Q: What is the solubility of tooth enamel in saliva, after consuming a gallon of orange juice, where…
A: Step 1: Step 2: Step 3: Step 4:
Q: producto principal HO CH3 HNO3 H2504 NO₂
A:
Q: Instructions: (1) You may use your class textbooks, handouts, and notes as you work on this problem…
A: The question asks for the synthesis of a specific molecule, which is a (Z)-alkene with a methoxy…
Q: An IR spectrum, a 13C NMR spectrum, and a 1H NMR spectrum were obtained for an unknown structure…
A:
Q: Show a synthesis of the following mostly (Z)-alkene molecule starting from benzene (C6H6), any other…
A: Show a synthesis of the following mostly (Z)-alkene molecule starting from benzene (C6H6), any other…
Q: Which compound is expected to be most acidic? OH NH2 A B OMe ○ A Ов ос D H OH D H OMe NH2
A: To determine which compound is the most acidic, we need to consider the electron-withdrawing or…
Q: The non-polar molecule among the following is O Type here to search CI CI-C-H H CI CI-C-CI CI H…
A: Thank you.
Q: Draw the major organic product(s) for the following. - You may assume each reaction occurs just one…
A:
Q: Draw a structural formula for the major organic product of the reaction shown below. CH3(CH2)5 CH2 +…
A:
Q: Please help me solve the following question, explain and make sure everything is correct, thanks !!
A: You can just use Volume of Fluorine ÷ Number of moles of Fluorine = Volume of Oxygen ÷ Number of…
Q: 6) The reaction below shows how coal (carbon) can be converted to methane (natural gas): C(s)…
A: First, we need to calculate the change in enthalpy (∆H°) and the change in entropy (∆S°) for the…
Q: What is the chemical formula for ammonium carbide and what is the molar mass?
A: Step 1: Step 2: Step 3: Step 4:
Q: What is the correct curved arrow mechanism to account for the first step of formation of the ester…
A: Cl is a leaving group. The carbonyl oxygen of 3-methylbutanoic acid is protonated by the acid…
Q: 4. In the experiment TLC: (a) When the best separations are achieved, what values range do R, fall…
A: Step 1 Step 2 Step 3 : Step 4
Q: 4. Calculate the pH at each point of a titration where 30.0 ml of 0.25M HNO3 are titrated with the…
A: Initial moles of HNO3: 0.0075 molMoles of LiOH added:15.0 mL: 0.00225 mol25.0 mL: 0.00375 mol50.0…
Q: The following initial rate data are for the oxidation of nitrogen monoxide by oxygen at 25 °C: 2NOO2…
A:
Q: 0 A chemist dissolves 578. mg of pure perchloric acid in enough water to make up 120. mL of…
A: Given:Mass of perchloric acid (HClO4)= 578. mg (3 significant figures)Volume of the…
Q: V. Show a synthesis of the following mostly (Z)-alkene molecule starting from benzene (C6H6), any…
A: Step 1: Step 2: Step 3: Step 4:
Q: What is the pH of 0.42 mol benzoic acid reacted with 0.17 mol NaOH? Total volume = 0.66 L Ka…
A:
Q: Draw the major organic product(s) for the following. - You may assume each reaction occurs just one…
A: 1st step is Fridel craft acylation reaction where para product is formed as the substituted tertiary…
Q: Chemistry
A: Chemistry is the scientific study of the properties, composition, and behavior of matter. It…
Q: What name is given to an object that orbits a larger object in space, such as a moon?
A: Detailed explanation: A satellite is any object that orbits a larger object in space. This orbit is…
Q: None
A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…
Q: Show a synthesis of the following molecules starting from benzene, any carbon-containing molecules…
A: Step 1:Step 2: Step 3: Step 4:
Q: What undergoes alpha decay to form Fr-273 In-123 undergoes electron capture to generate what
A: In alpha decay, an atomic nucleus emits an alpha particle (consisting of 2 protons and 2 neutrons)…
Q: The IR and 13C NMR spectra are shown for a molecule with the molecular formula of C5H10O. Draw the…
A:
Q: . Calculate the lattice energy of Li₂O(S). (AH(sublimation) K(s) = 77 kJ/mole, and AHƒ (Li₂O(s)) =…
A: Lattice energy is defined as the energy released when gaseous ions come together to form a solid…
Q: Please correct answer and don't use hend raiting
A: Step 1: Boiling point elevation is given by:ΔT = ((RT2)/ΔHVap) XsolHere, ΔT = Boling point…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: To give IUPAC name for any compound, firstly we have to select longest chain, that is…
Q: A student was given an unknown mixture and was asked to determine its composition by thin layer…
A: I used a ruler to measure the distance as shown in my monitor.Distance travelled by solvent = 5.3 cm…
Q: The following sentence has the format “Statement 1 BECAUSE Statement 2”. Decide whether statement 1…
A: First, let's understand the two statements. Statement 1 is about the elution order of…
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: Please help me with the organic chemistry question below. Please share explanations to aid in…
A: The text in the image describes a chemical reaction that occurs in two or more pericyclic steps.…
Q: Decide whether the Lewis structure proposed for each molecule is reasonable or not. molecule…
A: Lewis structures are graphical depictions of the spatial configuration of atoms and their chemical…
Q: 1. نه E PCC SOCI₂ D A HBr A OH 1. Na 2. CH₂Cl conc H₂SO4 B H₂CrO4 conc HCI PBr3 D B conc H₂SO4…
A: Step 1: Step 2: Step 3: Step 4:
Q: Please answer and solve these two question!!! Make sure its handwritten(NOT TYPED) and legible!!
