A bomb calorimeter, or constant volume calorimeter, is a device often used to determine the heat of combustion of fuels and the energy available from foods. Since the "bomb" itself can absorb energy, a separate experiment is needed to determine the heat capacity of the calorimeter. This is known as calibrating the calorimeter. In the laboratory a student burns a 0.461-g sample of 2-naphthylacetic acid (C12H100,) in a bomb calorimeter containing 1150. g water. The temperature increases from 24.70 °C to 27.20 °C. The specific heat capacity of water is 4.184 J g1 °C1, The combustion enthalpy is -5779 kJ/mol 2-naphthylacetic acid. C12H1002(s) + 27/2 02(g)12 CO2(g) + 5 H20(1) A,H° = -5779 kJ/mol Calculate the heat capacity of the calorimeter. heat capacity of calorimeter

A bomb calorimeter, or constant volume calorimeter, is a device often used to determine the heat of combustion of fuels and the energy available from foods. Since the "bomb" itself can absorb energy, a separate experiment is needed to determine the heat capacity of the calorimeter. This is known as calibrating the calorimeter. In the laboratory a student burns a 0.461-g sample of 2-naphthylacetic acid (C12H100,) in a bomb calorimeter containing 1150. g water. The temperature increases from 24.70 °C to 27.20 °C. The specific heat capacity of water is 4.184 J g1 °C1, The combustion enthalpy is -5779 kJ/mol 2-naphthylacetic acid. C12H1002(s) + 27/2 02(g)12 CO2(g) + 5 H20(1) A,H° = -5779 kJ/mol Calculate the heat capacity of the calorimeter. heat capacity of calorimeter

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter8: Thermochemistry

Section: Chapter Questions

Problem 88QAP: A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is...

See similar textbooks

Similar questions

A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
You did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.
In a coffee-cup calorimeter, 100.0 mL of 1.0 M NaOH and 100.0 mL of 1.0 M HCI are mixed. Both solutions were originally at 24.6C. After the reaction, the final temperature is 31.3C. Assuming that all the solutions have a density of 1.0 g/cm3 and a specific heat capacity of 4.18 J/Cg, calculate the enthalpy change for the neutralization of HCl by NaOH. Assume that no heat is lost to the surroundings or to the calorimeter.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Nitrogen gas is confined in a cylinder with a movable piston under a constant pressure of 9.95 104 Pa. When 695 J of energy in the form of heat is transferred from the gas to the surroundings, its volume decreases by 1.88 L. What is the change in internal energy of the gas?
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?