8. Consider the following reaction: CO(g) + H₂O(g) = CO₂(g) + H₂(g) Kc = 107 (at 500K) If a reaction mixture initially contains 0.125M CO and 0.125M H₂O, what will be the equilibrium concentration of each of the reactants and products? nene-sept airs dis (20) instantoo mundillupe erit eishuole o

8. Consider the following reaction: CO(g) + H₂O(g) = CO₂(g) + H₂(g) Kc = 107 (at 500K) If a reaction mixture initially contains 0.125M CO and 0.125M H₂O, what will be the equilibrium concentration of each of the reactants and products? nene-sept airs dis (20) instantoo mundillupe erit eishuole o

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 89AP

See similar textbooks

Similar questions

Predict the temperature at which the reaction in Exercise 17.67 comes to equilibrium. Consider the equation G = H TS. At some value of T, G equals zero and the reaction is at equilibrium. Set G = 0, substitute for H and S (assuming that they do not vary much with temperature) and solve for T. CH3CHO(l)+52O2(g)2CO2(g)+2H2O(l)
For the reaction C(s)+CO2(g)2CO(g) K=168 at 1273 K. If one starts with 0.3 atm of CO2 and 12.0 g of C at 1273 K, will the equilibrium mixture contain (a) mostly CO2? (b) mostly CO? (c) roughly equal amounts of CO2 and CO? (d) only C?
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
Consider the decomposition of CaCO3(s) into CaO(s) and Co2(g). What is the equilibrium partial pressure of CO2 at room temperature?
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?
Consider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?
Some metal oxides can be decomposed to the metal and oxygen under reasonable conditions. Is the decomposition of silver(I) oxide product-favored at equilibrium at 25 C? 2 Ag2O(s) 4 Ag(s) + O2(g) If not, can it become so if the temperature is raised? At what temperature does the reaction become product-favored at equilibrium?
The following equilibrium is established in a closed container: C(s)+O2(g)CO2(g)H=393kJmol1 How does the equilibrium shift in response to each of the following stresses? (a) The quantity of solid carbon is increased. (b) A small quantity of water is added, and CO2 dissolves in it. (c) The system is cooled. (d) The volume of the container is increased.
When calcium carbonate is heated strongly, CO2 gas is evolved. The equilibrium pressure of CO2 is 1.00 bar at 897 C, and rH at 298 K is 179.0 kJ/mol-rxn. CaCO3(s) CaO(s) + CO2(g) Estimate the value of rS at 897 C for the reaction.
Acetic acid, CH3CO2H, can form a dimer, (CH3CO2H)2, in the gas phase.. 2CH3CO2H(g)(CH3CO2H)2(g) The dimer is held together by to hydrogen bonds with a total strength of 66.5 kJ per mole of dimer. At 25 C, the equilibrium constant for the dimerization is 1.3103 (pressure in atm). What is ?S for the reaction?
A process that is reactant-favored at equilibrium can never be spontaneous. This statement is (a) true (b) false