R11abA chemical reaction takes place inside a flask submerged in a water bath. The water bath contains 9.30 kg of water at 33.1 °C. During the reaction 52.2 kJ ofheat flows out of the bath and into the flask.Microsoft CCalculate the new temperature of the water bath. You can assume the specific heat capacity of water under these conditions is 4.18 J-g¹K¹. Be sure youranswer has the correct number of significant digits.WlockMicrosoftMicrosoft6.52.210...esc0°Ccontrol106I Don't Know!1QAľoptionN2Submit9,066WSXHcommandCa20#3EDX.14NOV30$4RFŚ07 dº%5C VTGtvMacBook Pro6BY&7HⒸ2022 McGraw Hill LLC. All Rights Reserved. Terms of Use | Privacy Center | AccessibilityUN* 008JMIM9AKOOLWPI+ 11[?command optiondAr1

Answered: Image /qna-images/answer/c3d35e1d-72fb-4da8-9b59-ca82bb99b89e.jpg

A chemical reaction takes place inside a flask submerged in a water bath. The water bath contains 9.30 kg of water at 33.1 °C. During the reaction 52.2 kJ of heat flows out of the bath and into the flask. -1. -1 Calculate the new temperature of the water bath. You can assume the specific heat capacity of water under these conditions is 4.18 J-g K answer has the correct number of significant digits. Be sure your

A chemical reaction takes place inside a flask submerged in a water bath. The water bath contains 9.30 kg of water at 33.1 °C. During the reaction 52.2 kJ of heat flows out of the bath and into the flask. -1. -1 Calculate the new temperature of the water bath. You can assume the specific heat capacity of water under these conditions is 4.18 J-g K answer has the correct number of significant digits. Be sure your

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 100AE

See similar textbooks

Similar questions

A 237-g piece of molybdenum, initially at 100.0 C, is dropped into 244 g of water at 10.0 C. When the system comes to thermal equilibrium, the temperature is 15.3 C. What is the specific heat capacity of molybdenum?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
A sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?
When 1.0 g of fructose, C6H12O6(s), a sugar commonly found in fruits, is burned in oxygen in a bomb calorimeter, the temperature of the calorimeter increases by 1.58 C. If the heat capacity of the calorimeter and its contents is 9.90 kJ/C, what is q for this combustion?
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
Dry ice is solid carbon dioxide; it vaporizes at room temperature and normal pressures to the gas. Suppose you put 21.5 g of dry ice in a vessel fitted with a piston (similar to the one in Figure 6.9 but with the weight replaced by the atmosphere), and it vaporizes completely to the gas, pushing the piston upward until its pressure and temperature equal those of the surrounding atmosphere at 24.0C and 751 mmHg. Calculate the work done by the gas in expanding against the atmosphere. Neglect the volume of the solid carbon dioxide, which is very small in comparison to the volume of the gas phase.