mn2+ (aq), H(aq)|MnO₂(s)|Pt(s)

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.95QE

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
One ecologically important equilibrium is that between carbonate and hydrogencarbonate (bicarbonate) ions in natural water. (a) The standard Gibbs energies of formation of CO32−(aq) and HCO3−(aq) are −527.81 kJ mol−1 and −586.77 kJ mol−1, respectively. What is the standard potential of the HCO3−/CO32−,H2 couple? (b) Calculate the standard potential of a cell in which the cell reaction is Na2CO3(aq) + H2O(l) → NaHCO3(aq) + NaOH(aq). (c) Write the Nernst equation for the cell, and (d) predict and calculate the change in cell potential when the pH is changed to 7.0 at 298 K.
If a dilute H2 SO4 solution is electrolyzed with copper electrodes, the most likely electrode reactions are 2H ^ + + 2e- = H2 (g) at the cathode and 2Cu (s) + H2O = Cu2O (s) + 2H ^ + + 2e- at the anode. If we observe the formation of 27.4 cm3 of moist hydrogen (751 barometric torrs, 23.3 ° C) at the cathode, what change in weight will there be simultaneously at the anode? Data: Pv H2O 23.3 ° C = 22 torr.Atomic mass: Cu (65); O (16); H (1)
Calculate the cell potential for the galvanic cell in which the reaction Fe(s)+Au3+(aq)↽−−⇀ Fe3+(aq)+Au(s) occurs at 25 ∘C , given that [Fe3+]=0.00110 M and [Au3+]=0.789 M . Refer to the table of standard reduction potentials.