A d¹ octahedral complex is found to absorb visible light, with the absorption maximum occurring at 521 nm.Calculate the crystal-field splitting energy, A, in kJ/mol.A =4IncorrectA will decreaseA will increaseA will remain constantIncorrect3+If the complex has a formula of [M(H₂O)]³+, what effect will replacing the 6 aqua ligands with 6 Cl- ligands have on A?kJ/mol

The splitting of degenerate level in the presence of ligand is known as crystal field splitting. The…

A d¹ octahedral complex is found to absorb visible light, with the absorption maximum occurring at 521 nm. Calculate the crystal-field splitting energy, A, in kJ/mol. Δ= 4 Incorrect kJ/mol If the complex has a formula of [M(H₂O)]³+, what effect will replacing the 6 aqua ligands with 6 Cl¯ ligands have on A? A will decrease

A d¹ octahedral complex is found to absorb visible light, with the absorption maximum occurring at 521 nm. Calculate the crystal-field splitting energy, A, in kJ/mol. Δ= 4 Incorrect kJ/mol If the complex has a formula of [M(H₂O)]³+, what effect will replacing the 6 aqua ligands with 6 Cl¯ ligands have on A? A will decrease

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 73QRT

See similar textbooks

Similar questions

Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
For each d electron configuration, state the number of unpaired electrons expected in octahedral complexes. Give an example complex for each case. (Two answers are possible for some of these cases.) (a) d2 (b) d4 (c) d6 (d) d8
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?