8. Consider the oxidation of ethanol to acetaldehyde at 37C. Note that this reaction involves the transfer of two electrons. CH,CH,OH (aq)+0,(8)=CH,CH0(aq)+ H,0(1) E = +1.008V a) Write an expression for Q in terms of the activities and fugacities of the products and reactants. b) Calculate Q for the reaction if the activity of ethanol is 0.1, the activity of acetaldehyde is 1 and the fugacity of oxygen is 3 bar. c) Calculate the Gibbs energy, AG', for the reaction using the information above.

8. Consider the oxidation of ethanol to acetaldehyde at 37C. Note that this reaction involves the transfer of two electrons. CH,CH,OH (aq)+0,(8)=CH,CH0(aq)+ H,0(1) E = +1.008V a) Write an expression for Q in terms of the activities and fugacities of the products and reactants. b) Calculate Q for the reaction if the activity of ethanol is 0.1, the activity of acetaldehyde is 1 and the fugacity of oxygen is 3 bar. c) Calculate the Gibbs energy, AG', for the reaction using the information above.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter17: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 7RQ: If you calculate a value for G for a reaction using the values of Gf in Appendix 4 and get a...

See similar textbooks

Similar questions

Iodine, I2, dissolves readily in carbon tetrachloride. For this process, H = 0 kJ/mol. I2(s) I2 (in CCl4 solution) What is the sign of rG? Is the dissolving process entropy-driven or enthalpy-driven? Explain briefly.
Liquid water at 25C is introduced into an evacuated, insulated vessel. Identify the signs of the following thermodynamic functions for the process that occurs: H, S, Twater, Ssurr,, Suniv.
If you calculate a value for G for a reaction using the values of Gf in Appendix 4 and get a negative number, is it correct to say that the reaction is always spontaneous? Why or why not? Free energy changes also depend on concentration. For gases, how is G related to the pressure of the gas? What are standard pressures for gases and standard concentrations for solutes? How do you calculate G for a reaction at nonstandard conditions? The equation to determine G at nonstandard conditions has Q in it: What is Q? A reaction is spontaneous as long as G is negative; that is, reactions always proceed as long as the products have a lower free energy than the reactants. What is so special about equilibrium? Why dont reactions move away from equilibrium?
Estimate the temperature range over which each of the following reactions is spontaneous. (a) 2Al(s)+3Cl2(g)2AlCl3(s) (b) 2NOCl(g)2NO(g)+Cl2(g) (c) 4NO(g)+6H2O(g)4NH3(g)+5O2(g) (d) 2PH3(g)3H2(g)+2P(g)
Sodium reacts violently with water according to the equation Na(s) + H2O() NaOH(aq) + H2(g) Without doing calculations, predict the signs of rH and rS for the reaction. Verify your prediction with a calculation.
Explain why absolute entropies can be measured.
Many biochemical reactions that occur in cells require relatively high concentrations of potassium ion (K+). The concentration of K + in muscle cells is about 0.l5 M. The concentration of K+ in blood plasma is about 0.0050 M. The high internal concentration in cells is maintained by pumping K+ from the plasma. How much work must be done to transport 1.0 mole of K+ from the blood to the inside of a muscle cell at 37C, normal body temperature? When 1.0 mole of K+ is transferred from blood to the cells, do any other ions have to be transported? Why or why not?
Describe how the standard entropy of hydrogen gas at 25C can be obtained from heat measurements.
What is the difference between S, S , and S 298 for a Chemical change?
One of the important reactions in the biochemical pathway glycolysis is the reaction of glucose-6-phosphate (G6P) to form fructose-6-phosphate (F6P): G6PF6PG298=1.7kJ (a) Is the reaction spontaneous or nonspontaneous under standard thermodynamic conditions?. (b) Standard thermodynamic conditions imply the concentrations of G6P and F6P to be 1 M, however, in a typical cell, they are not even Close to these values. Calculate G when the concentrations of G6P and F6P are 120 M and 28 M respectively, and discuss the spontaneity of the forward reaction under these conditions. Assume the temperature is 37 C.
a Calculate K1, at 25C for sulfurous acid: H2SO3(aq)H+(aq)+HSO3(aq) b Which thermodynamic factor is the most significant in accounting for the fact that sulfurous acid is a weak acid? Why?
Impure nickel, refined by smelting sulfide ores in a blast furnace, can be converted into metal from 99.90% to 99.99% purity by the Mond process. The primary reaction involved in the Mond process is Ni(s)+4CO(g)Ni(CO)4(g) a. Without referring to Appendix 4, predict the sign of S for the above reaction. Explain. b. The spontaneity of the above reaction is temperature-dependent. Predict the sign of Ssurr, for this reaction. Explain c. For Ni(CO)4(g), Hfo=607KJ/mol and S = 417 J/K mol at 298 K. Using these values and data in Appendix 4, calculate H and S for the above reaction. d. Calculate the temperature at which G = 0 (K = 1) for the above reaction, assuming that H and S do not depend on temperature. e. The first step of the Mood process involves equilibrating impure nickel with CO(g) and Ni(CO)4(g) at about 50C. The purpose of this step is to convert as much nickel as possible into the gas phase. Calculate the equilibrium constant for the above reaction at 50.C. f. In the second step of the Mood process, the gaseous Ni(CO)4 is isolated and heated to 227C. The purpose of this step is to deposit as much nickel as possible as pure solid (the reverse of the preceding reaction). Calculate the equilibrium constant for the preceding reaction at 227C. g. Why is temperature increased for the second step of the Mood process? h. The Mond process relies on the volatility of Ni(CO)4 for its success. Only pressures and temperatures at which Ni(CO)4 is a gas are useful. A recently developed variation of the Mood process carries out the first step at higher pressures and a temperature of l52C. Estimate the maximum pressure of Ni(CO)4(g) that can be attained before the gas will liquefy at 152C. The boiling point for Ni(CO)4 is 42C and the enthalpy of vaporization is 29.0 kJ/mol. [Hint: The phase change reaction and the corresponding equilibrium expression are Ni(CO)4(l)Ni(CO)4(g)K=PNi(CO)4 Ni(CO)4(g) will liquefy when the pressure of Ni(CO)4 is greater than the K value.]