9.) Consider reaction: 2Al(s) + 3Cl,(g) - 2AICI,(s) What is percent yield if 130 g of AICI, is produced when 125 g of Al react with 125 g of Cl,? 10.) Consider reaction: 2Al(s) + 3Cl,(g) → 2AICI,(s) How many grams of AICI, would be produced if percent yield was 73% when 125 g of Al react with 125 g if Cl,? 11.) Given is the following equation: 2Al + 3CuSo, - Al2(So,), + 3Cu What is the limiting reactant when 146 g of Al react with 187 g of CuSo,? What is the excess reactant?

9.) Consider reaction: 2Al(s) + 3Cl,(g) - 2AICI,(s) What is percent yield if 130 g of AICI, is produced when 125 g of Al react with 125 g of Cl,? 10.) Consider reaction: 2Al(s) + 3Cl,(g) → 2AICI,(s) How many grams of AICI, would be produced if percent yield was 73% when 125 g of Al react with 125 g if Cl,? 11.) Given is the following equation: 2Al + 3CuSo, - Al2(So,), + 3Cu What is the limiting reactant when 146 g of Al react with 187 g of CuSo,? What is the excess reactant?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter5: Stoichiometry

Section: Chapter Questions

Problem 9RQ: Consider the following mixture of SO2(g) and O2(g). If SO2(g) and O2(g) react to form SO3(g), draw a...

See similar textbooks

Similar questions

Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
When elemental copper is strongly heated with sulfur, a mixture of CuS and Cu2Sis produced. with CuS predominating. :math>Cu(s)+S(s)CuS(s)2Cu(s)+S(s)Cu2S(s) at is the theoretical yield of CuS when 31.8 g of Cu(s) is heated with 50.0 g of S? (Assume only CuS is produced in the reaction.) What is the percent yield of CuS if only 40.0 g of CuS can be isolated from the mixture?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
Consider the following mixture of SO2(g) and O2(g). If SO2(g) and O2(g) react to form SO3(g), draw a representation of the product mixture assuming the reaction goes to completion. What is the limiting reactant in the reaction? If 96.0 g of SO2 react with 32.0 g O2, what mass o f product will form?
The phosphorus pentoxide used to produce phosphoric acid for cola soft drinks is prepared by burning phosphorus in oxygen. (a) What is the limiting reactant when 0.200 mol of P4 and 0.200 mol of 02 react according to P4+5O2P4O10 (b) Calculate the percent yield if 10.0 g of P4O10 is isolated from the reaction.
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
Cyanogen gas, C2N2, has been found in the gases of outer space. It can react with fluorine to form carbon tetrafluoride and nitrogen trifluoride. C2N2(g)+7F2(g)2CF4(g)+2NF3(g)(a) How many moles of fluorine react with 1.37 mol of cyanogen? (b) How many moles of CF4 are obtained from 13.75 mol of fluorine? (c) How many moles of cyanogen are required to produce 0.8974 mol of NF3? (d) How many moles of fluorine will yield 4.981 mol of nitrogen trifluoride?
Consider the following generic reaction: Y2+2XY2XY2 In a limiting reactant problem, a certain quantity of each reactant is given and you are usually asked to calculate the mass of product formed. If 10.0 g of Y2 is reacted with 10.0 g of XY, outline two methods you could use to determine which reactant is limiting (runs out first) and thus determines the mass of product formed.
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.