Electrical Potentials (25°C, 1 atm or 1 mol/L)E°(V)Lit + e-Li-3.040Ca2+ + 2eСа-2.868Na* + e-Na-2.714Mg2+ + 2e-A13+ + 3e-Mg-2.372Al-1.6622H20 + 2е-H2 + 2 OH--0.828Zn2+ + 2eZn-0.762Cr+ + 3e-Cr-0.744Ag2S + 2e-S+ 2eFe2+ + 2e-2 Ag + S?-S2--0.691-0.476Fe-0.447Cr** +eCr2+-0.407PBSO4 + 2e-Pb + SO42--0.359Ni2+ + 2e-Ni-0.257AgI +e-Sn²+ + 2e-Ag +I-0.152Sn-0.138Pb2+ + 2ePb-0.1262H* + 2eH20.000AgBr + e-Sn4+ + 2eAg + BrSn2+0.0710.151AgCl + e-Cu2+ + 2eAg + CH0.222Cu0.342I2 + 2e-O2 + 2H* + 2eFe3+ + e2 I-0.536H2O20.695Fe2+0.771Ag+ +e-Hg²+ + e-0.799AgHg0.851Br2 + 2e2 Br1.066O2 + 4H+ + 4e2 H2O1.229Cl2 + 2ePbO2 + SO42- + 4H+ + 2e-O3 + 2H* + 2e2 C-1.358PBSO4 + 2 H20O2 + H202 F-1.6912.076F2 + 2e-2.8661L 1L 11 1L 1L 1L 1L 1L 11 1L 1L 1L 1L1L 1L 1L 1L 11 1L 1L 1L 11L 1L 1L 1L 11 1L 11 A galvanic cell is constructed of two half cells Zn2*(aq)/Zn(s) and H2(g)/H*(aq) separated by a saltbridge. When [Zn2*] = 1.0 M and P(H2) = 1.0 atm, the emf of this cell is found to be E = 0.685 V at%3D25 °C.Use standard electrode potential p. 901 Tro textbook 4th Ed.a) Write a balanced redox reaction that occurs in the galvanic cell.b) Indicate the half reaction that happens in each half cell.c) Indicate the anode AND the cathoded) Calculate the H*(aq) concentration.

Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

A galvanic cell is constructed of two half cells Zn2+*(aq)/Zn(s) and H2(g)/H*(aq) separated by a salt bridge. When [Zn²*] = 1.0 M and P(H2) = 1.0 atm, the emf of this cell is found to be E = 0.685 V at %3D %3D 25 °C. Use standard electrode potential p. 901 Tro textbook 4th Ed. a) Write a balanced redox reaction that occurs in the galvanic cell. b) Indicate the half reaction that happens in each half cell. c) Indicate the anode AND the cathode

A galvanic cell is constructed of two half cells Zn2+(aq)/Zn(s) and H2(g)/H(aq) separated by a salt bridge. When [Zn²*] = 1.0 M and P(H2) = 1.0 atm, the emf of this cell is found to be E = 0.685 V at %3D %3D 25 °C. Use standard electrode potential p. 901 Tro textbook 4th Ed. a) Write a balanced redox reaction that occurs in the galvanic cell. b) Indicate the half reaction that happens in each half cell. c) Indicate the anode AND the cathode

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag