A generic solid, X, has a molar mass of 78.7 g/mol. In a constant-pressure calorimeter, 21.2 g of X is dissolved in 299 g of water at 23.00 °C. X(s) – X(aq) The temperature of the resulting solution rises to 26.70 °C. Assume the solution has the same specific heat as water, 4.184 3/(g C), and that there is negligible heat loss to the surroundings. How much heat was absorbed by the solution? kJ What is the enthalpy of the reaction? AH kJ/mol

A generic solid, X, has a molar mass of 78.7 g/mol. In a constant-pressure calorimeter, 21.2 g of X is dissolved in 299 g of water at 23.00 °C. X(s) – X(aq) The temperature of the resulting solution rises to 26.70 °C. Assume the solution has the same specific heat as water, 4.184 3/(g C), and that there is negligible heat loss to the surroundings. How much heat was absorbed by the solution? kJ What is the enthalpy of the reaction? AH kJ/mol

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 104AE

See similar textbooks

Similar questions

A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
Nitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
The addition of 3.15 g of Ba(OH)28H2O to a solution of 1.52 g of NH4SCN in loo g of water in a calorimeter caused the temperature to fall by 3.1 C. Assuming the specific heat of the solution and products is 4.20 J/g C, calculate the approximate amount of heat absorbed by the reaction, which can be represented by the following equation: Ba(OH)28H2O(s)+2NH4SCN(aq)Ba(SCN)2(aq)+2NH3(aq)+10H2O(l)
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?
When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?
One step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?