A: Q5Q6
Q: ) For each compound, identify as high or low spin and specify the number of unpaired electrons:…
A: Step 1: 0 Step 2: Step 3: Step 4:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Step 2: Lithium aluminum hydride(LiAlH4) is a powerful reducing agent used in chemistry. It…
Q: Please help me solve the following question, explain and make sure everything is correct, thanks…
A:
Q: How much water is needed to prepare 100 mL of a 0.117 M solution of Ca(NO3)2 (164.09 g/mol) if 160 g…
A: Step 1: Calculate the moles of Ca(NO3)2 dissolved. Moles of Ca(NO3)2 = Mass of Ca(NO3)2 /…
Q: 4. Explain the Hybridization around all the atoms for NO2 Hybridization steps N -1 Isolated atoms…
A: In the first step, we need to identify the number of valence electrons for each atom in the NO2…
Q: The density of a gas is 0.980 g/L at 25°C and 365 torr. Calculate the molar mass of the gas.
A: Thank you.
Q: a. b. Credit: Smith, Organic Chemistry • Build the model of each E2 elimination product. • Take a…
A: Please see the 3D models of the reactions and products for (a) (b) These 3D pictures depict the…
Q: Calculate the pH at each point of a titration where 30.0 ml of 0.25M HNO, are titrated with the…
A: various points during the titration of 30.0 mL of 0.25 M HNO3 with 0.15 M LiOH. Here's how to…
Q: Please don't provide handwritten solution...
A: Step 1 Step 2 Step 3 : Step 4
Q: 2. Thin layer chromatography was performed to find the most effective mobile phase needed to…
A: Step 1: The thin-layer chromatography (TLC) results provide insight into the effectiveness of…
Q: Numbering the main chain of branched alkanes For each organic compound in the table below, enter the…
A: Step 1:Step 2:Step 3:
Q: What is the correct structure for N-butyl-butanamide? О IZ О H IN О O
A: The name 'N-butyl-butanamide' gives us information about the structure of the molecule. 'Butanamide'…
Q: 3 moles of liquid water at 100\deg C and 1 atm go to the vapor phase at 160\deg C and 0.5 atm.…
A: To calculate the changes in enthalpy (ΔH), entropy (ΔS), Gibbs free energy (ΔG), and Helmholtz free…
Q: S2O3:2 + H3O+ = SO2 + H2O + S what is the activation energy of this reaction which has to be taken…
A:
Step by step
Solved in 2 steps
- 4. Draw the line structure for the ester that can be formed from the reaction of the acid anhydride and the alcohol given below. :0: :0: HO CH3-CH2-C-o-C-CCH2-CH3 acid anhydride alcohol6. Write the structure of the following compounds. a. 4 - ethyl - 2 - hexoneb. 2-ethyl - 3 – pentanoic acidIt has been suggested that the following compound was incorrectly named trans-3,5-dimethyl-4- propylnon-3-ene. What is the correct IUPAC name for the compound? A. cis-3,5-dimethyl-4-propylnon-3-ene trans-4(2-hexane)3methylhept-3-ene B. C. trans-4-propyl 3,5-dimethylnon-3-ene D. cis-4(2-hexane)3methylhept-3-ene E. trans-3,5-dimethyl-4-propylnon-3-ene
- Propyl-3-ethyl pentanoate WHAT IS THE 1.Common name 2.Condensed formula 3. Type of Compound and Functional groupFunctional Group Classes Alcohol Amide Ester • CH₂CH₂OH * CHIO-CH, 7. H₂C1O Amine Ketone Circle each functional group(s) and identify the class to which each of the groups belongs. 9. H₂C Aldehyde Thiol Aromatics Carboxylic Acid 2. CH,SH 6. Alkenes 4. H₂NCH₂CH₂ 10. Ether NM₂ 11. Which of the functional groups in the top list must be on a terminalC in the carbon chain?1. Amines are classified according to the number of alkyl or aryl groups directly attached to a certain atom in the molecule. What atom is this? 2. Draw examples of a primary, secondary, and tertiary amine. Secondary Primary H N-CH3 Tertiary CHS N-CH3 CH CHa N-CHS 3. What are the names of CH3CH2-NH, in the IUPAC and common naming systems? 4. Complete the following equation and name the organic reactants and products. CH,NH, (aq) + H,O = 5. What is the general name of the product of the neutralization reaction between an alkylamine and an acid? AIKVI Ammonium Salt la
- 15. Which of the following statements incorrectly describes alcohols? Straight chain isomers will have a higher boiling point than the branched molecule. The solubility of an alcohol is affected by the length of its carbon chain. The boiling point of an alcohol is affected by the length of its carbon chain. The solubility of an alcohol is affected by the shape of the molecule.QUESTION 1 What is the class name of the following structures? CH3 L. CH CH2 CH3 CH2 CH2 HO, O A. Aldehyde O B. Ketone OC. Alcohol O D.Carboxylic Acid O E. Carboxylate Salt OF. Ester QUESTION 2 What is the class name of the following structures? CH3 CH CH CH CH2 CH2 CH2 OK OA Aldehyde ОВ. Ketone OC. Alcohol OD.Carboxylic Acid O E Carboxylate Salt OF. EsterWhich isomer of C3H6O2 would be more soluble in water? a. the carboxylic acid isomer b. the ester isomer c. both isomers should be equally soluble in water
- What are the major products of the reaction of ethyl benzoate with hydrochloric acid and water? a. acetic acid and toluene b. phenylic acid and ethanol C. ethanoic acid and benzene d. benzoic acid and ethanol e. phenylic acid and methanol O a O b1. Draw the Full Lewis chemical structure of a simple ester of your choice containing exactly five carbon atoms.1. Can the compound KCIO3 dissolve in an organic solvent? A. Yes because it is an organic compound. B. Yes because it is an ionic compound. C. No because it is an ionic compound. D. No because it is an organic compound.
